Download |
||
|
Name |
DOWNLOAD Copy Link | |
|
Total Size |
37.6 GB |
|
|
Total Files |
3930 |
|
|
Hash |
34C7B283A37C19522D770570F5F95472BBA5AAAA |
|
/!!! (Chk Chk Chk) - Jamie, My Intentions Are Bass [EP] (2010)/ |
|
|
|
18.3 MB |
|
05 Steady As the Sidewalk Cracks (Tim Goldsworthy Remix).mp3 |
18.1 MB |
|
|
14.9 MB |
|
|
14.7 MB |
|
|
14.0 MB |
|
|
12.3 MB |
|
|
53.7 KB |
|
/+Verb - Sensual Frequencies (CCS2033) [EP] (2010)/ |
|
|
|
10.8 MB |
|
|
9.6 MB |
|
|
9.5 MB |
|
|
8.9 MB |
|
|
410.2 KB |
|
/7he Myriads - Running Man [EP] (2010)/ |
|
|
|
21.9 MB |
|
|
18.1 MB |
|
|
11.8 MB |
|
|
10.0 MB |
|
|
9.2 MB |
|
|
8.5 MB |
|
|
83.9 KB |
|
/A1 Bassline - Breathless (ECB226D) [EP] (2010)/ |
|
|
|
11.8 MB |
|
|
11.5 MB |
|
|
245.8 KB |
|
/AC Slater - Calm Down Trilogy (TBD044) [EP] (2010)/ |
|
|
|
11.4 MB |
|
|
10.0 MB |
|
|
9.1 MB |
|
|
8.4 MB |
|
|
595.0 KB |
|
/AC Slater - Take You (TBD029) (2010)/ |
|
|
|
17.3 MB |
|
|
15.4 MB |
|
|
15.1 MB |
|
|
12.3 MB |
|
|
11.9 MB |
|
|
11.5 MB |
|
|
8.6 MB |
|
|
7.2 MB |
|
|
7.2 MB |
|
|
873.9 KB |
|
/Acid Washed - Acid Washed [EP] (2010)/ |
|
|
|
20.3 MB |
|
|
17.1 MB |
|
|
16.5 MB |
|
|
13.6 MB |
|
|
11.0 MB |
|
|
10.7 MB |
|
|
9.7 MB |
|
|
8.8 MB |
|
|
8.3 MB |
|
|
64.1 KB |
|
/Acidkids - Greek Geek (ACDKDS005-A) [EP] (2010)/ |
|
|
|
12.6 MB |
|
|
12.6 MB |
|
|
12.2 MB |
|
|
11.4 MB |
|
|
169.6 KB |
|
|
0.6 KB |
|
/Act Yo Age - Love From Below (ECB237D) [EP] (2010)/ |
|
|
|
17.5 MB |
|
|
17.0 MB |
|
|
16.0 MB |
|
|
15.6 MB |
|
|
13.6 MB |
|
|
13.5 MB |
|
|
12.8 MB |
|
|
12.6 MB |
|
|
11.2 MB |
|
|
229.0 KB |
|
/Adam Freeland - How To Fake Your Own Life (MAPA058) [EP] (2010)/ |
|
|
02-adam_freeland-how_to_fake_your_own_life__etienne_de_crecy_remix.mp3 |
17.9 MB |
|
|
13.6 MB |
|
03-adam_freeland-how_to_fake_your_own_life__om_unit_remix.mp3 |
12.7 MB |
|
|
118.6 KB |
|
/Aeons - Beyond The Satellites EP (2010)/ |
|
|
|
12.4 MB |
|
|
11.8 MB |
|
|
9.4 MB |
|
|
9.3 MB |
|
|
8.8 MB |
|
|
25.7 KB |
|
/Aeroplane - We Cant Fly EP (2010)/ |
|
|
|
10.9 MB |
|
|
7.0 MB |
|
|
27.5 KB |
|
/Aeroplane - Without Lies (541416503990D) [EP] (2010)/ |
|
|
|
14.4 MB |
|
|
9.1 MB |
|
|
5.3 MB |
|
|
9.2 KB |
|
/Aerotronic - Sex & Cigarettes (MHTRSH01) [EP] (2010)/ |
|
|
|
11.1 MB |
|
|
10.8 MB |
|
|
10.8 MB |
|
|
10.3 MB |
|
|
9.5 MB |
|
|
8.2 MB |
|
|
51.6 KB |
|
/Africa Hitech - Blen - (2010)/ |
|
|
|
14.3 MB |
|
|
11.5 MB |
|
|
8.7 MB |
|
|
8.7 MB |
|
|
294.8 KB |
|
/Ajapai - Mobilized (ROTD026) [EP] (2010)/ |
|
|
|
12.8 MB |
|
|
12.2 MB |
|
|
10.9 MB |
|
|
10.9 MB |
|
|
53.1 KB |
|
/Alan Gay - Bastardrave [EP] (2009)/ |
|
|
|
19.0 MB |
|
|
15.9 MB |
|
|
10.7 MB |
|
|
8.3 MB |
|
|
366.4 KB |
|
|
10.9 KB |
|
/Alan Made - Show You How (MIXMA028) [EP] (2010)/ |
|
|
|
16.7 MB |
|
|
12.9 MB |
|
|
12.9 MB |
|
|
12.8 MB |
|
04 Alan Made - Show You How - Oliver Twizt Dubstep Remix.mp3 |
11.1 MB |
|
|
77.9 KB |
|
/Alexander Robotnick - Fischio [EP] (HEM0307) (2010)/ |
|
|
|
20.7 MB |
|
07- Alexander Robotnick - Fischionovo (Louis Guilliaume Remix).mp3 |
20.1 MB |
|
09- Alexander Robotnick - Fischionovo (Louis Guilliaume Ambient Dub).mp3 |
19.0 MB |
|
08- Alexander Robotnick - Fischionovo (Guglielmo Mascio Remix).mp3 |
14.7 MB |
|
|
14.1 MB |
|
|
13.9 MB |
|
02- Alexander Robotnick - Fischio (Matt Nee Kompute Remix).mp3 |
11.7 MB |
|
|
11.6 MB |
|
|
9.8 MB |
|
|
30.7 KB |
|
/Ali Love - Smoke And Mirrors [EP] (2010)/ |
|
|
|
10.9 MB |
|
|
9.5 MB |
|
|
8.3 MB |
|
|
4.6 MB |
|
|
43.2 KB |
|
/All Leather - When I Grow Up, I Wanna Fuck Like A Girl (DM182) [Remixes EP] (2010)/ |
|
|
|
14.5 MB |
|
|
14.3 MB |
|
|
12.9 MB |
|
|
11.7 MB |
|
|
11.6 MB |
|
|
11.2 MB |
|
|
10.7 MB |
|
|
10.3 MB |
|
|
9.7 MB |
|
|
9.2 MB |
|
|
6.9 MB |
|
|
6.8 MB |
|
|
5.7 MB |
|
|
5.1 MB |
|
|
4.1 MB |
|
|
725.2 KB |
|
/Andy Cato (Groove Armada) - That Bassline Track (GDM014) [EP] (2010)/ |
|
|
|
19.2 MB |
|
|
19.1 MB |
|
|
17.5 MB |
|
|
8.3 KB |
|
/Andy Murphy - Reach For The Lazers (OMG124) [EP] (2010)/ |
|
|
|
16.8 MB |
|
|
15.0 MB |
|
|
13.3 MB |
|
|
13.1 MB |
|
|
108.0 KB |
|
/Aniki - Soul for Hire (OMG025) [EP] (2010)/ |
|
|
|
20.2 MB |
|
|
14.2 MB |
|
|
12.8 MB |
|
|
12.6 MB |
|
|
97.3 KB |
|
/Anoraak - Try Me [EP] (2010)/ |
|
|
|
17.3 MB |
|
|
14.5 MB |
|
|
12.9 MB |
|
|
8.9 MB |
|
|
8.1 MB |
|
|
7.7 MB |
|
|
7.6 MB |
|
|
19.9 KB |
|
/Anthony Rother - Disco Light (WEB-2010)/ |
|
|
|
20.3 MB |
|
|
18.3 MB |
|
|
6.3 KB |
|
/Appleblim & Ramadanman - Void 23 (AUS1031) [EP] (2010)/ |
|
|
|
22.1 MB |
|
|
22.0 MB |
|
|
21.0 KB |
|
|
2.1 KB |
|
/Armand Van Helden and Steve Aoki - Brrrat [EP] (2010)/ |
|
|
|
13.2 MB |
|
|
12.0 MB |
|
|
9.4 MB |
|
|
407.2 KB |
|
/Art vs. Science - Magic Fountain [EP] (2010)/ |
|
|
|
14.2 MB |
|
|
13.7 MB |
|
|
12.1 MB |
|
|
11.6 MB |
|
|
11.3 MB |
|
|
58.4 KB |
|
|
50.7 KB |
|
|
40.3 KB |
|
/Attack1985 - Intruder (MAKO007) [EP] (2010)/ |
|
|
|
14.4 MB |
|
|
13.7 MB |
|
|
12.5 MB |
|
|
11.8 MB |
|
|
11.8 MB |
|
|
139.7 KB |
|
/Audiofun - Factory (ECB236D) [EP] (2010)/ |
|
|
|
13.9 MB |
|
|
13.5 MB |
|
|
12.8 MB |
|
|
12.3 MB |
|
|
11.9 MB |
|
|
11.7 MB |
|
|
655.2 KB |
|
/aUTOdiDakT - Here We Go (TRAK014) [EP] (2010)/ |
|
|
01. Autodidakt - Here We Go (Feat. Super Super) (Original Version) (320).mp3 |
13.1 MB |
|
02. Autodidakt - Here We Go (Feat. Super Super) (Distrakt Remix) (320).mp3 |
12.4 MB |
|
06. Autodidakt - Here We Go (Feat. Super Super) (Distrakt Alternate Remix) (320).mp3 |
10.6 MB |
|
03. Autodidakt - Here We Go (Feat. Super Super) (Gooseflesh Remix) (320).mp3 |
10.3 MB |
|
04. Autodidakt - Here We Go (Feat. Super Super) (Super Noize Generation Remix) (320).mp3 |
9.9 MB |
|
07. Autodidakt - Here We Go (Feat. Super Super) (LaСlopeAuBec Remix) (320).mp3 |
8.6 MB |
|
05. Autodidakt - Here We Go (Feat. Super Super) (Lazy Ants Remix) (320).mp3 |
8.5 MB |
|
|
113.6 KB |
|
/Autoerotique & SonicC - KMA (DM188) [EP] (2010)/ |
|
|
02 Autoerotique, SonicC - KMA - Rynecologist AA Stock Remix.mp3 |
15.2 MB |
|
|
14.8 MB |
|
|
12.9 MB |
|
|
12.3 MB |
|
|
12.2 MB |
|
|
105.6 KB |
|
/Azari & III - Indigo (TURBO085) [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
14.9 MB |
|
|
13.8 MB |
|
|
11.5 MB |
|
|
41.6 KB |
|
/Azari & III - Into The Night [EP] (2010)/ |
|
|
|
25.5 MB |
|
|
18.8 MB |
|
06 Into The Night (Troxler, Masomenos & Jaw - Live In Paris Mix).mp3 |
18.7 MB |
|
|
17.6 MB |
|
|
15.1 MB |
|
|
12.7 MB |
|
|
123.3 KB |
|
/Azari & III - Reckless With Your Remix 01 (PERMVAC0631) [EP] (2010)/ |
|
|
|
19.4 MB |
|
|
16.9 MB |
|
2 - Reckless With Your Love (Good Guy Mikesh Filburt Remix).mp3 |
15.4 MB |
|
|
12.1 MB |
|
|
28.7 KB |
|
/Azari And III - Reckless With Your Remix 02 (PERMVAC067-1) (2010)/ |
|
|
|
22.0 MB |
|
03- Reckless With Your Love (DJ Sneak's Stereo Gangstaz Dub Mix).mp3 |
18.4 MB |
|
04- Reckless With Your Love (Manuel Tur's Tin Cry Remix).mp3 |
16.4 MB |
|
01- Reckless With Your Love (DJ Sneak's Stereo Gangstaz Remix).mp3 |
14.7 MB |
|
|
260.5 KB |
|
/Babe And Terror - Summertime Our League (PH11) [EP] (2010)/ |
|
|
|
20.3 MB |
|
|
19.0 MB |
|
|
16.5 MB |
|
|
54.2 KB |
|
/Bambounou - Animism [EP] (2010)/ |
|
|
|
14.2 MB |
|
|
13.7 MB |
|
|
13.5 MB |
|
|
13.2 MB |
|
|
12.4 MB |
|
|
11.5 MB |
|
|
9.9 MB |
|
|
76.1 KB |
|
/Baobinga - Riddim Team EP (2010)/ |
|
|
|
9.8 MB |
|
|
9.8 MB |
|
|
9.3 MB |
|
|
8.1 MB |
|
|
7.8 MB |
|
|
7.7 MB |
|
|
7.7 MB |
|
|
122.2 KB |
|
/Bart B More - Brap EP (2010)/ |
|
|
|
15.8 MB |
|
|
7.9 MB |
|
/Bart B More, Nom De Strip & Little Bastard - Bollymore (OMG142) [EP] (2010)/ |
|
|
Bart B More,Nom De Strip & Little Bastard - Jailbait (Original Mix).mp3 |
16.2 MB |
|
Bart B More,Nom De Strip & Little Bastard - Bollymore (Original Mix).mp3 |
13.7 MB |
|
|
260.6 KB |
|
/Basement Jaxx - Dracula [Single] (2010)/ |
|
|
|
10.5 MB |
|
|
9.9 MB |
|
|
24.2 KB |
|
IndieBubbles.com - All Indie and Electro For Free Download.url |
0.1 KB |
|
/Bassanovva - Chicken Lover [EP] (2010)/ |
|
|
|
16.1 MB |
|
|
15.5 MB |
|
|
12.6 MB |
|
|
12.1 MB |
|
04-bassanovva-chicken_lover__munchi_likes_em_fried_moombahton_remix.mp3 |
11.2 MB |
|
|
11.1 MB |
|
|
10.1 MB |
|
|
9.8 MB |
|
|
105.2 KB |
|
|
0.8 KB |
|
/Bassnectar - Wildstyle [EP] (2010)/ |
|
|
|
15.7 MB |
|
|
14.2 MB |
|
|
14.1 MB |
|
|
10.9 MB |
|
|
10.4 MB |
|
|
10.3 MB |
|
|
8.4 MB |
|
|
39.4 KB |
|
/Bazooka Boom - Big Bada Boom (MAKOFREE02) [EP] (2010)/ |
|
|
|
12.6 MB |
|
04_Bazooka_Boom_Big_Bada_Boom_Alien_Delon_High_Tension_Remix.mp3 |
12.5 MB |
|
|
11.4 MB |
|
|
7.7 MB |
|
|
513.0 KB |
|
/Bear in Heaven - Beast Rest Forth Mouth Remixed [CD] (2010)/ |
|
|
|
15.9 MB |
|
01 Beast In Peace (The Hundred In The Hands Beast in Beat Remix).mp3 |
14.1 MB |
|
|
13.3 MB |
|
|
10.3 MB |
|
|
9.6 MB |
|
|
9.3 MB |
|
|
7.2 MB |
|
|
7.2 MB |
|
|
5.9 MB |
|
|
5.8 MB |
|
|
275.0 KB |
|
|
224.0 KB |
|
|
219.2 KB |
|
/Beataucue - Cha Cha Cha (2010)/ |
|
|
|
13.3 MB |
|
|
13.0 MB |
|
|
12.5 MB |
|
|
12.4 MB |
|
|
12.4 MB |
|
|
10.8 MB |
|
|
10.4 MB |
|
|
595.7 KB |
|
/Benga Feat. Youngman - Ho One & Only (SBOY034) [EP] (2010)/ |
|
|
|
11.2 MB |
|
|
8.9 MB |
|
|
430.7 KB |
|
/Benny Benassi - House Music (UL2658) [EP] (2010)/ |
|
|
03-benny_benassi-house_music_(autoerotiques_explode_the_club_remix).mp3 |
12.8 MB |
|
|
10.8 MB |
|
|
9.7 MB |
|
|
158.9 KB |
|
|
4.0 KB |
|
/Benny Rodrigues - Rotterdam Rave (EP) [BNRTRAX003] (2010)/ |
|
|
|
17.0 MB |
|
|
16.7 MB |
|
|
15.5 MB |
|
|
45.4 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Bert On Beats Feat. MC G - Alemao (MAN052) [EP] (2010)/ |
|
|
|
13.9 MB |
|
Bert_On_Beats_-_Alemao_(feat_MC_Gi_-_Bambounou_remix)_320.mp3 |
12.9 MB |
|
|
11.2 MB |
|
Bert_On_Beat_-_Alemao_(Beat_Laden_remix_-_feat_MC_Gi)_320.mp3 |
11.0 MB |
|
|
11.0 MB |
|
|
11.0 MB |
|
Bert_On_Beats_-_Alemao_(feat_MC_Gi_-_Schlachthofbronx_remix)_320.mp3 |
8.4 MB |
|
|
180.7 KB |
|
/Best Of Pickadolls [Compilation] (2010)/ |
|
|
|
162.9 MB |
|
|
14.7 MB |
|
|
12.7 MB |
|
|
6.2 MB |
|
|
2.0 KB |
|
/Bird Peterson - Zutopong (RIOT007) [EP] (2010)/ |
|
|
|
15.7 MB |
|
Bird_Peterson_-_Zutopong_(Bird_Peterson_Rinseout_remix)_320.mp3 |
13.8 MB |
|
|
11.5 MB |
|
|
11.3 MB |
|
|
10.3 MB |
|
|
10.1 MB |
|
|
279.3 KB |
|
/Black Strobe - Me & Madonna (KITSUNE123) [EP] (2010)/ |
|
|
|
21.4 MB |
|
|
13.0 MB |
|
|
12.6 MB |
|
|
12.6 MB |
|
|
10.0 MB |
|
|
230.2 KB |
|
|
0.1 KB |
|
/Blende - Urh! (RIOT006) [EP] (2010)/ |
|
|
|
12.8 MB |
|
|
11.7 MB |
|
|
11.5 MB |
|
|
359.1 KB |
|
/Blowmud - Tracks & Remixes (2010)/ |
|
|
|
17.1 MB |
|
|
16.3 MB |
|
|
13.5 MB |
|
|
13.1 MB |
|
|
12.1 MB |
|
|
12.0 MB |
|
|
11.6 MB |
|
|
185.8 KB |
|
/Bob Holroyd - African Drug (PHONICA006) [EP] (2010)/ |
|
|
|
28.4 MB |
|
|
20.9 MB |
|
|
14.2 MB |
|
|
9.5 MB |
|
|
39.5 KB |
|
/Bobmo - Bring It [EP] (2010)/ |
|
|
|
13.0 MB |
|
|
12.4 MB |
|
|
9.7 MB |
|
|
8.9 MB |
|
|
79.1 KB |
|
/Bodi Bill - I Like Holden Caulfield (SR034_1) [EP] (2010)/ |
|
|
|
8.2 MB |
|
|
6.6 MB |
|
|
5.9 MB |
|
|
65.5 KB |
|
/Boemklatsch - Noisy [EP] (2010)/ |
|
|
|
12.0 MB |
|
|
10.7 MB |
|
|
9.8 MB |
|
|
8.8 MB |
|
|
8.7 MB |
|
|
6.7 MB |
|
|
6.0 MB |
|
|
223.8 KB |
|
|
51.9 KB |
|
|
39.7 KB |
|
/Bok Bok & Cubic Zarkonia - Hoes Come Out At Night (NSWL005) [Vinyl] (2010)/ |
|
|
|
13.9 MB |
|
|
11.3 MB |
|
|
164.1 KB |
|
/Booka Shade - Regenerate (BOOKA005) [EP] (2010)/ |
|
|
|
19.6 MB |
|
|
18.6 MB |
|
|
17.7 MB |
|
|
17.5 MB |
|
|
17.1 MB |
|
|
13.3 MB |
|
|
153.2 KB |
|
/Booka Shade - Teenage Spaceman (BOOKA004) [Remixes EP] (2010)/ |
|
|
|
14.5 MB |
|
05-booka_shade-teenage_spaceman_(tim_deluxe_future_disco_remix).mp3 |
11.7 MB |
|
|
9.4 MB |
|
|
8.3 MB |
|
|
5.2 MB |
|
|
56.6 KB |
|
|
1.0 KB |
|
/Bostro Pesopeo - Anantes (PERMVAC066-1) [EP] (2010)/ |
|
|
06-bostro_pesopeo-basic_feat._billie_ray_martin__hard_ton_remix.mp3 |
17.3 MB |
|
05-bostro_pesopeo-anantes__contra_communem_opinonem_remix.mp3 |
16.3 MB |
|
|
14.8 MB |
|
|
14.6 MB |
|
|
14.6 MB |
|
|
11.1 MB |
|
|
270.0 KB |
|
|
0.7 KB |
|
/Bottin & Rodion - Galli (Give It Up) - Piazza Venezia EP (2010)/ |
|
|
|
18.8 MB |
|
|
13.4 MB |
|
|
11.4 KB |
|
/Bottin - Discocracy-August [EP] (541416_503808D) (2010)/ |
|
|
|
16.8 MB |
|
|
14.0 MB |
|
|
152.0 KB |
|
/Bowski - Leggings & Talkbox (FBLOOD002) [EP] (2010)/ |
|
|
|
12.7 MB |
|
|
12.5 MB |
|
|
10.1 MB |
|
|
152.7 KB |
|
/Boy 8-bit - Yard Birds [EP] (Turbo086) (2010)/ |
|
|
|
19.7 MB |
|
|
16.2 MB |
|
|
14.0 MB |
|
|
124.8 KB |
|
/Boys Noize - 1010 & Yeah (BNR050D) [EP] (2010)/ |
|
|
|
13.3 MB |
|
|
12.9 MB |
|
|
410.5 KB |
|
|
51.1 KB |
|
|
49.5 KB |
|
|
1.8 KB |
|
/Boys Noize - Miami Noize 2010/ |
|
|
|
13.1 MB |
|
|
12.9 MB |
|
|
12.7 MB |
|
|
11.8 MB |
|
|
11.5 MB |
|
|
10.9 MB |
|
|
9.9 MB |
|
|
8.3 MB |
|
/Boys Noize - Nott [Single] (8 November, 2010 Boysnoize)/ |
|
|
|
14.0 MB |
|
|
13.7 MB |
|
|
12.9 MB |
|
|
12.7 MB |
|
|
128.2 KB |
|
|
0.6 KB |
|
|
0.2 KB |
|
/Boys Noize - Trooper (BNR052BDB) [EP] (2010)/ |
|
|
|
18.6 MB |
|
|
15.7 MB |
|
|
13.9 MB |
|
|
13.4 MB |
|
|
10.4 MB |
|
|
30.3 KB |
|
|
0.6 KB |
|
/Brenmar - At It Again (DBR008) [EP] (2010)/ |
|
|
|
11.1 MB |
|
|
10.6 MB |
|
|
10.3 MB |
|
|
10.3 MB |
|
|
9.9 MB |
|
|
8.9 MB |
|
|
53.8 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Brian V - Ravenous (PRIME06) [EP] (2010)/ |
|
|
|
12.2 MB |
|
|
12.2 MB |
|
|
12.0 MB |
|
|
72.6 KB |
|
|
47.2 KB |
|
|
47.0 KB |
|
|
46.1 KB |
|
|
4.9 KB |
|
/Brodinski & Mumdance - Eurostarr (ECB197RD) [Remixes EP] (2010)/ |
|
|
|
13.4 MB |
|
|
12.6 MB |
|
|
10.6 MB |
|
|
229.0 KB |
|
/Bruce Stallion - Donuts (MEOW164) [EP] (2010)/ |
|
|
|
14.6 MB |
|
|
12.8 MB |
|
|
11.6 MB |
|
|
10.3 MB |
|
|
9.6 MB |
|
|
58.1 KB |
|
|
11.6 KB |
|
/Burns & Fred Falke - Y.S.L.M. (You Stopped Loving Me) [EP] (2010)/ |
|
|
05 Y.S.L.M. (You Stopped Loving Me) (Rynecologist Remix).mp3 |
17.6 MB |
|
|
14.3 MB |
|
02 Y.S.L.M. (You Stopped Loving Me) (Treasure Fingers Remix).mp3 |
12.2 MB |
|
|
12.1 MB |
|
03 Y.S.L.M. (You Stopped Loving Me) (Burns' European Sex Dub).mp3 |
10.5 MB |
|
|
161.8 KB |
|
|
0.1 KB |
|
/Butch - XTC (PURE061) [Single] (2010)/ |
|
|
|
20.3 MB |
|
|
16.1 MB |
|
|
32.9 KB |
|
/C.R.S.T. - Revival (WRND006) [EP] (2010)/ |
|
|
|
14.8 MB |
|
|
13.1 MB |
|
|
11.1 MB |
|
|
10.5 MB |
|
|
294.1 KB |
|
/Cajmere - Perculator Remixes Part 1 (CAJ299) [EP] (2010)/ |
|
|
|
18.9 MB |
|
|
16.2 MB |
|
|
15.9 MB |
|
|
13.2 MB |
|
|
9.7 MB |
|
|
9.0 MB |
|
|
139.6 KB |
|
/Calvertron - Bum Rush (JKR011) [EP] (2010)/ |
|
|
|
11.9 MB |
|
|
10.5 MB |
|
|
327.7 KB |
|
/Camel - Speak Easy (DFEP18) [EP] (2010)/ |
|
|
|
16.5 MB |
|
|
16.3 MB |
|
|
14.5 MB |
|
|
49.8 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Camo UFOs - The Kool & Deadly (TBMP3023) [EP] (2010)/ |
|
|
|
13.2 MB |
|
|
12.6 MB |
|
|
9.0 MB |
|
|
8.8 MB |
|
|
8.8 MB |
|
|
137.9 KB |
|
/Canblaster - Jetpack (SOS004) [EP] (2010)/ |
|
|
|
13.8 MB |
|
|
11.0 MB |
|
|
7.7 MB |
|
|
134.6 KB |
|
/Caribou - Swim Remixes (SLANG753778) [CD2] (2010)/ |
|
|
|
27.7 MB |
|
|
25.8 MB |
|
|
21.9 MB |
|
02- Caribou - Leave House (Motor City Drum Ensemble Remix).mp3 |
21.1 MB |
|
|
16.4 MB |
|
|
15.0 MB |
|
|
14.4 MB |
|
|
13.8 MB |
|
|
13.1 MB |
|
|
12.8 MB |
|
|
12.8 MB |
|
|
12.6 MB |
|
|
10.5 MB |
|
|
10.1 MB |
|
03- Caribou - Sun (Altrice's 'Only What You Gave Me' Remix).mp3 |
8.7 MB |
|
|
71.0 KB |
|
/Carte Blanche - Black Billionaires EP/ |
|
|
|
12.0 MB |
|
|
9.7 MB |
|
|
9.6 MB |
|
|
8.2 MB |
|
|
8.1 MB |
|
|
0.0 KB |
|
/Cash Antics Vol. 2 (WRND008) [EP] (2010)/ |
|
|
|
15.5 MB |
|
|
14.4 MB |
|
|
11.2 MB |
|
|
10.1 MB |
|
|
87.5 KB |
|
IndieBubbles.com - All Indie and Electro For Free Download.url |
0.1 KB |
|
/Caspa - Love Never Dies (SUBSOL010D) [EP] (2010)/ |
|
|
|
11.1 MB |
|
|
11.1 MB |
|
01-caspa_and_mr_hudson-love_never_dies_(back_for_the_first_time)-def.mp3 |
8.5 MB |
|
03-caspa-back_for_the_first_time_(instrumental_radio_edit)-def.mp3 |
7.3 MB |
|
|
149.1 KB |
|
00-caspa-love_never_dies_(back_for_the_first_time)-(subsol010d)-web-2010-def.nfo |
11.4 KB |
|
/Cassius - 99 Remixes (CASS003) [Remixes EP] (2010)/ |
|
|
|
17.1 MB |
|
|
13.6 MB |
|
|
12.1 MB |
|
|
91.6 KB |
|
|
0.5 KB |
|
/Cassius - Rawkers (ED041) [EP] (2010)/ |
|
|
|
20.1 MB |
|
|
11.6 MB |
|
|
10.6 MB |
|
|
9.9 MB |
|
|
9.6 MB |
|
|
9.0 MB |
|
|
205.8 KB |
|
/Cassius - Rawkers [EP] (2010)/ |
|
|
|
20.5 MB |
|
|
12.0 MB |
|
|
11.0 MB |
|
|
10.2 MB |
|
|
10.0 MB |
|
|
9.4 MB |
|
|
200.5 KB |
|
/Cassius - The Rawkers (ED041) [EP] (2010)/ |
|
|
|
20.1 MB |
|
|
11.7 MB |
|
|
11.1 MB |
|
|
9.7 MB |
|
|
9.7 MB |
|
|
8.9 MB |
|
|
493.9 KB |
|
/CDVR - Electronic Play [EP] (2010)/ |
|
|
|
9.8 MB |
|
|
5.7 MB |
|
|
5.5 MB |
|
|
5.1 MB |
|
|
5.0 MB |
|
|
4.9 MB |
|
|
717.0 KB |
|
/CFCF - Drifts EP (2010)/ |
|
|
|
14.4 MB |
|
|
10.0 MB |
|
|
9.1 MB |
|
|
8.8 MB |
|
|
7.0 MB |
|
|
6.8 MB |
|
|
62.1 KB |
|
/Charlie Why - I Was Deliciously Wired (BANG029) [EP] (2010)/ |
|
|
|
16.3 MB |
|
|
15.0 MB |
|
|
11.8 MB |
|
|
11.6 MB |
|
|
9.0 MB |
|
|
5.6 MB |
|
|
114.2 KB |
|
IndieBubbles.com - All Indie and Electro For Free Download.url |
0.1 KB |
|
/Chesus X Diverse Concept & CRST - Baduka & Bump (TTY002) [EP] (2010)/ |
|
|
|
16.5 MB |
|
|
12.9 MB |
|
|
454.0 KB |
|
/Chewy Chocolate Cookies - Delicatessen #2 (CCC007) [EP] (2010)/ |
|
|
|
12.0 MB |
|
|
11.3 MB |
|
|
80.3 KB |
|
/Chilly Gonzales - Never Stop (Erol Alkan Rework) [Single] (2010)/ |
|
|
|
15.3 MB |
|
|
86.9 KB |
|
/Chromeo - Dont Turn The Lights On (TURBO087) [EP] (2010)/ |
|
|
|
13.5 MB |
|
|
13.2 MB |
|
02-chromeo-dont_turn_the_lights_on__christian_martin_remix.mp3 |
12.4 MB |
|
03-chromeo-dont_turn_the_lights_on__christian_martin_dub.mp3 |
12.4 MB |
|
|
29.5 KB |
|
/Clock Opera - A Piece of String [Remixes EP] (2010)/ |
|
|
|
12.8 MB |
|
01-clock_opera-a_piece_of_string_(julien_plaisir_de_france_remix)-1real.mp3 |
12.6 MB |
|
03-clock_opera-a_piece_of_string_(mickey_moonligight_remix)-1real.mp3 |
10.1 MB |
|
|
57.4 KB |
|
00-clock_opera-a_piece_of_string__remixes-web-2010-1real.nfo |
7.6 KB |
|
00-clock_opera-a_piece_of_string__remixes-web-2010-1real.sfv |
0.2 KB |
|
/Clouds - Liquid (FBLOOD1) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
13.4 MB |
|
|
95.6 KB |
|
/Club Sweat (SWEATDS028) [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
13.5 MB |
|
|
11.1 MB |
|
|
499.3 KB |
|
|
63.9 KB |
|
/Commix - Be True (Burial Remix) (METHLP013S) [Single] (2010)/ |
|
|
|
14.7 MB |
|
|
43.9 KB |
|
/Congorock - Babylon (FGRD007) [Remixes EP] (2010)/ |
|
|
|
12.2 MB |
|
|
12.2 MB |
|
|
11.0 MB |
|
|
9.8 MB |
|
|
9.8 MB |
|
|
248.6 KB |
|
/Cooly G - Dis Boy (DVA006) [EP] (2010)/ |
|
|
|
14.1 MB |
|
|
11.9 MB |
|
|
7.3 MB |
|
|
357.5 KB |
|
/Cory Blaine - Hot Plate (MIX010) [EP] (2010)/ |
|
|
|
17.2 MB |
|
|
11.7 MB |
|
|
11.2 MB |
|
|
10.9 MB |
|
|
10.4 MB |
|
|
8.1 MB |
|
|
856.8 KB |
|
/Costello - Get Crazy [EP] (2010)/ |
|
|
|
13.4 MB |
|
|
13.4 MB |
|
|
13.2 MB |
|
|
11.2 MB |
|
|
10.4 MB |
|
|
8.8 MB |
|
|
88.4 KB |
|
/Count and Sinden Feat. Mystery Jets - After Dark (RUG370D) [EP] (2010)/ |
|
|
01-the_count_and_sinden_ft._mystery_jets-after_dark_(herve_mix).mp3 |
10.8 MB |
|
02-the_count_and_sinden_ft._mystery_jets-after_dark_(the_counts_afterdub_mix).mp3 |
9.3 MB |
|
|
428.6 KB |
|
00-the_count_and_sinden_ft._mystery_jets-after_dark_(incl._herve_remix)-web-2010.nfo |
0.9 KB |
|
/Crazy White Boy - Love You Better (OMG139) [EP] (2010)/ |
|
|
|
19.5 MB |
|
|
18.9 MB |
|
|
15.9 MB |
|
|
9.7 MB |
|
|
1.7 MB |
|
/CREEP - Days (YT053) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
10.5 MB |
|
|
8.9 MB |
|
|
5.1 MB |
|
|
116.7 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Critical Mass - Burning Love 2010 (FFA016D) [EP] (2010)/ |
|
|
|
15.3 MB |
|
|
11.9 MB |
|
|
10.3 MB |
|
|
449.8 KB |
|
/Crookers Feat. Yelle - Cooler Couleur (LMFLF037D) [EP] (2010)/ |
|
|
|
17.6 MB |
|
|
12.7 MB |
|
|
12.0 MB |
|
|
7.0 MB |
|
|
107.9 KB |
|
/CRST - Good Love (NHNH013) [EP] (2010)/ |
|
|
|
15.8 MB |
|
|
15.0 MB |
|
|
13.5 MB |
|
|
12.1 MB |
|
|
11.5 MB |
|
|
10.1 MB |
|
|
40.9 KB |
|
/CRST - Mighty Music (CC2024) [EP] (2010)/ |
|
|
|
15.8 MB |
|
|
15.2 MB |
|
|
14.6 MB |
|
|
12.7 MB |
|
|
12.2 MB |
|
|
11.1 MB |
|
|
190.2 KB |
|
/Cryptonites - Vegas (FMO1010) [EP] (2010)/ |
|
|
|
15.8 MB |
|
|
11.9 MB |
|
|
9.9 MB |
|
|
9.4 MB |
|
|
8.4 MB |
|
|
102.3 KB |
|
/Crystal Fighters - In The Summer (Remixes) [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
14.8 MB |
|
|
12.8 MB |
|
|
9.5 MB |
|
|
127.9 KB |
|
/Crystal Fighters - In The Summer [EP] (2010)/ |
|
|
|
13.7 MB |
|
|
13.5 MB |
|
|
13.1 MB |
|
|
12.1 MB |
|
|
12.0 MB |
|
|
9.6 MB |
|
|
9.2 MB |
|
|
127.9 KB |
|
/Cyberpunkers - I Needed To Go (FMO1008) [EP] (2010)/ |
|
|
|
13.7 MB |
|
|
12.2 MB |
|
|
11.3 MB |
|
|
11.0 MB |
|
|
10.7 MB |
|
|
10.2 MB |
|
|
9.1 MB |
|
|
71.4 KB |
|
/D-51 - The Invasion (GDR003) [EP] (2010)/ |
|
|
|
15.5 MB |
|
|
14.5 MB |
|
|
13.7 MB |
|
|
13.3 MB |
|
|
13.0 MB |
|
|
12.3 MB |
|
|
12.3 MB |
|
|
52.4 KB |
|
/D-Bag And Naan - Milk (FFR004) [EP] (2010)/ |
|
|
|
13.1 MB |
|
|
11.7 MB |
|
|
9.4 MB |
|
|
8.5 MB |
|
|
8.5 MB |
|
|
8.4 MB |
|
|
8.2 MB |
|
|
254.1 KB |
|
|
1.1 KB |
|
/D.I.M. - Kleine Traume (BNR051DB) [EP] (2010)/ |
|
|
|
16.9 MB |
|
|
16.2 MB |
|
|
13.5 MB |
|
|
130.9 KB |
|
/Da Fresh - Right On Time (DEFDIG1020) [EP] (2010)/ |
|
|
|
18.1 MB |
|
|
13.9 MB |
|
|
49.5 KB |
|
/Dan Le Sac vs. Scroobius Pip - Sick Tonight-Great Britain (2010)/ |
|
|
|
13.5 MB |
|
|
10.9 MB |
|
|
10.8 MB |
|
|
10.0 MB |
|
|
7.2 MB |
|
|
253.2 KB |
|
/Dangerous Dan - The Ritz (BANG030DIG) [Single] (2010)/ |
|
|
|
14.5 MB |
|
|
299.6 KB |
|
|
2.5 KB |
|
/Darkstar - Gold (HDB043) [EP] (2010)/ |
|
|
|
12.8 MB |
|
|
8.9 MB |
|
|
66.4 KB |
|
/David E. Sugar - Flea Market (SBEST92D) [EP] (2010)/ |
|
|
|
15.0 MB |
|
|
12.9 MB |
|
|
12.2 MB |
|
05-david_e._sugar-flea_market__sunday_best_ambient_remix.mp3 |
11.0 MB |
|
|
9.7 MB |
|
|
7.9 MB |
|
|
99.7 KB |
|
|
0.7 KB |
|
/David Keno - Wait For More (Snatch! 001) (2010)/ |
|
|
|
16.3 MB |
|
|
16.2 MB |
|
|
112.6 KB |
|
/Deadbots - Girl On Fire (FMO1011) [EP] (2010)/ |
|
|
|
14.6 MB |
|
|
13.5 MB |
|
|
13.5 MB |
|
|
12.6 MB |
|
09 - Deadbots - My Guitar (Sharam Jey Instrumental Remix).mp3 |
12.3 MB |
|
|
12.3 MB |
|
|
12.2 MB |
|
|
12.1 MB |
|
|
10.5 MB |
|
|
143.0 KB |
|
/Deadbots - Much Better (SCR014) [EP] (2010)/ |
|
|
03 - Deadbots - Much Better (Arveene & Misk Microdot Mix).mp3 |
15.0 MB |
|
|
13.9 MB |
|
|
13.2 MB |
|
|
11.2 MB |
|
|
577.0 KB |
|
/Deadfish Remixed Vol.1 (DFLP01) [Compilation] (2010)/ |
|
|
|
19.6 MB |
|
|
17.8 MB |
|
|
17.8 MB |
|
|
17.1 MB |
|
|
17.1 MB |
|
|
17.1 MB |
|
|
16.6 MB |
|
|
16.0 MB |
|
|
15.3 MB |
|
|
14.8 MB |
|
|
1.5 MB |
|
|
68.3 KB |
|
|
65.2 KB |
|
/Deathface - The Horror (TBD032) [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
14.0 MB |
|
|
12.5 MB |
|
|
11.8 MB |
|
|
11.4 MB |
|
|
338.8 KB |
|
/Dem Slackers - Let's Go [EP] (2010)/ |
|
|
|
15.8 MB |
|
|
14.5 MB |
|
|
13.6 MB |
|
|
13.3 MB |
|
|
13.0 MB |
|
|
12.1 MB |
|
|
12.1 MB |
|
|
253.4 KB |
|
|
55.6 KB |
|
|
52.0 KB |
|
/Designer Drugs - Drop Down Riot (IHC015R) [Remixes EP] (2010)/ |
|
|
|
11.4 MB |
|
|
10.2 MB |
|
|
10.0 MB |
|
|
9.1 MB |
|
|
385.7 KB |
|
/Designer Drugs - Through The Prism (UL2673) [Single] (2010)/ |
|
|
|
9.3 MB |
|
|
46.8 KB |
|
/Detachments - Holiday Romance [EP] (2010)/ |
|
|
03- Detachments - Holiday Romance (Andy Blake's Mix For A World Unknown).mp3 |
42.3 MB |
|
02- Detachments - Holiday Romance (Cosmodelica’s Holiday Drama Mix).mp3 |
18.0 MB |
|
|
9.2 MB |
|
|
82.8 KB |
|
/Dimitri Vegas Like Mike Dada Life and Tara McDonald - Tomorrow [EP] (2010)/ |
|
|
|
19.0 MB |
|
|
18.1 MB |
|
|
12.3 MB |
|
|
12.3 MB |
|
|
591.2 KB |
|
/Diplo & Don Diablo - Make You Pop (SS00110) [EP] (2010)/ |
|
|
|
14.1 MB |
|
|
14.1 MB |
|
|
9.8 MB |
|
|
7.8 MB |
|
|
3.1 MB |
|
|
377.1 KB |
|
/Diplo with Lil Jon - U Don't Like Me [EP] (2010)/ |
|
|
|
8.5 MB |
|
|
6.2 MB |
|
|
6.2 MB |
|
|
6.2 MB |
|
|
6.1 MB |
|
|
74.2 KB |
|
/Discodeine - Singular [EP] (2010)/ |
|
|
|
13.9 MB |
|
|
13.9 MB |
|
|
12.3 MB |
|
|
7.3 MB |
|
|
151.9 KB |
|
/Discosamurai - Yes & No [EP] (2010)/ |
|
|
|
10.7 MB |
|
|
10.5 MB |
|
|
549.6 KB |
|
/Diskjokke - 1987 [EP] (2010)/ |
|
|
|
20.2 MB |
|
|
17.1 MB |
|
|
15.0 MB |
|
|
220.4 KB |
|
/Diskokaine - Hall of Shame (GOMMADT16) [EP] (2010)/ |
|
|
DT016-02 Diskokaine - Hall of Shame (King of Kong Remix).mp3 |
16.4 MB |
|
DT016-03 Diskokaine - Hall of Shame (Hannulelauri Remix).mp3 |
15.6 MB |
|
|
14.8 MB |
|
|
13.7 MB |
|
|
13.5 MB |
|
|
1.3 MB |
|
/Distrakt - Deep Throat (MHTRSH07) [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
13.8 MB |
|
|
13.2 MB |
|
|
12.7 MB |
|
|
10.9 MB |
|
|
10.8 MB |
|
|
10.3 MB |
|
|
10.3 MB |
|
|
10.0 MB |
|
|
168.2 KB |
|
|
1.4 KB |
|
/DJ Manie and Casablanca Connect - Kiesz (MIXMA024) [EP] (2010)/ |
|
|
01-dj_manie_and_casablanca_connect_-_kiesz_(original_mix)-ume.mp3 |
13.6 MB |
|
03-dj_manie_and_casablanca_connect_-_kiesz_(mightyfouls_remix)-ume.mp3 |
11.5 MB |
|
02-dj_manie_and_casablanca_connect_-_kiesz_(tom_piper_remix)-ume.mp3 |
10.3 MB |
|
|
372.3 KB |
|
00-dj_manie_and_casablanca_connect_-_kiesz-(mixma024)-web-2010-ume.nfo |
16.2 KB |
|
/DJ Rockid and Sandro Silva - Fawaka [EP] (2010)/ |
|
|
|
12.9 MB |
|
|
12.3 MB |
|
|
10.3 MB |
|
|
110.8 KB |
|
/Dj Shadow - Def Surrounds Us & I've Been Trying [Single] (2010)/ |
|
|
|
21.1 MB |
|
|
10.1 MB |
|
|
163.6 KB |
|
/DJ Sneak - Southern Boy (SAV18) [EP] (2010)/ |
|
|
|
23.4 MB |
|
|
13.4 MB |
|
|
12.3 MB |
|
|
12.3 MB |
|
|
7.9 MB |
|
|
853.2 KB |
|
/Djedjotronic - Bit This Thin (BNR046) [EP] (2010)/ |
|
|
|
17.1 MB |
|
|
15.4 MB |
|
|
12.4 MB |
|
|
11.4 MB |
|
|
10.1 MB |
|
|
9.6 MB |
|
|
57.9 KB |
|
/Doc Daneeka - Television (PTN005) [EP] (2010)/ |
|
|
|
13.5 MB |
|
|
13.4 MB |
|
|
12.4 MB |
|
|
11.2 MB |
|
|
691.5 KB |
|
|
0.5 KB |
|
/Dolby Anol - Visa Mastercard (TBASS27) [EP] (2010)/ |
|
|
|
13.1 MB |
|
|
12.7 MB |
|
|
73.1 KB |
|
/Don Diablo - I Am Not From France EP/ |
|
|
|
16.2 MB |
|
|
14.6 MB |
|
03-don_diablo-i_am_not_from_france_(cagedbabys_rollerdisco_lcross_campaign_mix).mp3 |
14.0 MB |
|
|
13.4 MB |
|
|
9.9 MB |
|
06-don_diablo-i_am_not_from_france_(hugo_van_dyck_remix).mp3 |
9.4 MB |
|
05-don_diablo-i_am_not_from_france_(louis_la_roche_remix).mp3 |
8.7 MB |
|
|
90.6 KB |
|
|
9.6 KB |
|
/Don Rimini - Nlarge Your Parties EP (2010)/ |
|
|
|
16.3 MB |
|
|
14.9 MB |
|
|
12.4 MB |
|
|
11.5 MB |
|
|
51.1 KB |
|
/Donk Boys - Congabonga (Snatch! 002) (2010)/ |
|
|
|
17.5 MB |
|
|
17.2 MB |
|
|
15.8 MB |
|
|
75.9 KB |
|
/Donovans - Undertaker & Sharkness (CHEAPER019) [EP] (2010)/ |
|
|
|
11.7 MB |
|
|
9.4 MB |
|
|
32.2 KB |
|
/dOP - L’Hôpital, La Rue, La Prison [CCS051] [EP] (2010)/ |
|
|
|
17.9 MB |
|
|
17.7 MB |
|
|
12.4 MB |
|
|
8.4 MB |
|
|
39.2 KB |
|
/Douster & Savage Skulls feat. Robyn - Get Rich or High Tryin (MAD111) [EP] (2010)/ |
|
|
|
13.8 MB |
|
|
12.0 MB |
|
|
9.9 MB |
|
|
9.7 MB |
|
|
100.4 KB |
|
/Douze - Les Paradis Artificiels [EP] (2010)/ |
|
|
|
16.9 MB |
|
|
16.4 MB |
|
|
13.7 MB |
|
|
9.7 MB |
|
|
8.6 MB |
|
|
106.1 KB |
|
/Downlink - Emergency (ROTD029) [EP] (2010)/ |
|
|
|
12.6 MB |
|
|
10.5 MB |
|
|
10.2 MB |
|
|
10.0 MB |
|
|
148.8 KB |
|
/Dragonette - Mixin To Thrill (DI020) [EP] (2010)/ |
|
|
|
17.2 MB |
|
|
17.1 MB |
|
|
16.6 MB |
|
|
15.0 MB |
|
|
13.0 MB |
|
|
12.2 MB |
|
|
11.7 MB |
|
|
10.8 MB |
|
|
8.8 MB |
|
|
7.4 MB |
|
|
322.2 KB |
|
/Drop The Lime - Sex Sax (BRREP021) [Remixes EP] (2010)/ |
|
|
|
16.4 MB |
|
|
15.1 MB |
|
|
13.8 MB |
|
|
11.9 MB |
|
|
11.3 MB |
|
|
609.5 KB |
|
/Drop the Lime - Sex Sax (TBD038) (2010)/ |
|
|
|
16.3 MB |
|
|
14.5 MB |
|
|
13.5 MB |
|
|
11.8 MB |
|
|
11.8 MB |
|
|
10.7 MB |
|
|
929.8 KB |
|
/Drop Top - Machete (SDUBNEW003) [EP] (2010)/ |
|
|
|
14.6 MB |
|
|
12.0 MB |
|
|
11.0 MB |
|
|
801.0 KB |
|
|
0.7 KB |
|
/Dubbel Dutch - Throwback (POS016) [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
13.6 MB |
|
|
13.2 MB |
|
|
473.3 KB |
|
|
0.5 KB |
|
/Duck Sauce - Barbra Streisand (3BEAT014) [EP] (2010)/ |
|
|
|
12.1 MB |
|
|
10.9 MB |
|
|
120.5 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Duck Sauce - Barbra Streisand (Afrojack Mixes) (3BEAT014X) [EP] (2010)/ |
|
|
01-duck_sauce_-_barbra_streisand_(afrojack_ducky_mix)-ume.mp3 |
12.4 MB |
|
02-duck_sauce_-_barbra_streisand_(afrojack_meaty_mix)-ume.mp3 |
12.3 MB |
|
|
120.5 KB |
|
00-duck_sauce_-_barbra_streisand_(afrojack_mixes)-(3beat014x)-web-2010-ume.nfo |
16.1 KB |
|
/Duke Dumont - Regality (TURBO041) [EP] (2007)/ |
|
|
|
13.5 MB |
|
|
13.1 MB |
|
|
12.4 MB |
|
|
152.6 KB |
|
/Duke Dumont - The Dominion Dubs (DSD016) [EP] (2008)/ |
|
|
|
9.8 MB |
|
|
8.9 MB |
|
|
2.6 MB |
|
|
1.4 MB |
|
|
1.3 MB |
|
|
90.2 KB |
|
/Dummejungs - Epic (BLV111256) [EP] (2010)/ |
|
|
|
9.4 MB |
|
|
8.4 MB |
|
|
95.3 KB |
|
/Dupstep Remix (BEW005) [EP] (2010)/ |
|
|
|
13.2 MB |
|
|
11.4 MB |
|
|
11.2 MB |
|
|
35.3 KB |
|
/DVA - Just Vybe & Step 2 Funk (HDB040) [EP] (2010)/ |
|
|
|
15.9 MB |
|
|
13.0 MB |
|
|
224.7 KB |
|
|
10.4 KB |
|
/Eats Tapes - Still Lox (MEOW163) [EP] (2010)/ |
|
|
|
17.9 MB |
|
|
15.7 MB |
|
|
11.7 MB |
|
|
11.6 MB |
|
|
11.0 MB |
|
00-eats_tapes-still_lox-xyx_bice_ep-(meow163)-web-2010-def.nfo |
12.9 KB |
|
|
11.2 KB |
|
/Eclier - Hole [EP] (2010)/ |
|
|
|
12.7 MB |
|
|
11.9 MB |
|
|
11.6 MB |
|
|
266.6 KB |
|
/Edu K - Flutesnoot (MAN051) [EP] (2010)/ |
|
|
|
16.5 MB |
|
|
12.9 MB |
|
|
12.5 MB |
|
|
11.6 MB |
|
|
11.2 MB |
|
|
166.1 KB |
|
|
0.6 KB |
|
/Egyptian Hip Hop - Some Reptiles Grew Wings [EP] (2010)/ |
|
|
|
10.8 MB |
|
|
8.4 MB |
|
|
6.7 MB |
|
|
6.7 MB |
|
|
22.1 KB |
|
/Egyptrixx - Battle For North America (AAAHH04) [EP] (2010)/ |
|
|
|
13.9 MB |
|
|
12.2 MB |
|
|
11.4 MB |
|
|
10.6 MB |
|
|
827.9 KB |
|
/Egyptrixx - The Only Way Up (NS002) [EP] (2010)/ |
|
|
|
12.5 MB |
|
|
11.8 MB |
|
|
11.5 MB |
|
|
11.3 MB |
|
|
10.7 MB |
|
06-egyptrixx--the_only_way_up_(cubic_zirconia_instrumental)-dh.mp3 |
10.3 MB |
|
|
594.2 KB |
|
|
3.0 KB |
|
/Egyptrixx and Subeena - Neurotic (OPT003) [EP] (2010)/ |
|
|
|
17.1 MB |
|
|
13.2 MB |
|
|
13.0 MB |
|
|
9.6 MB |
|
|
214.3 KB |
|
/Electric Rescue - Ambivalent (BNRTRAX001) [EP] (2010)/ |
|
|
|
21.2 MB |
|
|
21.2 MB |
|
|
16.1 MB |
|
|
21.5 KB |
|
/Electrixx vs. Alex Mind - No Discussion (EXX021) [EP] (2010)/ |
|
|
|
14.6 MB |
|
01-electrixx_vs_alex_mind-no_discussion_(original_mix)-ccat.mp3 |
14.4 MB |
|
|
13.3 MB |
|
03-electrixx_vs_alex_mind-no_discussion_(radio_mix)-ccat.mp3 |
9.1 MB |
|
|
325.0 KB |
|
/Elite Force - The Law Of Life (Remixes 1) EP (2010)/ |
|
|
|
17.2 MB |
|
|
17.0 MB |
|
|
14.9 MB |
|
|
60.6 KB |
|
/Emperatron - King Riddim (TBMP3021) [EP] (2010)/ |
|
|
|
13.4 MB |
|
|
12.7 MB |
|
|
12.4 MB |
|
|
8.1 MB |
|
|
72.6 KB |
|
/Enter Shikari - Destabilise [Single] (2010)/ |
|
|
|
11.0 MB |
|
|
106.2 KB |
|
/Erdbeerschnitzel - Cotton [EP] (2010)/ |
|
|
|
18.0 MB |
|
|
15.6 MB |
|
|
15.0 MB |
|
|
14.8 MB |
|
|
85.2 KB |
|
/Erdbeerschnitzel - To And End (MIRAU011) [EP] (2010)/ |
|
|
|
20.4 MB |
|
|
19.5 MB |
|
|
14.8 MB |
|
|
76.0 KB |
|
/Erol Alkan and Boys Noize - Lemonade, Avalanche EP/ |
|
|
|
15.1 MB |
|
|
11.4 MB |
|
|
308.8 KB |
|
/Eskmo - Cloudlight & Come Back (ZENDNLS270X) [EP] (2010)/ |
|
|
|
9.9 MB |
|
|
9.9 MB |
|
|
8.2 MB |
|
|
8.1 MB |
|
|
737.6 KB |
|
00-eskmo-cloudlight__come_back-(zendnls270x)-web-2010-kouala.nfo |
1.1 KB |
|
/Etienne de Crecy - Binary [EP] (2010)/ |
|
|
|
17.7 MB |
|
|
15.3 MB |
|
|
14.6 MB |
|
|
11.9 MB |
|
|
10.7 MB |
|
|
8.6 MB |
|
|
50.4 KB |
|
/Etienne De Crécy - No Brain [EP] (2010)/ |
|
|
|
18.6 MB |
|
|
17.7 MB |
|
|
16.3 MB |
|
|
15.1 MB |
|
|
12.4 MB |
|
|
10.9 MB |
|
|
18.6 KB |
|
/Eumig & Chinon - Eumig & Chinon (2010)/ |
|
|
|
10.8 MB |
|
|
10.3 MB |
|
07- Data-Debt - California Special (Eumig & Chinon Remix).mp3 |
9.0 MB |
|
|
7.9 MB |
|
|
6.2 MB |
|
|
5.9 MB |
|
|
5.4 MB |
|
|
128.9 KB |
|
|
65.6 KB |
|
/Everything Everything - Schoolin [Remixes EP] (2010)/ |
|
|
|
10.7 MB |
|
|
8.7 MB |
|
|
8.6 MB |
|
|
7.3 MB |
|
|
6.8 MB |
|
|
99.1 KB |
|
/Evil Nine - Auto (LOVE003) [EP] (2010)/ |
|
|
|
16.1 MB |
|
|
14.7 MB |
|
|
14.3 MB |
|
|
83.4 KB |
|
/Evil Nine - Stay Up (LOVE002) [EP] (2010)/ |
|
|
|
13.6 MB |
|
|
13.2 MB |
|
|
233.4 KB |
|
/Evil Nine - Ultimo (LOVE001) [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
13.1 MB |
|
|
13.0 MB |
|
|
31.3 KB |
|
/Evil Nine Ft. Spoek Mathambo - No Manners (MAPA057) 2010/ |
|
|
|
9.6 MB |
|
|
9.5 MB |
|
06-evil_nine_ft_spoek_mathambo-no_manners_(instrumental).mp3 |
9.3 MB |
|
03-evil_nine_ft_spoek_mathambo-no_manners_(dannoso_remix).mp3 |
8.7 MB |
|
04-evil_nine_ft_spoek_mathambo-no_manners_(dannoso_instrumental).mp3 |
8.6 MB |
|
02-evil_nine_ft_spoek_mathambo-no_manners_(arveene_and_misk_remix).mp3 |
6.3 MB |
|
|
206.5 KB |
|
00-evil_nine_ft_spoek_mathambo-no_manners-(mapa057)-promo_cdm-2010.m3u |
0.4 KB |
|
/Example - Kickstarts Remixes (2010)/ |
|
|
|
9.9 MB |
|
|
9.5 MB |
|
|
9.3 MB |
|
|
7.3 MB |
|
|
6.8 MB |
|
|
5.3 MB |
|
|
5.1 MB |
|
|
57.1 KB |
|
|
0.9 KB |
|
|
0.4 KB |
|
|
0.3 KB |
|
/F.O.O.L - Berserkergang (MMAN030) [EP] (2010)/ |
|
|
05 Berserkergang feat. A Girl And A Gun (Drivepilot Remix).mp3 |
11.6 MB |
|
06 Berserkergang feat. A Girl And A Gun (Beef Theatre Remix).mp3 |
11.0 MB |
|
|
10.3 MB |
|
04 Berserkergang feat. A Girl And A Gun (Noize Generation Remix).mp3 |
9.5 MB |
|
02 Berserkergang feat. A Girl And A Gun (Owl Vision Remix).mp3 |
8.8 MB |
|
|
8.5 MB |
|
|
28.6 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/F.O.O.L - We're Not French (BLV118350) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
12.1 MB |
|
|
10.2 MB |
|
|
9.8 MB |
|
|
9.6 MB |
|
|
9.5 MB |
|
|
9.0 MB |
|
|
7.8 MB |
|
|
80.0 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Fagget Fairys - Feed The Horse (GIGOLO273) [EP] (2010)/ |
|
|
|
16.4 MB |
|
|
8.1 MB |
|
|
144.9 KB |
|
|
121.4 KB |
|
|
0.5 KB |
|
/Faithless - Tweak Your Nipple (Remixes) (2010)/ |
|
|
|
19.7 MB |
|
02-faithless-tweak_your_nipple__rollo_and_sister_bliss_tweakin_mix.mp3 |
19.2 MB |
|
|
13.8 MB |
|
|
165.7 KB |
|
/FaltyDL - Endeavour (ZIQ279) [EP] (2010)/ |
|
|
|
11.7 MB |
|
|
10.6 MB |
|
|
9.8 MB |
|
|
259.3 KB |
|
/FaltyDL - Phreqaflex (ZIQ277) [EP] (2010)/ |
|
|
|
11.6 MB |
|
|
8.8 MB |
|
|
7.9 MB |
|
|
373.3 KB |
|
/Fantastadon & Hot Pink Delorean - Party Flavour (POE028) [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
14.7 MB |
|
|
14.1 MB |
|
|
13.5 MB |
|
|
12.7 MB |
|
|
11.4 MB |
|
|
11.0 MB |
|
|
172.5 KB |
|
/Fantastic Mr. Fox - Evelyn (ACRE021) [EP] (2010)/ |
|
|
|
10.5 MB |
|
|
10.3 MB |
|
|
8.3 MB |
|
|
7.8 MB |
|
|
552.9 KB |
|
|
11.4 KB |
|
/Far Too Loud - Start The Party (FTECH044D) [EP] (2010)/ |
|
|
|
11.8 MB |
|
|
9.8 MB |
|
|
9.4 MB |
|
|
132.9 KB |
|
/Far Too Loud - We Want to Dance [Single] (FTECH042D) (2010)/ |
|
|
|
13.6 MB |
|
|
13.1 MB |
|
|
75.2 KB |
|
/Fatboy Slim Vs Herve - Machines Can Do The Work EP (2010)/ |
|
|
02-fatboy_slim_vs_herve-machines_can_do_the_work_(original_mix).mp3 |
12.0 MB |
|
01-fatboy_slim_vs_herve-machines_can_do_the_work_(action_man_aka_herve_acid_flash_mix).mp3 |
11.9 MB |
|
|
297.4 KB |
|
|
0.9 KB |
|
/Fatboy Slim Vs. Herve - Machines Can Do The Work (SKINT186DR) [Remixes EP] (2010)/ |
|
|
01_fatboy_slim_vs_herve_-_machines_can_do_the_work_joris_voorn_does_the_work_remix.mp3 |
20.8 MB |
|
03_fatboy_slim_vs_herve_-_machines_can_do_the_work_reset_remix.mp3 |
14.2 MB |
|
02_fatboy_slim_vs_herve_-_machines_can_do_the_work_ado_done_most_the_work_mix.mp3 |
11.2 MB |
|
|
408.6 KB |
|
00_fatboy_slim_vs_herve_-_machines_can_do_the_work_remixes-(skint186dr)-web-2010-tra.nfo |
3.9 KB |
|
/FCKN Crew- Discoke (SSS003) [EP] (2010)/ |
|
|
|
9.4 MB |
|
|
9.3 MB |
|
|
8.8 MB |
|
|
7.0 MB |
|
Fckn Crew - Discoke (The toxic avenger HEY WHAT'S THE BPM REMIX).mp3 |
6.0 MB |
|
|
605.2 KB |
|
|
410.3 KB |
|
|
0.6 KB |
|
/Feadz - The T.U.F.F. (BEC5772786) [Single] (2010)/ |
|
|
|
11.3 MB |
|
|
619.8 KB |
|
|
0.3 KB |
|
/Felguk - Side By Side (FIX117) [EP] (2010)/ |
|
|
|
15.9 MB |
|
|
15.4 MB |
|
|
9.3 MB |
|
|
247.0 KB |
|
|
1.0 KB |
|
/Felix Cartal - Love [EP] (2010)/ |
|
|
|
13.5 MB |
|
|
12.9 MB |
|
|
12.1 MB |
|
|
319.9 KB |
|
/Felix Da Housecat - Thee Anthem (PRYF006) (2010)/ |
|
|
|
20.7 MB |
|
|
17.4 MB |
|
|
166.9 KB |
|
/Femme en Fourrure - Dirty Blonde II (DBR005) [EP] (2010)/ |
|
|
|
18.1 MB |
|
Femme_En_Fourrure_-_Dirty_Blonde_(Lazaro_Casanova_Rhodes_mix)_320.mp3 |
17.6 MB |
|
|
16.1 MB |
|
|
14.9 MB |
|
Femme_En_Fourrure_-_Dirty_Blonde_(French_Fries___Manare_remix)_320.mp3 |
14.1 MB |
|
|
12.8 MB |
|
Femme_En_Fourrure_-_Dirty_Blonde_(Marcus_Price_remix)_320.mp3 |
9.7 MB |
|
|
53.3 KB |
|
/Femme En Fourrure - Plump Bisquit (TBMP3006) [EP] (2010)/ |
|
|
|
17.0 MB |
|
02 - Femme En Fourrure - Plump Bisquit (Sharkslayer Demon Dub Mix).mp3 |
15.4 MB |
|
|
240.5 KB |
|
/Figure - The Death of Joshua (WAL12) [EP] (2010)/ |
|
|
|
13.5 MB |
|
|
12.5 MB |
|
|
11.3 MB |
|
|
104.9 KB |
|
|
8.7 KB |
|
IndieBubbles.com - All Indie and Electro For Free Download.url |
0.1 KB |
|
/Figure - Torture (IDIOT046) [EP] (2010)/ |
|
|
|
13.7 MB |
|
|
11.8 MB |
|
|
11.2 MB |
|
|
10.9 MB |
|
|
9.0 MB |
|
|
48.0 KB |
|
/Fis-T - Night Hunter (502001) [EP] (2010)/ |
|
|
|
12.9 MB |
|
|
11.7 MB |
|
|
147.8 KB |
|
/Flashworx - Two Guys In Japan EP (2010)/ |
|
|
|
16.2 MB |
|
|
13.4 MB |
|
Flashworx - Sandra Was Great (Sare Havlicek & Le Pimp Remix).mp3 |
12.8 MB |
|
|
12.2 MB |
|
|
11.5 MB |
|
|
11.5 MB |
|
|
10.5 MB |
|
|
155.6 KB |
|
/Flinch - Watch Me Now & Playing With Fire (PLAY018) [EP] (2010)/ |
|
|
|
13.2 MB |
|
|
11.1 MB |
|
|
79.9 KB |
|
00-flinch-watch_me_now__playing_with_fire-(play018)-web-2010.nfo |
8.3 KB |
|
IndieBubbles.com - All Indie and Electro For Free Download.url |
0.1 KB |
|
/Florrie - Call 911 (Remixes) (2010)/ |
|
|
|
11.2 MB |
|
|
9.3 MB |
|
|
8.7 MB |
|
04-florrie-call_911_(his_majesty_andre_call_me_instead_remix).mp3 |
7.2 MB |
|
|
122.7 KB |
|
/Flying Lotus - Pattern + Grid World (WAP308) [EP] (2010)/ |
|
|
|
6.9 MB |
|
|
5.9 MB |
|
|
5.6 MB |
|
|
4.9 MB |
|
|
4.9 MB |
|
|
4.8 MB |
|
|
4.5 MB |
|
|
686.9 KB |
|
/Foamo - Here Comes (MODA010) [EP] (2010)/ |
|
|
|
13.9 MB |
|
|
11.8 MB |
|
|
334.0 KB |
|
/Four Tet - Angel Echoes Remixes [WEB] (2010)/ |
|
|
|
15.2 MB |
|
|
8.5 MB |
|
|
597.6 KB |
|
/Four Tet vs. Mala - Nothing To See & Don’t Le Me Go [EP] (2010)/ |
|
|
|
21.3 MB |
|
|
12.3 MB |
|
|
95.8 KB |
|
00-four_tet_vs_mala-nothing_to_see_&_don't_let_me_go-(sjr233)-web-2010.nfo |
0.7 KB |
|
/Freestylers feat Belle Humble - Cracks (Remixes) [EP] (nsdx005) (2010)/ |
|
|
|
20.0 MB |
|
|
14.3 MB |
|
|
11.4 MB |
|
|
10.7 MB |
|
|
67.2 KB |
|
/French Fries - Senta [Remixes EP] (2010)/ |
|
|
|
17.2 MB |
|
|
14.4 MB |
|
|
13.3 MB |
|
|
10.9 MB |
|
|
10.7 MB |
|
|
73.4 KB |
|
/Fukkk Offf - Worldwide [EP] (2010)/ |
|
|
|
14.1 MB |
|
|
14.0 MB |
|
|
11.9 MB |
|
|
8.7 MB |
|
|
118.7 KB |
|
/Futurecop - The Remixes 3 [CD] (2010)/ |
|
|
|
17.8 MB |
|
|
15.0 MB |
|
|
13.9 MB |
|
|
12.3 MB |
|
|
12.1 MB |
|
|
12.0 MB |
|
|
10.7 MB |
|
|
10.6 MB |
|
|
10.1 MB |
|
|
9.4 MB |
|
02-futurecop-transformers_(lorentz_and_m.sakarias_vocal_mix).mp3 |
7.2 MB |
|
|
7.1 MB |
|
|
245.1 KB |
|
|
2.5 KB |
|
/Galen and Justin Martin - The Cactus (DB041) [EP] (2010)/ |
|
|
|
16.2 MB |
|
|
14.4 MB |
|
|
241.4 KB |
|
00-galen_and_justin_martin-the_cactus_ep-(db041)-web-2010.nfo |
0.5 KB |
|
/Gamble & Burke - Let's Go Together (KITSUNE115) [EP] (2010)/ |
|
|
|
17.2 MB |
|
|
13.1 MB |
|
|
11.6 MB |
|
|
9.5 MB |
|
|
277.9 KB |
|
/Geometry - Tracks & Remixes (2010)/ |
|
|
|
12.4 MB |
|
|
12.0 MB |
|
|
11.2 MB |
|
|
10.9 MB |
|
|
9.9 MB |
|
|
9.6 MB |
|
|
9.4 MB |
|
|
8.8 MB |
|
|
23.9 KB |
|
/Gesaffelstein - Variations (TURBO093D) [EP] (2010)/ |
|
|
|
22.5 MB |
|
|
17.3 MB |
|
|
16.8 MB |
|
|
15.6 MB |
|
|
15.3 MB |
|
|
215.9 KB |
|
|
63.3 KB |
|
/Get Cape. Wear Cape. Fly. - Collapsing Cities [Remixes] (2010)/ |
|
|
02-get_cape._wear_cape._fly.-collapsing_cities_(his_majesty_andre_remix).mp3 |
6.6 MB |
|
01-get_cape._wear_cape._fly.-collapsing_cities_(jakwob_remix).mp3 |
5.5 MB |
|
|
42.6 KB |
|
/Giant - Komrade vol.1 Night Fever (TBMP3017) [EP] (2010)/ |
|
|
|
13.4 MB |
|
|
10.5 MB |
|
|
64.7 KB |
|
/Gold Panda - Unreleased Medical Journal [CDR] (2010)/ |
|
|
|
10.2 MB |
|
|
9.5 MB |
|
|
8.8 MB |
|
|
7.1 MB |
|
|
6.7 MB |
|
|
6.6 MB |
|
|
5.9 MB |
|
|
5.8 MB |
|
|
3.8 MB |
|
/Gold Panda - You EP (2010)/ |
|
|
|
15.1 MB |
|
|
12.3 MB |
|
|
10.7 MB |
|
|
9.4 MB |
|
|
8.3 MB |
|
|
207.2 KB |
|
/Gomma Dance Tracks EP 3 (GOMMADT013) [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
13.6 MB |
|
|
12.2 MB |
|
|
11.6 MB |
|
|
7.3 MB |
|
|
157.2 KB |
|
/Gomma Electro Bombas (GOMMADT011) [EP] (2010)/ |
|
|
|
17.7 MB |
|
|
17.4 MB |
|
|
11.9 MB |
|
|
11.3 MB |
|
|
8.2 MB |
|
|
289.9 KB |
|
/Gonzales - I Am Europe [EP] (2010)/ |
|
|
|
15.5 MB |
|
|
13.4 MB |
|
|
13.1 MB |
|
|
12.9 MB |
|
|
11.7 MB |
|
|
3.1 MB |
|
|
314.8 KB |
|
/Goose - Can't Stop Me Now (K7280EPD) [EP] (2010)/ |
|
|
|
14.7 MB |
|
|
10.3 MB |
|
|
8.4 MB |
|
|
54.3 KB |
|
/Gooseflesh - Insanely [EP] (2009)/ |
|
|
|
15.6 MB |
|
|
13.0 MB |
|
|
10.0 MB |
|
|
9.8 MB |
|
|
8.6 MB |
|
|
213.5 KB |
|
/Gorillaz - On Melancholy Hill (Remixes) (2010)/ |
|
|
|
13.6 MB |
|
|
13.6 MB |
|
03-gorillaz-on_melancholy_hill_(the_japanese_popstars_remix).mp3 |
13.0 MB |
|
|
8.4 MB |
|
|
5.1 MB |
|
|
15.3 KB |
|
/Gorillaz with Daley - Doncamatic (All Played Out) [EP] (2010)/ |
|
|
|
11.6 MB |
|
|
8.2 MB |
|
|
8.2 MB |
|
|
243.6 KB |
|
/Green Velvet - Harmageddon (RR2040) [EP] (2010)/ |
|
|
|
16.3 MB |
|
|
15.0 MB |
|
|
13.4 MB |
|
|
13.1 MB |
|
|
74.7 KB |
|
/Green Velvet - La La Land Remixes [EP] (CAJ300) (2010)/ |
|
|
04- Green Velvet - La La Land (Derrick Carter 'D's BHQ Business' Remix).mp3 |
20.2 MB |
|
05- Green Velvet - La La Land (Pleasurekraft Sideshow Remix).mp3 |
15.2 MB |
|
07- Green Velvet - La La Land (Tommie Sunshine & Kassiano Dub).mp3 |
15.1 MB |
|
06- Green Velvet - La La Land (Santiago & Bushido Remix).mp3 |
13.8 MB |
|
|
13.6 MB |
|
|
13.3 MB |
|
|
12.8 MB |
|
|
11.2 MB |
|
|
93.5 KB |
|
/Greenmoney - Gold Ru$h (FGR032) [EP] (2010)/ |
|
|
05 - greenmoney - suh mi stay (karizma's kaytronik remix).mp3 |
18.3 MB |
|
|
13.6 MB |
|
|
11.6 MB |
|
|
11.6 MB |
|
|
11.5 MB |
|
|
11.5 MB |
|
|
11.2 MB |
|
|
10.1 MB |
|
|
9.7 MB |
|
|
308.8 KB |
|
/Grinderman - Worm Tamer [EP] (2010)/ |
|
|
|
14.3 MB |
|
|
8.3 MB |
|
|
7.7 MB |
|
|
14.4 KB |
|
/Grum - Can't Shake This Feeling (WEPLAY104) [EP] (2010)/ |
|
|
|
10.4 MB |
|
|
8.2 MB |
|
05-grum_-_cant_shake_this_feeling_(aston_shuffle_remix)-ume.mp3 |
7.3 MB |
|
|
7.0 MB |
|
|
5.7 MB |
|
|
5.0 MB |
|
|
76.0 KB |
|
/Grum - Through The Night (HEART007) [EP] (2010)/ |
|
|
|
22.0 MB |
|
04 Grum - Through The Night (Tom de Neef's Jacksquad Remix).mp3 |
19.4 MB |
|
|
14.0 MB |
|
|
13.2 MB |
|
|
12.9 MB |
|
|
12.3 MB |
|
|
10.5 MB |
|
|
41.9 KB |
|
/Gtronic - Cameltoe EP (2010)/ |
|
|
|
14.5 MB |
|
04_gtronic_-_suck_my_lollipop_(blatta_and_inesha_how_many_licks_remix).mp3 |
13.0 MB |
|
|
11.7 MB |
|
|
9.1 MB |
|
|
217.6 KB |
|
|
0.8 KB |
|
|
0.2 KB |
|
|
0.2 KB |
|
/Gtronic - Punch [EP] (2010)/ |
|
|
|
13.3 MB |
|
|
13.1 MB |
|
|
8.9 MB |
|
|
517.5 KB |
|
/Haezer - WTFIH (FMO1009) [Remixes EP] (2010)/ |
|
|
|
15.3 MB |
|
|
11.9 MB |
|
|
11.8 MB |
|
|
11.4 MB |
|
|
10.7 MB |
|
|
10.6 MB |
|
|
9.9 MB |
|
|
7.8 MB |
|
|
92.5 KB |
|
/Happyboxx - Destroy It (MAKO005) [EP] (2010)/ |
|
|
|
17.7 MB |
|
|
12.3 MB |
|
|
12.1 MB |
|
|
11.8 MB |
|
|
396.8 KB |
|
/Harvard Bass - Caked 81 (2009)/ |
|
|
|
15.6 MB |
|
|
14.8 MB |
|
|
10.4 MB |
|
|
579.0 KB |
|
/Heavy Bass Champions Of The World Vol. X - Willy Joy and Rob Threezy (TBD042) [EP] (2010)/ |
|
|
|
16.8 MB |
|
|
13.2 MB |
|
|
9.8 MB |
|
|
238.0 KB |
|
/Heavy Bass Champions of the World Vol. XI - Flinch (TBD045) [EP] (2010)/ |
|
|
|
14.6 MB |
|
|
12.6 MB |
|
|
10.4 MB |
|
|
229.3 KB |
|
/Heavyfeet - Last Two People (STMP007) [EP] (2010)/ |
|
|
02-heavyfeet-last_two_people_feat_rod_hotly_and_kid_bliss_(club_dub).mp3 |
15.5 MB |
|
04-heavyfeet-last_two_people_feat_rod_hotly_and_kid_bliss_(two_fresh_remix).mp3 |
14.2 MB |
|
03-heavyfeet-last_two_people_feat_rod_hotly_and_kid_bliss_(dcup_remix).mp3 |
9.6 MB |
|
01-heavyfeet-last_two_people_feat_rod_hotly_and_kid_bliss_(original_mix).mp3 |
8.3 MB |
|
|
256.9 KB |
|
|
8.4 KB |
|
IndieBubbles.com - All Indie and Electro For Free Download.url |
0.1 KB |
|
/Heavyfeet - Sawdust & Sultanas (SEED043) [EP] (2010)/ |
|
|
|
15.4 MB |
|
|
12.9 MB |
|
|
12.5 MB |
|
|
11.6 MB |
|
|
85.2 KB |
|
/Herve - Together (CHEAP023) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
12.5 MB |
|
|
7.7 MB |
|
|
141.9 KB |
|
/Hey Today! - Strange (LL34D) [EP] (2010)/ |
|
|
|
14.3 MB |
|
|
14.2 MB |
|
|
13.0 MB |
|
|
11.7 MB |
|
|
8.2 MB |
|
|
58.6 KB |
|
/Hickup - Mitzwa (SWEATDS033) [EP] (2010)/ |
|
|
|
13.2 MB |
|
|
13.1 MB |
|
|
219.8 KB |
|
/Highbloo - Fakirology (LL37D) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
13.2 MB |
|
|
12.3 MB |
|
|
11.2 MB |
|
|
293.3 KB |
|
/His Majesty Andre - The Lincolnshire Poacher (MODA008) [EP] (320)/ |
|
|
|
12.0 MB |
|
|
11.4 MB |
|
|
9.7 MB |
|
|
615.0 KB |
|
/Hoaxx - Cadillac (DKR019) [EP] (2010)/ |
|
|
|
14.9 MB |
|
|
9.6 MB |
|
|
598.4 KB |
|
|
8.3 KB |
|
/Holy Fuck - Red Lights (YT048DL) [Single] (2010)/ |
|
|
|
9.3 MB |
|
|
7.7 MB |
|
|
84.4 KB |
|
|
1.5 KB |
|
/Homepark - Forever Walking (STRIKE3) [EP] (2010)/ |
|
|
|
19.6 MB |
|
|
17.6 MB |
|
|
16.1 MB |
|
|
13.4 MB |
|
|
86.5 KB |
|
|
18.9 KB |
|
/Homework - Fissa Tune (EXP-DIGITAL-02) [EP] (2010)/ |
|
|
|
12.2 MB |
|
|
11.8 MB |
|
|
11.6 MB |
|
|
10.9 MB |
|
|
98.1 KB |
|
/Homework - Trumpet Express [EP] (2010)/ |
|
|
|
20.4 MB |
|
|
16.0 MB |
|
|
14.4 MB |
|
|
32.9 KB |
|
/Hostage - Roll [EP] (2010)/ |
|
|
|
14.1 MB |
|
|
11.7 MB |
|
|
11.0 MB |
|
|
10.3 MB |
|
|
8.5 MB |
|
|
141.2 KB |
|
/Hostage - Versatile Sound (RIOT008) [EP] (2010)/ |
|
|
|
12.7 MB |
|
|
9.6 MB |
|
|
343.4 KB |
|
/Hot Chip - We Have Remixes [EP] (2010)/ |
|
|
|
17.6 MB |
|
01-hot_chip-hand_me_down_your_love__todd_edwards_micro_chip_remix-styl.mp3 |
16.2 MB |
|
|
12.6 MB |
|
|
12.1 MB |
|
|
36.5 KB |
|
/Hot City - Another Girl (MOSHI91D) [Single] (2010)/ |
|
|
|
13.2 MB |
|
|
54.6 KB |
|
/Hot City - Twist (MOSHI113) [EP] (2010)/ |
|
|
|
12.2 MB |
|
|
12.0 MB |
|
|
11.7 MB |
|
|
11.3 MB |
|
|
10.6 MB |
|
|
32.0 KB |
|
/Hot Pink Delorean - Court Jester (2010)/ |
|
|
|
17.3 MB |
|
|
17.1 MB |
|
|
15.0 MB |
|
|
13.6 MB |
|
|
12.2 MB |
|
|
7.4 MB |
|
|
214.8 KB |
|
/Hot Pink Delorean - I'm Your Computer (HPDMC0004) [EP] (2010)/ |
|
|
|
17.0 MB |
|
|
14.7 MB |
|
|
189.9 KB |
|
|
56.2 KB |
|
/Housemeister - Beef Jerky 2 Premium Cuts (BNR047DB) [EP] (2010)/ |
|
|
|
11.8 MB |
|
|
9.8 MB |
|
|
9.3 MB |
|
|
9.0 MB |
|
|
8.4 MB |
|
|
100.7 KB |
|
/Human Life - In It Together [EP] (2010)/ |
|
|
|
17.7 MB |
|
|
14.0 MB |
|
|
13.3 MB |
|
|
13.2 MB |
|
|
13.1 MB |
|
|
12.5 MB |
|
|
11.1 MB |
|
|
9.8 MB |
|
|
9.8 MB |
|
|
9.8 MB |
|
|
8.9 MB |
|
|
645.4 KB |
|
/Humanleft and Benjamin Damage - Arnaud and Bernard &Zeppelin (50WEAPONS005) [EP] (2010)/ |
|
|
|
12.7 MB |
|
|
9.4 MB |
|
|
77.3 KB |
|
00-humanleft_and_benjamin_damage-arnaud_and_bernard__zeppelin-(50weapons005)-web-2010-def.nfo |
11.6 KB |
|
/Huoratron - Prevenge (Q201239) [EP] (2010)/ |
|
|
|
13.3 MB |
|
|
12.8 MB |
|
|
11.7 MB |
|
|
10.8 MB |
|
|
9.6 MB |
|
|
9.5 MB |
|
|
9.3 MB |
|
|
86.6 KB |
|
|
10.8 KB |
|
/Hurts - Stay [EP] (2010)/ |
|
|
|
18.0 MB |
|
|
14.9 MB |
|
|
9.5 MB |
|
|
37.4 KB |
|
/Hypno - Go Shorty (RAMP040) [EP] (2010)/ |
|
|
|
11.1 MB |
|
|
10.2 MB |
|
|
293.5 KB |
|
/I Heart Sharks - Wolves [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
9.9 MB |
|
03-i_heart_sharks-wolves_(dadajugend_rund_with_the_pack_remix).mp3 |
9.2 MB |
|
|
9.2 MB |
|
|
98.0 KB |
|
/Idiot Boyz - Crazy Saxo! (DOPE031) [EP] (2010)/ |
|
|
|
13.7 MB |
|
|
11.9 MB |
|
|
10.8 MB |
|
|
458.5 KB |
|
/Iiya Santana - Erin [EP] (2010)/ |
|
|
|
17.7 MB |
|
|
16.2 MB |
|
|
14.6 MB |
|
|
121.7 KB |
|
|
18.8 KB |
|
/Ikki - Bakala Banger [EP] (2010)/ |
|
|
|
10.6 MB |
|
|
10.2 MB |
|
|
9.1 MB |
|
|
121.5 KB |
|
/Ikonika & Optimum - Aqueous Cream & Ampersand (HBR001) [EP] (2010)/ |
|
|
|
12.8 MB |
|
|
11.7 MB |
|
|
376.9 KB |
|
/Ikonika - Dckhdbtch (ZIQ282) [EP] (2010)/ |
|
|
|
10.9 MB |
|
|
10.8 MB |
|
|
10.2 MB |
|
|
255.9 KB |
|
|
5.0 KB |
|
/Ill Blu - Bellion & Dragon Pop (HDB036) [EP] (2010)/ |
|
|
|
10.8 MB |
|
|
10.1 MB |
|
|
484.1 KB |
|
|
1.2 KB |
|
/In Flagranti feat Natalie Smash - Through The Rabbit Hole [EP] (2010)/ |
|
|
|
19.3 MB |
|
|
14.8 MB |
|
|
14.5 MB |
|
|
12.5 MB |
|
|
12.4 MB |
|
|
319.5 KB |
|
/Informant - Signal [EP] (2010)/ |
|
|
|
12.4 MB |
|
|
9.8 MB |
|
|
7.3 MB |
|
|
7.3 MB |
|
|
4.2 MB |
|
|
4.2 MB |
|
/Irish Steph - Power [EP] (2010)/ |
|
|
|
14.8 MB |
|
|
12.9 MB |
|
|
12.9 MB |
|
|
12.8 MB |
|
|
11.7 MB |
|
|
11.6 MB |
|
06- Irish Steph - Leprechauns Love Disco (Pulpalicious Remix).mp3 |
11.5 MB |
|
|
10.6 MB |
|
|
79.9 KB |
|
/J-Wow - Odeo (MAD-109) [EP] (2010)/ |
|
|
|
13.3 MB |
|
|
13.1 MB |
|
|
12.7 MB |
|
|
12.1 MB |
|
|
840.5 KB |
|
/Jack Beats - Revolution-Out Of My Body EP (2010)/ |
|
|
|
14.3 MB |
|
|
10.6 MB |
|
|
48.6 KB |
|
/Jahcoozi - Barefoot Wanderer (Remixes Part 2) [EP] (2010)/ |
|
|
|
14.7 MB |
|
|
12.9 MB |
|
|
12.8 MB |
|
|
12.5 MB |
|
|
7.4 MB |
|
|
65.0 KB |
|
/Jam City - Magic Drops (NS009) [EP] (2010)/ |
|
|
|
12.4 MB |
|
|
12.1 MB |
|
|
9.8 MB |
|
|
109.3 KB |
|
|
0.3 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Jamaica - Short & Entertaining [Remixes EP] (2010)/ |
|
|
|
11.8 MB |
|
|
10.3 MB |
|
|
9.2 MB |
|
|
8.7 MB |
|
|
7.0 MB |
|
|
47.4 KB |
|
/Jamie Lidell - I Wanna Be Your Telephone/ |
|
|
03-Jamie Lidell-I Wanna Be Your Telephone (Tiga Party Like it's 19909 remix).mp3 |
13.5 MB |
|
|
9.3 MB |
|
|
8.9 MB |
|
|
19.3 KB |
|
/Jan Driver - Gain Reaction (BNR053) [EP] (2010)/ |
|
|
|
14.9 MB |
|
|
13.4 MB |
|
|
12.1 MB |
|
|
11.0 MB |
|
|
21.6 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Japanese Popstars - Destroy [EP] (2010)/ |
|
|
The Japanese Popstars, Jon Spencer - Destroy (Autokratz Remix).mp3 |
15.3 MB |
|
The Japanese Popstars, Jon Spencer - Destroy (Doorly Remix).mp3 |
14.6 MB |
|
|
12.3 MB |
|
|
11.2 MB |
|
The Japanese Popstars, Jon Spencer - Destroy (Original Mix).mp3 |
11.0 MB |
|
|
47.5 KB |
|
/Jaymo & Andy George - Hold Me Back [EP] (2010)/ |
|
|
Andy George and Jaymo-Hold Me Back feat J2K Thomas Gandey Remix.mp3 |
16.6 MB |
|
Andy George and Jaymo-Hold Me Back feat J2K BeatauCue Remix.mp3 |
12.2 MB |
|
Andy George and Jaymo-Hold Me Back feat J2K Subskrpt Remix.mp3 |
11.0 MB |
|
|
10.5 MB |
|
Andy George and Jaymo-Hold Me Back feat J2K Original Mix.mp3 |
7.6 MB |
|
|
122.9 KB |
|
/Jesse Rose - Well Now EP (DSD025)-WEB-2009-CBR/ |
|
|
|
14.8 MB |
|
|
14.8 MB |
|
|
11.3 MB |
|
|
0.6 KB |
|
|
0.2 KB |
|
|
0.1 KB |
|
/Jesse Voorn - Zapp (W005) [EP] (2010)/ |
|
|
|
16.5 MB |
|
|
14.8 MB |
|
|
60.6 KB |
|
/Jessie Ware and SBTRKT - Nervous (NMBRS8) [EP] (2010)/ |
|
|
|
13.2 MB |
|
|
11.0 MB |
|
|
10.1 MB |
|
|
10.1 MB |
|
|
9.2 MB |
|
|
510.3 KB |
|
/Jeuce - Flavour (GDR009) [Remixes] (2010)/ |
|
|
|
20.4 MB |
|
|
15.0 MB |
|
|
13.3 MB |
|
|
12.6 MB |
|
|
12.3 MB |
|
|
12.2 MB |
|
|
12.2 MB |
|
|
11.6 MB |
|
|
10.1 MB |
|
|
9.0 MB |
|
|
498.2 KB |
|
/JFK and St Mandrew - Face Pump (Congorock Remix) [EP] (2010)/ |
|
|
|
12.7 MB |
|
|
10.8 MB |
|
|
220.7 KB |
|
/JFK and St. Mandrew - Beehive [RIOT001] (2010)/ |
|
|
|
10.5 MB |
|
|
9.5 MB |
|
|
240.1 KB |
|
/Joe And Will Ask - Rainbow Trout & Man The Cannons (DEADLY018D) [EP] (2010)/ |
|
|
|
15.3 MB |
|
|
14.6 MB |
|
/John Acquaviva & Alex Delia - Global Cooling EP (2010)/ |
|
|
03-john_acquaviva_and_alex_delia_-_global_cooling_(original_mix).mp3 |
17.5 MB |
|
02-john_acquaviva_and_alex_delia_-_salamandra_(tyler_michaud_and_manuel_de_la_mare_remix).mp3 |
16.7 MB |
|
01-john_acquaviva_and_alex_delia_-_salamandra_(alex_delia_and_nihil_young_2010_remix).mp3 |
16.4 MB |
|
00-john_acquaviva_and_alex_delia_-_global_cooling_ep-(defdig1019)-web-2010-srg.nfo |
12.8 KB |
|
00-john_acquaviva_and_alex_delia_-_global_cooling_ep-(defdig1019)-web-2010-srg.sfv |
0.3 KB |
|
00-john_acquaviva_and_alex_delia_-_global_cooling_ep-(defdig1019)-web-2010-srg.m3u |
0.3 KB |
|
/Jon Hopkins - Vessel & Wire [Remixes EP] (2010)/ |
|
|
|
17.8 MB |
|
|
15.4 MB |
|
|
76.6 KB |
|
/Jori Hulkkonen - I Am Dead [EP] (2010)/ |
|
|
|
17.5 MB |
|
|
16.3 MB |
|
|
15.1 MB |
|
01- Jori Hulkkonen - I Am Dead (Hercules & Love Affair Remix).mp3 |
13.5 MB |
|
|
11.5 MB |
|
|
7.4 MB |
|
|
52.0 KB |
|
/Joyce Muniz - Party Over Here, Party Over There (EXPDIGITAL04) [EP] (2010)/ |
|
|
04-joyce_muniz-party_over_here_and_party_over_there__homework_remix.mp3 |
16.6 MB |
|
02-joyce_muniz-party_over_here_and_party_over_there__pol_on_remix.mp3 |
16.1 MB |
|
05-joyce_muniz-party_over_here_and_party_over_there__j._phlip_remix.mp3 |
15.7 MB |
|
03-joyce_muniz-party_over_here_and_party_over_there__shir_khan_remix.mp3 |
15.1 MB |
|
|
14.4 MB |
|
|
92.6 KB |
|
/Julio Bashmore - Batak Groove & Around (SMR007) [EP] (2010)/ |
|
|
|
15.2 MB |
|
|
12.1 MB |
|
|
79.1 KB |
|
/Junkie XL - Fairlight [EP] (2010)/ |
|
|
|
17.2 MB |
|
|
16.5 MB |
|
|
8.9 MB |
|
|
113.4 KB |
|
/Justin Martin & Ardalan - Mr. Spock (DB043) [Single] (2010)/ |
|
|
|
13.7 MB |
|
|
52.7 KB |
|
|
30.2 KB |
|
/Kanji Kinetic - Thrill Seeka (XTSTD010) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
13.0 MB |
|
|
12.4 MB |
|
|
12.4 MB |
|
|
10.7 MB |
|
|
121.2 KB |
|
/Kano - Upside (BP002) [EP] (2010)/ |
|
|
|
14.1 MB |
|
|
9.4 MB |
|
|
9.1 MB |
|
|
7.5 MB |
|
|
371.3 KB |
|
/Kashii - Nether Where (ECB260D) [EP] (2010)/ |
|
|
|
12.3 MB |
|
|
11.7 MB |
|
|
10.5 MB |
|
|
9.2 MB |
|
|
3.3 MB |
|
|
3.2 KB |
|
/Kaskade feat. Martina of Dragonette - Fire In Your New Shoes [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
15.7 MB |
|
08- Fire In Your New Shoes (Innerpartysystem Extended Mix).mp3 |
15.7 MB |
|
|
15.4 MB |
|
|
12.0 MB |
|
|
11.9 MB |
|
09- Fire In Your New Shoes (Innerpartysystem Instrumental Mix).mp3 |
11.9 MB |
|
|
9.6 MB |
|
06- Fire In Your New Shoes (Innerpartysystem Radio Edit).mp3 |
8.3 MB |
|
|
39.4 KB |
|
/Kasper Bjorke - Alcatraz [EP] (2010)/ |
|
|
|
17.1 MB |
|
|
16.3 MB |
|
|
15.8 MB |
|
|
9.1 MB |
|
|
43.5 KB |
|
/Kastle - Better Off Alone (SECLUS025) [EP] (2010)/ |
|
|
|
14.4 MB |
|
|
12.4 MB |
|
|
11.7 MB |
|
|
10.9 MB |
|
|
10.7 MB |
|
|
8.3 MB |
|
|
219.7 KB |
|
/Kavinsky - Nightcall EP/ |
|
|
|
12.3 MB |
|
|
9.3 MB |
|
|
6.4 MB |
|
|
5.5 MB |
|
|
5.3 MB |
|
|
221.3 KB |
|
/Keith & Supabeatz - Some1 (ECB216D) [EP] (2010)/ |
|
|
|
14.8 MB |
|
|
13.9 MB |
|
|
12.3 MB |
|
|
11.2 MB |
|
|
233.5 KB |
|
/Keith and Supabeatz - Higher Place (ECB255DX) [EP] (2010)/ |
|
|
|
13.5 MB |
|
|
13.4 MB |
|
|
12.1 MB |
|
|
11.7 MB |
|
|
11.4 MB |
|
|
225.6 KB |
|
00-keith_and_supabeatz-higher_place_e.p.-(ecb255d)-web-2010.nfo |
4.3 KB |
|
/Kele - Everything You Wanted [PromoCDM] (2010)/ |
|
|
|
12.7 MB |
|
02-kele-everything_you_wanted_(fred_faulk_remix_instrumental).mp3 |
12.3 MB |
|
07-kele-everything_you_wanted_(dj_mujava_and_dj_qness_club_serenity_dub).mp3 |
9.0 MB |
|
|
8.3 MB |
|
|
8.2 MB |
|
06-kele-everything_you_wanted_(dj_mujava_and_dj_qness_club_serenity).mp3 |
7.2 MB |
|
|
6.9 MB |
|
|
5.9 MB |
|
/Kele - Tenderoni EP (2010)/ |
|
|
|
11.9 MB |
|
|
10.9 MB |
|
|
9.6 MB |
|
|
3.6 MB |
|
|
27.5 KB |
|
/Kid Kaio - Kid Kaio EP (2010)/ |
|
|
|
11.3 MB |
|
|
11.2 MB |
|
|
10.3 MB |
|
/Kids At The Bar - Exile (KR04) [EP] (2010)/ |
|
|
|
14.2 MB |
|
|
12.3 MB |
|
|
10.5 MB |
|
|
9.8 MB |
|
|
9.6 MB |
|
|
64.0 KB |
|
/Kingdom - That Mystic (NS006) [EP] (2010)/ |
|
|
|
12.3 MB |
|
|
12.1 MB |
|
|
12.0 MB |
|
|
10.9 MB |
|
|
10.8 MB |
|
|
305.3 KB |
|
/Kissed With A Noise ft. Young Buck - Watuppp [EP] (2010)/ |
|
|
Kissed With A Noise Ft. Young Buck - Watuppp (PeaceTreaty Remix).mp3 |
16.7 MB |
|
Kissed With A Noise Ft. Young Buck - Watuppp (Disco Villains Remix).mp3 |
14.2 MB |
|
Kissed With A Noise Ft. Young Buck - Watuppp (Skeet Skeet Remix).mp3 |
10.5 MB |
|
Kissed With A Noise Ft. Young Buck - Watuppp (Voodoo Vandals Remix).mp3 |
10.4 MB |
|
Kissed With A Noise Ft. Young Buck - Watuppp (Barletta Remix).mp3 |
9.1 MB |
|
|
9.0 MB |
|
Kissed With A Noise Ft. Young Buck - Watuppp (B.Rich Remix).mp3 |
9.0 MB |
|
|
103.4 KB |
|
/Kissy Sell Out & Lazy Flow - Kissy vs. Lazy (SCH005) [EP] (2010)/ |
|
|
|
15.8 MB |
|
|
14.8 MB |
|
|
13.4 MB |
|
|
12.6 MB |
|
|
12.2 MB |
|
|
11.8 MB |
|
|
206.4 KB |
|
/Kissy Sell Out And Tinashe - Come On Over (This Could Be Love) (SCH001D) [Remixes] (2010)/ |
|
|
03-kissy_sellout_and_tinashe-come_on_over_(punx_soundcheck_remix).mp3 |
9.0 MB |
|
02-kissy_sellout_and_tinashe-come_on_over_(urchins_remix).mp3 |
8.5 MB |
|
04-kissy_sellout_and_tinashe-come_on_over_(leatherhead_remix).mp3 |
6.2 MB |
|
|
5.8 MB |
|
05-kissy_sellout_and_tinashe-come_on_over_(schizofonics_remix).mp3 |
5.7 MB |
|
|
99.8 KB |
|
/Kode9 - You Don't Wash (K7272EP) [Remixes EP] (2010)/ |
|
|
01-kode9_feat_the_spaceape_-_you_dont_wash_(martyns_scrub_vocal)-zzzz.mp3 |
15.9 MB |
|
|
13.8 MB |
|
|
262.3 KB |
|
00-kode9_-_you_dont_wash_remixes-(k7272ep)-web-2010-zzzz.nfo |
8.2 KB |
|
/Konovalov - 1991 (IHU010) [EP] (2010)/ |
|
|
|
12.4 MB |
|
|
10.8 MB |
|
|
10.2 MB |
|
|
9.0 MB |
|
|
27.1 KB |
|
/Korallreven - The Truest Faith [EP] (2010)/ |
|
|
|
16.2 MB |
|
|
14.1 MB |
|
|
13.4 MB |
|
03 - Korallreven - The Truest Faith (Sail A Whale Remix).mp3 |
13.1 MB |
|
|
12.4 MB |
|
|
11.0 MB |
|
08 - Korallreven - Loved-Up (Cosimo Paradise Lost Remix).mp3 |
9.7 MB |
|
|
9.3 MB |
|
|
134.8 KB |
|
/Kotey Extra Band & Bottin - Hot Ring EP (2010)/ |
|
|
|
17.7 MB |
|
|
16.2 MB |
|
|
12.8 MB |
|
|
19.9 KB |
|
/LA Riots - The Drop/ |
|
|
|
17.2 MB |
|
|
14.0 MB |
|
|
13.9 MB |
|
|
13.5 MB |
|
|
12.1 MB |
|
|
10.9 MB |
|
|
10.3 MB |
|
/La Zebra - Feel The Music (MOZZ023D) [EP] (2010)/ |
|
|
|
17.2 MB |
|
|
12.3 MB |
|
|
12.2 MB |
|
|
9.9 MB |
|
|
9.9 MB |
|
|
81.7 KB |
|
/La Zebra - La Zebra EP (2010)/ |
|
|
|
12.5 MB |
|
|
12.1 MB |
|
|
9.9 MB |
|
|
9.4 MB |
|
|
9.0 MB |
|
|
8.9 MB |
|
|
101.5 KB |
|
/Laserkraft 3D - Nein, Mann! [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
16.1 MB |
|
|
15.1 MB |
|
|
14.4 MB |
|
02- Laserkraft 3D - Nein, Mann! (Tocadisco's TOCACABANA Remix).mp3 |
13.1 MB |
|
|
11.3 MB |
|
|
9.5 MB |
|
|
350.4 KB |
|
/Late of the Pier - Remixes EP [EP] (2010)/ |
|
|
|
12.8 MB |
|
|
12.4 MB |
|
|
10.2 MB |
|
|
7.3 MB |
|
|
37.7 KB |
|
/Laurent Garnier - Gnanmankoudji EP (2010)/ |
|
|
02-laurent_garnier-gnanmankoudji_(emperor_machine_remix).mp3 |
22.0 MB |
|
01-laurent_garnier-gnanmankoudji_(andreas_saags_jazz_lesson).mp3 |
21.1 MB |
|
03-laurent_garnier-gnanmankoudji_(kultur_and_colombo_remix).mp3 |
17.0 MB |
|
|
200.6 KB |
|
/Lazer Sword - Shot In The Nite [Single] (2010)/ |
|
|
|
10.8 MB |
|
|
7.1 MB |
|
|
116.8 KB |
|
/Lazy Flow - El Konquistador (YGZ002) [EP] (2010)/ |
|
|
|
15.0 MB |
|
|
11.8 MB |
|
|
10.4 MB |
|
|
9.2 MB |
|
|
8.9 MB |
|
|
8.0 MB |
|
|
445.9 KB |
|
/Lazy Rich & Porter Robinson feat. Sue Cho - Hello (BFR047) [Single] (2010)/ |
|
|
Lazy Rich & Porter Robinson feat. Sue Cho - Hello (Original Mix).mp3 |
17.3 MB |
|
Lazy Rich & Porter Robinson feat. Sue Cho - Hello (Radio Edit).mp3 |
8.4 MB |
|
|
1.2 MB |
|
/Lazy Rich - Discofukkr (ROR047) [Remixes EP] (2010)/ |
|
|
|
16.0 MB |
|
|
15.8 MB |
|
|
13.3 MB |
|
|
13.0 MB |
|
|
12.4 MB |
|
|
101.6 KB |
|
|
8.5 KB |
|
/Lazy Rich Feat. Lizzie Curious - Boom (BFR051) [Single] (2010)/ |
|
|
|
15.4 MB |
|
|
283.4 KB |
|
|
0.6 KB |
|
IndieBubbles.com - All Indie and Electro For Free Download.url |
0.1 KB |
|
/LBCK - LBCK EP (2010)/ |
|
|
|
12.7 MB |
|
|
8.6 MB |
|
|
8.3 MB |
|
|
8.3 MB |
|
|
8.2 MB |
|
|
7.6 MB |
|
|
5.2 MB |
|
|
58.4 KB |
|
/LCD Soundsystem - I Can Change [EP] (2010)/ |
|
|
|
20.6 MB |
|
|
18.7 MB |
|
|
18.4 MB |
|
05- LCD Soundsystem - I Can Change (Stereogamous Inlovestrumental).mp3 |
18.2 MB |
|
|
14.3 MB |
|
|
69.7 KB |
|
/Le Castle Vania - Nobody Gets Out Alive (ALWAYS001) [Remixes EP] (2010)/ |
|
|
|
13.3 MB |
|
|
12.3 MB |
|
|
11.3 MB |
|
|
10.9 MB |
|
|
10.9 MB |
|
|
945.0 KB |
|
/Lebatman - Lebatman (2010)/ |
|
|
|
12.0 MB |
|
|
11.9 MB |
|
|
11.7 MB |
|
|
11.6 MB |
|
|
11.0 MB |
|
|
10.9 MB |
|
|
10.8 MB |
|
|
10.4 MB |
|
|
10.4 MB |
|
|
10.4 MB |
|
|
10.0 MB |
|
|
7.6 MB |
|
|
23.4 KB |
|
/Lee Mortimer and Foamo - Superman (WEAR031) [EP] (2010)/ |
|
|
|
13.2 MB |
|
|
12.2 MB |
|
|
12.1 MB |
|
|
11.4 MB |
|
|
99.3 KB |
|
/Lemonade - Lifted (True Panther Sounds) [EP] (2010)/ |
|
|
|
16.3 MB |
|
|
13.7 MB |
|
|
13.2 MB |
|
|
12.7 MB |
|
|
11.5 MB |
|
|
10.8 MB |
|
|
10.0 MB |
|
|
14.4 KB |
|
/Les Petits Pilous - Bielle EP/ |
|
|
|
11.2 MB |
|
|
9.7 MB |
|
|
9.1 MB |
|
|
8.5 MB |
|
|
237.3 KB |
|
/Les Sins - Lina [EP] (2010)/ |
|
|
|
9.4 MB |
|
|
7.8 MB |
|
|
41.1 KB |
|
/Light Year - Five Girls (BANG035) [EP] (2010)/ |
|
|
|
11.1 MB |
|
|
10.4 MB |
|
|
10.3 MB |
|
|
9.2 MB |
|
|
9.1 MB |
|
|
80.9 KB |
|
/Light Year - Night Vision (BANG031DIG) [EP] (2010)/ |
|
|
|
11.5 MB |
|
|
10.4 MB |
|
|
9.8 MB |
|
|
9.3 MB |
|
|
9.3 MB |
|
|
9.0 MB |
|
|
135.9 KB |
|
/Logo - La Vie Moderne [EP] (2010)/ |
|
|
|
28.7 MB |
|
|
18.5 MB |
|
|
16.3 MB |
|
|
13.6 MB |
|
|
13.1 MB |
|
|
10.8 MB |
|
|
9.7 MB |
|
|
99.6 KB |
|
/Logo - La Vie Moderne_Junocide (K114) [EP] (2010)/ |
|
|
|
28.7 MB |
|
|
18.5 MB |
|
|
16.3 MB |
|
|
13.6 MB |
|
08- La Vie Moderne (French Fries & Tony Senghore Remix feat. PiuPiu).mp3 |
13.3 MB |
|
|
13.0 MB |
|
|
10.8 MB |
|
|
9.7 MB |
|
|
375.8 KB |
|
/LOL Boys - 123 [EP] (2010)/ |
|
|
|
11.4 MB |
|
|
9.6 MB |
|
|
317.0 KB |
|
/Lone - Pineapple Crush (CHEAPER023) [EP] (2010)/ |
|
|
|
13.9 MB |
|
|
13.1 MB |
|
|
12.5 MB |
|
|
10.9 MB |
|
|
118.1 KB |
|
/Lorenzo Vektor - Turn It Up (SIL002) [EP] (2010)/ |
|
|
|
16.1 MB |
|
|
13.2 MB |
|
|
12.5 MB |
|
|
12.0 MB |
|
|
10.8 MB |
|
|
10.6 MB |
|
|
266.6 KB |
|
/Losers (Feat Riz MC and Envy) - Flush Remixes (DTIL025D) [EP] (2010)/ |
|
|
03- Losers (Feat. Riz MC & Envy) - Flush (Dan Le Sac Do Do Remix).mp3 |
16.0 MB |
|
|
11.6 MB |
|
05- Losers (Feat. Riz MC & Envy) - Flush (South Central Remix).mp3 |
11.4 MB |
|
|
11.2 MB |
|
|
11.2 MB |
|
06- Losers (Feat. Riz MC & Envy) - Flush (Sukh Knight Remix).mp3 |
11.0 MB |
|
|
8.8 MB |
|
|
37.4 KB |
|
/Losers - No Man Is An Island (Theme From Losers) EP] (2009)/ |
|
|
|
9.5 MB |
|
|
8.9 MB |
|
|
6.3 MB |
|
04- Losers - No Man Is An Island (Tobias Doppelganger Remix).mp3 |
5.7 MB |
|
|
14.5 KB |
|
/Lukes Anger - The Humdinger (MEOW162) [EP] (2010)/ |
|
|
|
11.8 MB |
|
|
11.6 MB |
|
|
11.5 MB |
|
|
10.9 MB |
|
|
383.7 KB |
|
/M.I.A. - XXXO Remixes (2010)/ |
|
|
|
5.9 MB |
|
|
5.8 MB |
|
|
4.8 MB |
|
|
4.8 MB |
|
|
4.4 MB |
|
|
420.6 KB |
|
/M.S.K. - Mask Mask Mask (2010)/ |
|
|
|
12.1 MB |
|
|
11.8 MB |
|
|
11.1 MB |
|
|
11.0 MB |
|
|
10.8 MB |
|
|
10.6 MB |
|
|
10.4 MB |
|
|
10.3 MB |
|
|
9.9 MB |
|
|
9.1 MB |
|
|
9.1 MB |
|
|
8.9 MB |
|
|
8.3 MB |
|
|
63.7 KB |
|
|
43.5 KB |
|
/Ma5k - The Other Side [EP] (2010)/ |
|
|
|
11.0 MB |
|
|
8.4 MB |
|
|
8.2 MB |
|
|
7.9 MB |
|
|
7.7 MB |
|
|
7.4 MB |
|
|
7.4 MB |
|
|
55.8 KB |
|
/Machinedrum - Let It (IL1008) [EP] (2010)/ |
|
|
|
11.0 MB |
|
|
9.6 MB |
|
|
8.6 MB |
|
|
8.1 MB |
|
|
7.4 MB |
|
|
5.9 MB |
|
|
390.4 KB |
|
/Machinedrum - Many Faces (LM005) [EP] (2010)/ |
|
|
|
13.6 MB |
|
|
13.2 MB |
|
|
11.8 MB |
|
|
11.0 MB |
|
|
10.4 MB |
|
|
5.4 MB |
|
|
5.0 MB |
|
|
509.6 KB |
|
|
1.3 KB |
|
/Maddslinky - Special (TRUEP217) [EP] (2010)/ |
|
|
|
17.6 MB |
|
|
15.4 MB |
|
05-maddslinky-special_(mj_coles_back_to_the_future_remix).mp3 |
14.3 MB |
|
|
14.2 MB |
|
|
13.6 MB |
|
|
13.6 MB |
|
|
13.5 MB |
|
|
13.4 MB |
|
|
13.3 MB |
|
|
13.2 MB |
|
|
9.2 MB |
|
|
57.7 KB |
|
00-maddslinky-special_(incl._atjazz_remix)-(truep217)-web-2010-hft.nfo |
3.2 KB |
|
/Maelstrom - Wide Open (KTZDG01) [EP] (2010)/ |
|
|
|
14.7 MB |
|
|
13.5 MB |
|
|
12.2 MB |
|
|
12.2 MB |
|
|
143.1 KB |
|
/Magik Johnson - Disco Mustaccio & Ghost Piano (ECB235D) [EP] (2010)/ |
|
|
03-magik_johnson-disco_mustaccio_(sam_roqwell_and_isancho_remix)-alki.mp3 |
17.2 MB |
|
|
14.7 MB |
|
|
13.7 MB |
|
|
9.0 MB |
|
|
233.9 KB |
|
/Magnetic Man - Perfect Stranger [Single] (2010)/ |
|
|
02-magnetic_man-perfect_stranger_(feat._katy_b)_(album_version).mp3 |
8.5 MB |
|
01-magnetic_man-perfect_stranger_(feat._katy_b)_(benga_remix).mp3 |
7.0 MB |
|
|
85.4 KB |
|
|
0.8 KB |
|
/Major Lazer - Lazers Never Die [EP] (2010)/ |
|
|
|
15.4 MB |
|
|
12.8 MB |
|
|
11.6 MB |
|
|
9.4 MB |
|
|
7.0 MB |
|
|
50.9 KB |
|
/Make The Girl Dance - Kill Me (PBR026) [EP] (2010)/ |
|
|
|
10.0 MB |
|
|
8.9 MB |
|
|
8.5 MB |
|
|
7.4 MB |
|
|
7.0 MB |
|
|
6.9 MB |
|
|
286.8 KB |
|
/Make the Girl Dance - Wall Of Death (ROY22) [EP] (2010)/ |
|
|
Make_The_Girl_Dance_feat_Solange_La_Frange_-_Wall_Of_Death_(The_Killers_Rabbits_remix)_320.mp3 |
13.9 MB |
|
Make_The_Girl_Dance_feat_Solange_La_Frange_-_Wall_Of_Death_(Cyberpunkers_remix)_320.mp3 |
11.3 MB |
|
Make_The_Girl_Dance_feat_Solange_La_Frange_-_Wall_Of_Death_(StereoHeroes_remix)_320.mp3 |
9.8 MB |
|
Make_The_Girl_Dance_feat_Solange_La_Frange_-_Wall_Of_Death_(original_mix)_320.mp3 |
8.5 MB |
|
|
528.7 KB |
|
/Malente & Moston - Oh My God (NBR001) [EP] (2010)/ |
|
|
|
16.0 MB |
|
2. Moston and Malente - Oh My God (Chaos In The CBD Remix).mp3 |
13.5 MB |
|
|
12.9 MB |
|
3. Moston and Malente - Oh My God (Rishi Romero Ghetto Electric Remix).mp3 |
12.5 MB |
|
|
12.0 MB |
|
|
11.3 MB |
|
|
11.2 MB |
|
|
11.2 MB |
|
|
268.6 KB |
|
/Manare - Speakeasy [EP] (2010)/ |
|
|
|
18.8 MB |
|
|
15.3 MB |
|
|
13.0 MB |
|
|
11.2 MB |
|
|
11.1 MB |
|
|
9.4 MB |
|
|
145.2 KB |
|
/Manaré - Quiet Riot [EP] (2010)/ |
|
|
|
17.5 MB |
|
|
15.1 MB |
|
|
14.0 MB |
|
|
13.8 MB |
|
|
12.3 MB |
|
|
12.3 MB |
|
|
10.9 MB |
|
|
176.7 KB |
|
/Mange Le Funk - I Still Want You (Promo2010)/ |
|
|
03-mange_le_funk-i_still_want_you_(the_revenge_running_remix).mp3 |
14.2 MB |
|
|
10.4 MB |
|
01-mange_le_funk-i_still_want_you_(gramophonedzie_remix).mp3 |
8.4 MB |
|
|
1.0 KB |
|
/Marc Remillard - Heavy Bass Champions Of The World Vol XII (TBD 049) [EP] (2010)/ |
|
|
|
10.0 MB |
|
|
196.5 KB |
|
|
0.1 KB |
|
/Marcus Price & Carli - Mat Bira Kvinnor Weed EP (2010)/ |
|
|
|
14.2 MB |
|
|
13.7 MB |
|
|
13.5 MB |
|
|
13.2 MB |
|
|
13.1 MB |
|
|
8.2 MB |
|
|
8.0 MB |
|
|
7.4 MB |
|
|
833.5 KB |
|
/Mark Ronson and The Business Intl - Bang Bang Bang (2010)/ |
|
|
|
14.9 MB |
|
|
12.9 MB |
|
|
9.8 MB |
|
|
9.3 MB |
|
|
164.6 KB |
|
/Mason - Runaway (MOO008) [EP] (2010)/ |
|
|
|
15.2 MB |
|
|
14.3 MB |
|
|
7.4 MB |
|
|
6.7 MB |
|
|
189.3 KB |
|
|
0.9 KB |
|
|
0.2 KB |
|
|
0.1 KB |
|
|
0.0 KB |
|
/Mason - You Are Not Alone (MOO007) [EP] (2010)/ |
|
|
|
19.2 MB |
|
|
16.3 MB |
|
|
15.9 MB |
|
|
15.4 MB |
|
|
15.4 MB |
|
|
15.4 MB |
|
|
8.8 MB |
|
|
180.0 KB |
|
|
1.2 KB |
|
|
0.4 KB |
|
|
0.3 KB |
|
/May68 - The Prisoner [EP] (KITSUNE118) (2010)/ |
|
|
|
16.8 MB |
|
03- May68 - The Prisoner (Vicarious Bliss Halfweg Birthday Club Dub Mix).mp3 |
13.0 MB |
|
|
13.0 MB |
|
|
11.8 MB |
|
|
10.7 MB |
|
|
131.6 KB |
|
/Mekka Mekka - Right Now (SSS002) [EP] (2010)/ |
|
|
|
10.4 MB |
|
|
10.1 MB |
|
|
9.2 MB |
|
|
284.4 KB |
|
|
276.0 KB |
|
|
0.5 KB |
|
/Melé - Bombay (MIX008) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
13.7 MB |
|
|
11.9 MB |
|
|
11.9 MB |
|
|
11.5 MB |
|
|
11.3 MB |
|
|
761.5 KB |
|
/Mighty Mouse - Disco Battle Weapons (DISCOC001) [EP] (2010)/ |
|
|
|
13.9 MB |
|
|
13.8 MB |
|
|
121.4 KB |
|
/Mightyfools - Thats The Shit (LL30D) (2010)/ |
|
|
|
12.2 MB |
|
|
10.8 MB |
|
|
114.9 KB |
|
|
0.6 KB |
|
|
0.1 KB |
|
|
0.1 KB |
|
/Mightyfools vs. Sharkslayer - Devils Marbles (LL35D) [EP] (2010)/ |
|
|
01_mightyfools_and_sharkslayer_-_devils_marbles_(club_mix).mp3 |
14.3 MB |
|
02_mightyfools_and_sharkslayer_-_devils_marbles_(dub_mix).mp3 |
14.3 MB |
|
|
151.5 KB |
|
00_mightyfools_and_sharkslayer_-_devils_marbles-(ll35d)-web-2010.nfo |
0.6 KB |
|
/Mikix The Cat Feat. Shannon - The Key [EP] (2010)/ |
|
|
02 - The Key feat Shannon_Sound Pellegrino Thermal Team Remix.mp3 |
16.8 MB |
|
|
11.0 MB |
|
|
10.4 MB |
|
|
102.6 KB |
|
/MJ Cole & Wiley - From The Drop (PROPH121) [EP] (2010)/ |
|
|
|
13.8 MB |
|
|
11.4 MB |
|
|
8.8 MB |
|
|
8.8 MB |
|
|
88.1 KB |
|
/Modek - Hiroshima (MSMD812) [EP] (2010)/ |
|
|
|
15.9 MB |
|
|
13.3 MB |
|
|
13.0 MB |
|
|
12.8 MB |
|
|
11.4 MB |
|
|
11.4 MB |
|
|
67.9 KB |
|
/Modeselektion Vol.01 #2 (MONKEYTOWN05) [EP] (2010)/ |
|
|
|
13.4 MB |
|
|
11.3 MB |
|
|
11.2 MB |
|
|
37.2 KB |
|
/Modeselektion Vol.1 (MONKEYTOWN4) [EP] (2010)/ |
|
|
|
13.9 MB |
|
|
13.1 MB |
|
|
11.7 MB |
|
|
118.9 KB |
|
|
11.2 KB |
|
/Modeselektor - Art & Cash (50WEAPONS04DGTL) [Remixes EP] (2010)/ |
|
|
|
12.8 MB |
|
|
12.4 MB |
|
|
10.9 MB |
|
|
10.0 MB |
|
|
62.4 KB |
|
00-modeselektor_-_art_and_cash_remixes-(50weapons04dgtl)-web-2010-zzzz.nfo |
8.2 KB |
|
/Moguai - Oyster (MAU5026)-WEB-2010-SRG/ |
|
|
|
20.5 MB |
|
|
20.3 MB |
|
|
17.5 MB |
|
00-moguai_-_oyster__incl_michael_woods_remix-(mau5026)-web-2010-srg.nfo |
12.7 KB |
|
/Monarchy - Love Get Out Of My Way (2010)/ |
|
|
05-monarchy-love_get_out_of_my_way_(tim_goldsworthy_remix).mp3 |
9.2 MB |
|
06-monarchy-love_get_out_of_my_way_(tim_goldsworthy_dub).mp3 |
8.6 MB |
|
|
7.9 MB |
|
|
7.7 MB |
|
07-monarchy-love_get_out_of_my_way_(treasure_fingers_remix).mp3 |
6.2 MB |
|
|
6.1 MB |
|
|
5.2 MB |
|
|
76.2 KB |
|
|
2.0 KB |
|
|
0.5 KB |
|
|
0.4 KB |
|
/Monarchy - Love Get Out Of My Way (PromoCDM-2010)/ |
|
|
05-monarchy--love_get_out_of_my_way_(tim_goldsworthy_remix)-wus.mp3 |
9.2 MB |
|
06-monarchy--love_get_out_of_my_way_(tim_goldsworthy_dub)-wus.mp3 |
8.7 MB |
|
|
8.3 MB |
|
|
8.3 MB |
|
07-monarchy--love_get_out_of_my_way_(holy_ghost_feat._dixon_remix)-wus.mp3 |
8.1 MB |
|
08-monarchy--love_get_out_of_my_way_(holy_ghost_feat._dixon_dub)-wus.mp3 |
7.9 MB |
|
10-monarchy--love_get_out_of_my_way_(treasure_fingers_remix)-wus.mp3 |
6.3 MB |
|
|
6.2 MB |
|
|
5.1 MB |
|
02-monarchy--love_get_out_of_my_way_(benassi_remix_radio_edit)-wus.mp3 |
4.7 MB |
|
|
54.0 KB |
|
/Mondkopf - Deaf House EP (2010)/ |
|
|
|
9.6 MB |
|
|
7.0 MB |
|
|
6.6 MB |
|
|
5.1 MB |
|
|
351.6 KB |
|
/Monkey Safari - Zulu (WHAT012) [EP] (2010)/ |
|
|
|
15.3 MB |
|
|
13.5 MB |
|
|
12.0 MB |
|
|
11.0 MB |
|
|
10.8 MB |
|
|
10.1 MB |
|
|
70.6 KB |
|
/Monsieur Adi - We Are The Romans [Remixes EP] (2010)/ |
|
|
|
13.9 MB |
|
|
11.8 MB |
|
|
10.1 MB |
|
|
10.1 MB |
|
|
9.4 MB |
|
|
8.9 MB |
|
|
148.8 KB |
|
00-monsieur_adi-we_are_the_romans_(the_remixes)-web-2010.nfo |
0.7 KB |
|
/Motor - Autokill & Pitch123 EP/ |
|
|
|
18.0 MB |
|
|
10.6 MB |
|
|
0.5 KB |
|
/Moullinex - Superman EP (2010)/ |
|
|
|
12.2 MB |
|
|
9.4 MB |
|
|
9.0 MB |
|
|
8.0 MB |
|
|
7.7 MB |
|
|
7.6 MB |
|
|
264.1 KB |
|
/Mowgli - Caraibi (DFEP16) [EP] (2010)/ |
|
|
|
20.4 MB |
|
|
19.0 MB |
|
|
15.9 MB |
|
|
15.2 MB |
|
|
18.1 KB |
|
/Mowgli - We Think It's Cool (DFEP15) [EP] (2010)/ |
|
|
|
19.7 MB |
|
|
19.5 MB |
|
|
19.4 MB |
|
|
8.6 MB |
|
|
227.0 KB |
|
/Mr Fogg - Stung [EP] (2010)/ |
|
|
|
11.2 MB |
|
|
10.0 MB |
|
|
28.8 KB |
|
/Mr Moustache - Female [EP] (2010)/ |
|
|
|
10.5 MB |
|
|
10.2 MB |
|
|
10.1 MB |
|
|
9.9 MB |
|
|
7.0 MB |
|
|
144.7 KB |
|
|
54.6 KB |
|
|
0.1 KB |
|
/Mr. Oizo & Gaspard Augé - Rubber [EP] (2010)/ |
|
|
|
10.0 MB |
|
|
9.6 MB |
|
|
7.4 MB |
|
04. Mr. Oizo & Gaspard Augé - Rubber (Flying Lotus 'Unprotected Sex' Remix).mp3 |
7.3 MB |
|
|
165.7 KB |
|
/Mumbai Science - Ancova (2010)/ |
|
|
|
14.1 MB |
|
|
13.2 MB |
|
|
12.1 MB |
|
|
159.8 KB |
|
/Mumbai Science - Gold (LL39D) [EP] (2010)/ |
|
|
|
15.9 MB |
|
|
15.7 MB |
|
|
12.7 MB |
|
|
89.6 KB |
|
/Mumbai Science - Woof (LL25D) [EP] (2010)/ |
|
|
|
12.8 MB |
|
|
10.9 MB |
|
|
10.3 MB |
|
|
135.6 KB |
|
/Mumdance - The Mum Decent (MAD-117) [EP] (2010)/ |
|
|
|
12.1 MB |
|
|
11.2 MB |
|
|
10.7 MB |
|
|
7.1 MB |
|
|
192.1 KB |
|
/Mumdance And Brodinski - Eurostarr (ECB197D) [EP] (2009)/ |
|
|
02-mumdance_and_brodinski-eurostarr_-_zombie_disco_squad_remix-kouala.mp3 |
18.9 MB |
|
01-mumdance_and_brodinski-eurostarr_-_original_mix-kouala.mp3 |
13.4 MB |
|
04-mumdance_and_brodinski-eurostarr_-_high_rankin_remix-kouala.mp3 |
13.3 MB |
|
03-mumdance and brodinski - eurostarr - nic_sarno_remake.mp3 |
12.4 MB |
|
|
217.1 KB |
|
/Munchi - Murda Sound (TA0019) [EP] (2010)/ |
|
|
|
14.3 MB |
|
|
13.4 MB |
|
|
12.6 MB |
|
|
10.3 MB |
|
|
8.2 MB |
|
|
7.3 MB |
|
|
44.6 KB |
|
/Munk - La Musica (GOMMADT015) [EP] (2010)/ |
|
|
|
18.9 MB |
|
|
18.7 MB |
|
|
17.2 MB |
|
|
16.2 MB |
|
|
12.4 MB |
|
|
11.3 MB |
|
|
203.1 KB |
|
/Muscles - Younger & Immature [EP] (2010)/ |
|
|
|
8.5 MB |
|
|
7.9 MB |
|
|
7.3 MB |
|
|
7.0 MB |
|
|
5.9 MB |
|
|
88.0 KB |
|
/Mustang - Apocalypso [EP] (2010)/ |
|
|
|
19.1 MB |
|
|
16.9 MB |
|
|
585.5 KB |
|
|
0.1 KB |
|
/Mustang - Chameleon Circus [EP] (2010)/ |
|
|
|
15.2 MB |
|
|
15.0 MB |
|
|
13.6 MB |
|
|
12.9 MB |
|
|
21.0 KB |
|
/Mustard Pimp - Cherry & Kiwi (DM168) [Remixed EP] (2010)/ |
|
|
|
13.3 MB |
|
|
13.3 MB |
|
|
12.8 MB |
|
|
11.7 MB |
|
|
11.7 MB |
|
|
11.2 MB |
|
|
10.9 MB |
|
|
10.6 MB |
|
|
9.8 MB |
|
|
97.6 KB |
|
/Mux Mool - Wax Rose Saturday (GI-121) [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
12.1 MB |
|
|
10.6 MB |
|
|
8.9 MB |
|
06-mux_mool-wolf_tone_symphony_(paul_white_remix)-kouala.mp3 |
8.8 MB |
|
|
8.4 MB |
|
|
6.8 MB |
|
|
6.5 MB |
|
|
510.4 KB |
|
00-mux_mool-wax_rose_saturday_ep-(gi-121)-web-2010-kouala.nfo |
1.6 KB |
|
/N.A.S.A - The Big Bang (Remixes) [Album] (2010)/ |
|
|
|
10.5 MB |
|
10- Whachadoin (Villains Remix feat. Spank Rock, M.I.A., Santigold and Nick Zinner).mp3 |
8.5 MB |
|
08- Way Down (Squeak E. Clean Jupiter Remix feat. RZA and Barbie Hatch).mp3 |
8.1 MB |
|
13- N.A.S.A. Music (LA Riots Remix feat. Method Man, E40 and DJ Swamp).mp3 |
8.1 MB |
|
06- Gifted (Treasure Fingers Epicwave Remix feat. Kanye West, Santigold & Lykke Li).mp3 |
8.0 MB |
|
05- Whachadoin (Boombotz Remix feat. Spank Rock, M.I.A. & Santigold).mp3 |
7.8 MB |
|
09- A Volta (J.O.B. Remix feat. Sizzla, Amanda Blank and Lovefoxx).mp3 |
7.4 MB |
|
02- Gifted (Boombotz Remix) feat. Kanye West, Santigold, Lykke Li & Maximum Hedrum.mp3 |
7.1 MB |
|
|
6.9 MB |
|
07- There's A Party (Funkglorious Remix feat. George Clinton & Chali 2na).mp3 |
6.6 MB |
|
11- Money (The Count's Dungeon Remix feat. David Byrne, Chuck D., Seu Jorge and Z. Trip).mp3 |
6.6 MB |
|
12- Gifted (Steve Aoki Remix feat. Kanye West, Santigold & Lykke Li).mp3 |
6.6 MB |
|
04- I Wanna Be Your Lover feat. Maximum Hedrum and Barbie Hatch.mp3 |
6.1 MB |
|
|
5.8 MB |
|
03- Samba Soul (Ape Shit Brothers Remix feat. Del tha Funkee Homosapien).mp3 |
5.7 MB |
|
|
5.7 MB |
|
|
4.4 MB |
|
|
322.5 KB |
|
/Nakion - Jesu Sufo (TSR041) [EP] (2010)/ |
|
|
|
18.1 MB |
|
|
16.5 MB |
|
|
12.5 MB |
|
|
10.5 MB |
|
|
474.1 KB |
|
|
0.6 KB |
|
/NastyNasty - Puke Paint (FTNT011) [EP] (2010)/ |
|
|
|
8.6 MB |
|
|
7.8 MB |
|
|
7.4 MB |
|
|
7.2 MB |
|
|
7.0 MB |
|
|
505.9 KB |
|
/Neo Tokyo - Laser Laser (ARCADE006) [EP] (2010)/ |
|
|
|
13.5 MB |
|
|
13.1 MB |
|
|
12.5 MB |
|
|
175.7 KB |
|
/Nguzunguzu - Mirage (SIL003) [EP] (2010)/ |
|
|
|
10.5 MB |
|
|
10.0 MB |
|
|
9.6 MB |
|
|
8.6 MB |
|
|
8.0 MB |
|
|
170.4 KB |
|
/Nightbreaker - Tokamak (ARB006) [EP] (2010)/ |
|
|
|
12.7 MB |
|
|
12.1 MB |
|
|
9.6 MB |
|
/NinetyNine - L'Argent [EP] (2010)/ |
|
|
|
10.8 MB |
|
|
10.7 MB |
|
|
9.8 MB |
|
|
9.5 MB |
|
|
9.0 MB |
|
|
8.2 MB |
|
|
529.8 KB |
|
/Nobody Beats the Drum - Dirty Monkey [EP] (2010)/ |
|
|
Nobody beats the drum_05_Over & Over (Slagsmalsklubben remix).mp3 |
10.6 MB |
|
Nobody beats the drum_03_Dirty Monkey (Max Morrell remix).mp3 |
9.7 MB |
|
|
8.8 MB |
|
|
8.2 MB |
|
|
7.8 MB |
|
|
237.4 KB |
|
/Noisia - Alpha Centauri (DVSN007) [EP] (2010)/ |
|
|
|
14.7 MB |
|
|
11.7 MB |
|
|
220.4 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Nom De Strip - Nom De Strip (EP) (2010)/ |
|
|
|
15.1 MB |
|
|
12.8 MB |
|
|
10.6 MB |
|
/Nouveau Yorican - Chiuso (DFTD292D) [Single] (2010)/ |
|
|
|
14.3 MB |
|
|
167.6 KB |
|
IndieBubbles.com - All Indie and Electro For Free Download.url |
0.1 KB |
|
/Nouveau Yorican - Jackit (MIXMA022) [EP] (2010)/ |
|
|
|
17.7 MB |
|
|
12.5 MB |
|
|
11.6 MB |
|
|
678.2 KB |
|
/NT89 & Distrakt - Pumpin' [EP] (2010)/ |
|
|
|
11.9 MB |
|
|
10.6 MB |
|
|
10.4 MB |
|
|
514.1 KB |
|
/NT89 - Dooma (ECB213DX) [EP] (2010)/ |
|
|
|
13.1 MB |
|
|
12.8 MB |
|
|
221.7 KB |
|
/Numan - Race Against Time (ZIQ284) [EP] (2010)/ |
|
|
|
11.9 MB |
|
|
10.1 MB |
|
|
9.5 MB |
|
|
5.7 MB |
|
|
24.6 KB |
|
|
11.8 KB |
|
/Ocelot - Beating Hearts (WOS072D) [EP] (2010)/ |
|
|
|
11.5 MB |
|
|
9.6 MB |
|
|
8.6 MB |
|
|
6.9 MB |
|
|
6.2 MB |
|
|
4.3 MB |
|
|
293.6 KB |
|
/Oliver $ - Shaka-Lao (PID001) [EP] (2010)/ |
|
|
|
16.5 MB |
|
|
13.2 MB |
|
|
139.2 KB |
|
/Oliver S - I Hope EP (010)/ |
|
|
|
15.2 MB |
|
|
13.8 MB |
|
|
12.7 MB |
|
|
12.0 MB |
|
|
37.5 KB |
|
/Oliver Twitz - Loca (MAD108) [EP] (2010)/ |
|
|
|
12.6 MB |
|
|
10.8 MB |
|
|
48.6 KB |
|
|
41.7 KB |
|
|
36.0 KB |
|
/oOoOO - oOoOO [EP] (2010)/ |
|
|
|
9.6 MB |
|
|
9.0 MB |
|
|
8.6 MB |
|
|
7.3 MB |
|
|
6.7 MB |
|
|
3.8 MB |
|
|
61.0 KB |
|
/Optimum - Max Power (ZIQ283) [EP] (2010)/ |
|
|
|
13.8 MB |
|
|
12.4 MB |
|
|
11.5 MB |
|
|
461.3 KB |
|
|
11.0 KB |
|
/Oriol - Coconut Coast-[WEB] (2010)/ |
|
|
|
13.7 MB |
|
|
12.8 MB |
|
|
10.6 MB |
|
|
7.5 MB |
|
|
95.7 KB |
|
/Ostblockschlampen - Rude Nudes (DDR004) [EP] (2010)/ |
|
|
|
14.4 MB |
|
|
13.3 MB |
|
|
12.2 MB |
|
|
11.5 MB |
|
|
11.0 MB |
|
|
11.0 MB |
|
|
6.5 MB |
|
|
863.5 KB |
|
|
11.1 KB |
|
/Overthrill - The Upper Worlds [EP] (2010)/ |
|
|
02 - The Upper Worlds feat. Miss Wonder (Monsieur Adi Remix).mp3 |
10.1 MB |
|
|
9.7 MB |
|
|
9.7 MB |
|
|
9.0 MB |
|
|
8.7 MB |
|
|
7.6 MB |
|
|
93.4 KB |
|
/Pablo Calamari - Riddim (SWEATDS029) [EP] (2010)/ |
|
|
|
11.5 MB |
|
|
11.0 MB |
|
|
9.1 MB |
|
|
8.6 MB |
|
|
399.3 KB |
|
|
33.0 KB |
|
/Palmbomen - Moon Children [EP] (2010)/ |
|
|
|
15.5 MB |
|
|
14.5 MB |
|
|
14.2 MB |
|
|
13.2 MB |
|
|
11.9 MB |
|
|
8.0 MB |
|
|
3.7 MB |
|
/Pance Party - Let's Get Invisible! EP (2010)/ |
|
|
|
16.9 MB |
|
|
15.8 MB |
|
|
13.5 MB |
|
|
13.1 MB |
|
|
180.3 KB |
|
/Pance Party - Maru (NOIZE019) [EP] (2010)/ |
|
|
|
13.6 MB |
|
|
11.9 MB |
|
|
11.2 MB |
|
|
8.6 MB |
|
|
284.0 KB |
|
/Pantha Du Prince - Lay In A Shimmer (RTRADDS591) [EP] (2010)/ |
|
|
|
21.5 MB |
|
01-pantha_du_prince-lay_in_a_shimmer_(original_mix)-bside.mp3 |
15.8 MB |
|
04-pantha_du_prince-lay_in_a_shimmer_(fata_morgana_version)-bside.mp3 |
13.8 MB |
|
|
12.9 MB |
|
|
582.4 KB |
|
|
6.3 KB |
|
/Panton - Someday EP (2010)/ |
|
|
|
16.6 MB |
|
|
14.1 MB |
|
|
13.4 MB |
|
|
11.9 MB |
|
|
227.9 KB |
|
/Passion Pit - Sleepyhead (Remixes) [EP] (2010)/ |
|
|
|
11.1 MB |
|
|
11.0 MB |
|
|
9.4 MB |
|
|
9.1 MB |
|
|
6.0 MB |
|
|
5.9 MB |
|
|
4.8 MB |
|
|
157.4 KB |
|
/Paul Ahi - With a Vengeance (SIM033) [EP] (2010)/ |
|
|
|
19.2 MB |
|
03 - paul ahi - with a vengeance (paul anthony and zxx remix).mp3 |
19.0 MB |
|
04 - paul ahi - with a vengeance (alex kidd (usa) remix).mp3 |
15.2 MB |
|
|
14.3 MB |
|
|
13.5 MB |
|
|
13.5 MB |
|
|
1.7 MB |
|
00 - paul ahi - with a vengeance - (sim033) - web - 2010 - hft.nfo |
2.6 KB |
|
|
1.5 KB |
|
|
0.1 KB |
|
/Paul Anthony & ZXX - The Album (DFDIGI041) [CD] (2010)/ |
|
|
|
18.9 MB |
|
|
17.1 MB |
|
|
16.9 MB |
|
|
16.5 MB |
|
|
15.3 MB |
|
|
13.2 MB |
|
/Paul Anthony, Dirty Politics & ZXX - Slipstream (SIM029) [EP] (2010)/ |
|
|
01 Paul Anthony, Dirty Politics & ZXX - Slipstream - Original Mix.mp3 |
14.3 MB |
|
|
13.4 MB |
|
|
40.1 KB |
|
/Paul Chambers - Yeah, Techno (PH10) [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
12.7 MB |
|
|
10.9 MB |
|
|
217.5 KB |
|
/Pendulum - Witchcraft [CDSingle] (2010)/ |
|
|
|
16.6 MB |
|
|
15.1 MB |
|
|
13.8 MB |
|
|
11.9 MB |
|
|
10.2 MB |
|
|
81.9 KB |
|
/Penguin Prison - Golden Train (WOS087D) [EP] (2010)/ |
|
|
|
20.7 MB |
|
|
17.4 MB |
|
02-penguin_prison-golden_train_(penguin_prison_club_mix).mp3 |
15.3 MB |
|
|
9.5 MB |
|
|
9.0 MB |
|
|
293.2 KB |
|
|
5.6 KB |
|
/Permanent Vacation - Zuckerhut Remixes [EP] (PERMVAC070-1) (2010)/ |
|
|
|
21.4 MB |
|
|
16.4 MB |
|
|
63.0 KB |
|
|
43.9 KB |
|
/Phonat - Cockroaches [EP] (2010)/ |
|
|
|
9.3 MB |
|
|
8.8 MB |
|
|
7.7 MB |
|
|
7.0 MB |
|
|
41.1 KB |
|
/Pink a Pad's - Pink is Back (CRUX027) [EP] (2010)/ |
|
|
|
15.0 MB |
|
|
13.8 MB |
|
|
13.4 MB |
|
|
12.8 MB |
|
|
10.8 MB |
|
|
10.2 MB |
|
|
51.1 KB |
|
/Pirupa - The Leader (SNATCH007) [EP] (2010)/ |
|
|
|
19.8 MB |
|
|
18.1 MB |
|
|
589.4 KB |
|
/Plan B - Prayin Remixes (2010)/ |
|
|
|
14.6 MB |
|
|
14.6 MB |
|
|
7.9 MB |
|
|
6.0 MB |
|
|
5.6 MB |
|
|
4.8 MB |
|
|
60.6 KB |
|
/Poni Hoax - We Are The Bankers [EP] (2010)/ |
|
|
|
14.1 MB |
|
|
14.1 MB |
|
|
13.8 MB |
|
|
12.0 MB |
|
|
9.0 MB |
|
|
198.3 KB |
|
/Pretty Lights - Spilling Over Every Side [EP] (2010)/ |
|
|
|
22.1 MB |
|
|
19.7 MB |
|
|
19.0 MB |
|
|
19.0 MB |
|
|
17.4 MB |
|
|
13.1 MB |
|
|
696.7 KB |
|
/Primary 1 - Never Know [EP] (2010)/ |
|
|
|
9.5 MB |
|
|
6.7 MB |
|
|
6.4 MB |
|
|
5.9 MB |
|
|
36.0 KB |
|
|
1.3 KB |
|
/Project Bassline - The Twelfth Step (CHEAP021) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
13.1 MB |
|
|
12.8 MB |
|
|
12.4 MB |
|
|
10.9 MB |
|
|
191.1 KB |
|
/Proxy - Decoy (TURBO042) 2007/ |
|
|
|
14.5 MB |
|
|
14.2 MB |
|
|
21.9 KB |
|
|
16.0 KB |
|
|
4.8 KB |
|
/Proxy - Vibrate EP (2010)/ |
|
|
|
15.1 MB |
|
|
12.9 MB |
|
|
12.9 MB |
|
|
12.3 MB |
|
|
11.1 MB |
|
|
6.4 MB |
|
|
220.3 KB |
|
|
0.7 KB |
|
|
0.3 KB |
|
|
0.3 KB |
|
/Quality Street (BUTTERZ002) [EP] (2010)/ |
|
|
|
12.9 MB |
|
|
10.3 MB |
|
|
9.1 MB |
|
|
7.7 MB |
|
|
242.8 KB |
|
|
1.2 KB |
|
/R1 Ryders - Full Throttle [EP] (2010)/ |
|
|
|
18.3 MB |
|
|
12.9 MB |
|
|
12.4 MB |
|
|
11.9 MB |
|
|
26.1 KB |
|
/Ramadanman - Fall Short Work Them (SWAMP006) [EP] (2010)/ |
|
|
|
16.9 MB |
|
|
16.1 MB |
|
|
43.8 KB |
|
/Ramadanman - Glut Tempest (HEK008) (2010)/ |
|
|
|
17.0 MB |
|
|
11.9 MB |
|
|
399.1 KB |
|
/Randy Twigg - Redone (MEOW161) [CD] (2010)/ |
|
|
|
15.6 MB |
|
|
14.6 MB |
|
|
13.4 MB |
|
|
10.5 MB |
|
07-randy_twigg-3_parrots_(kid606_megaboom_vip_remix)-def.mp3 |
10.1 MB |
|
|
9.9 MB |
|
|
9.6 MB |
|
|
9.3 MB |
|
|
9.0 MB |
|
/Randy Twigg - Undone (MEOW154) [CD] (2009)/ |
|
|
|
13.3 MB |
|
11-randy_twigg-photograph_(gd_luxxe_remix)_(bonus_track)-kouala.mp3 |
12.9 MB |
|
|
10.9 MB |
|
|
10.9 MB |
|
|
10.0 MB |
|
|
9.6 MB |
|
|
9.3 MB |
|
|
8.3 MB |
|
|
8.0 MB |
|
|
7.5 MB |
|
|
7.5 MB |
|
|
6.4 MB |
|
|
1.4 KB |
|
|
0.7 KB |
|
|
0.5 KB |
|
/Redinho - Bare Blips (NMBRS2) [EP] (2010)/ |
|
|
|
7.5 MB |
|
|
7.0 MB |
|
|
6.3 MB |
|
|
6.1 MB |
|
|
5.7 MB |
|
|
4.9 MB |
|
|
3.9 MB |
|
|
2.1 MB |
|
|
66.5 KB |
|
/Redlight - What You Talking About (MTAREC003) [EP] (2010)/ |
|
|
|
14.4 MB |
|
|
8.2 MB |
|
|
8.1 MB |
|
|
8.1 MB |
|
|
7.8 MB |
|
|
6.4 MB |
|
|
571.8 KB |
|
/Renaissance Man - Brainstorm (MTP032) [EP] (2010)/ |
|
|
|
19.9 MB |
|
|
19.4 MB |
|
|
18.0 MB |
|
|
17.5 MB |
|
|
14.3 MB |
|
|
13.9 MB |
|
|
179.4 KB |
|
/Renaissance Man- Babbadabba EP (2010)/ |
|
|
|
18.0 MB |
|
|
16.9 MB |
|
|
14.9 MB |
|
|
64.0 KB |
|
/Reset - If We Try (The Love Anthem) (BEW002) [EP] (2010)/ |
|
|
|
14.6 MB |
|
02-reset-if_we_try_(the_love_anthem)_(atomic_hooligan_remix).mp3 |
10.7 MB |
|
|
38.7 KB |
|
|
8.3 KB |
|
/Reset! - My Trunk (CHEAP022) [EP] (2010)/ |
|
|
|
16.2 MB |
|
|
13.2 MB |
|
|
13.2 MB |
|
|
12.4 MB |
|
|
555.5 KB |
|
/Richard Vission & Trash Yourself - Get Down (SOLGV14) [EP] (2010)/ |
|
|
Richard Vission & Trash Yourself - Get down (Nino Anthony late night creepin mix).mp3 |
17.1 MB |
|
Richard Vission & Trash Yourself - Get down (Lucky Date remix).mp3 |
14.6 MB |
|
Richard Vission & Trash Yourself - Get down (Beatpunks remix).mp3 |
12.8 MB |
|
Richard Vission & Trash Yourself - Get down (original mix).mp3 |
12.4 MB |
|
Richard Vission & Trash Yourself - Get down (Jesse Jamz remix).mp3 |
11.0 MB |
|
|
133.5 KB |
|
/Rifoki - Sperm Donor EP (2010)/ |
|
|
|
2.8 MB |
|
|
2.7 MB |
|
|
2.4 MB |
|
|
2.0 MB |
|
|
549.5 KB |
|
|
22.7 KB |
|
/Riva Starr feat. Rettore - Splendido (Snatch! 003) (2010)/ |
|
|
|
17.4 MB |
|
|
15.9 MB |
|
|
83.8 KB |
|
/Riva Starr pres. Star Traxx - More (SNATCH009) [EP] (2010)/ |
|
|
|
18.9 MB |
|
03-star_traxx_and_riva_starr-more__pirupa_and_pigi_remix.mp3 |
18.6 MB |
|
|
17.2 MB |
|
|
16.7 MB |
|
|
15.0 MB |
|
|
707.1 KB |
|
00-star_traxx_and_riva_starr-snatch009-(snatch009)-web-2010.nfo |
0.6 KB |
|
/Robortom feat Au Revoir Simone - Paganini Rocks [EP] (2010)/ |
|
|
|
20.3 MB |
|
|
15.5 MB |
|
|
13.7 MB |
|
|
7.2 MB |
|
|
6.4 MB |
|
|
145.4 KB |
|
/Robyn - Indestructible (KOR028BP) [Remixes EP] (2010)/ |
|
|
|
17.2 MB |
|
|
14.7 MB |
|
|
13.3 MB |
|
|
116.9 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Roman Pushkin - Together (MDR25) [EP] (2010)/ |
|
|
|
17.2 MB |
|
|
13.9 MB |
|
|
12.1 KB |
|
/Round Table Knights - Cut To The Top (MTP031) (2010)/ |
|
|
01 - Cut_To_The_Top_Feat__Reverend_Beat_Man_Original_Mix.mp3 |
17.1 MB |
|
|
16.0 MB |
|
|
66.7 KB |
|
/Ruede Hagelstein-Re.You - Emergency-This Way (SOUVENIR028) [EP] (2010)/ |
|
|
|
19.2 MB |
|
|
17.6 MB |
|
|
17.2 MB |
|
|
16.3 MB |
|
|
15.3 MB |
|
|
347.1 KB |
|
|
340.8 KB |
|
/Rustie - Sunburst [EP] (2010)/ |
|
|
|
8.3 MB |
|
|
7.8 MB |
|
|
7.4 MB |
|
|
6.5 MB |
|
|
6.3 MB |
|
|
5.7 MB |
|
|
145.3 KB |
|
/Rye Rye feat. M.I.A. - Sunshine Remixes [EP] (2010)/ |
|
|
|
17.6 MB |
|
|
9.7 MB |
|
|
8.3 MB |
|
|
7.9 MB |
|
|
7.0 MB |
|
|
161.3 KB |
|
/S U R V I V E - S U R V I V E [EP] (2010)/ |
|
|
|
8.3 MB |
|
|
8.1 MB |
|
|
6.8 MB |
|
|
6.3 MB |
|
|
941.7 KB |
|
/Samo Sound Boy - Taking It All (POS021) [EP] (2010)/ |
|
|
|
11.3 MB |
|
|
10.8 MB |
|
|
10.7 MB |
|
|
10.6 MB |
|
|
10.6 MB |
|
|
10.2 MB |
|
|
575.0 KB |
|
/Sampha and SBTRKT - Break Off/ |
|
|
|
11.7 MB |
|
|
11.7 MB |
|
|
10.2 MB |
|
|
508.3 KB |
|
/Sandro Silva & Anjiro Rijo - Fifty What & Vallina Candy (OMG119) [EP] (2010)/ |
|
|
|
18.2 MB |
|
01-sandro_silva_and_anjiro_rijo-fifty_what_(dem_slackers_remix).mp3 |
13.8 MB |
|
02-sandro_silva_and_anjiro_rijo-fifty_what_(original_mix).mp3 |
11.8 MB |
|
|
362.3 KB |
|
02-sandro_silva_and_anjiro_rijo-fifty_what_(original_mix).m3i |
44.2 KB |
|
/Sandro Silva - Graffiti & Hero (SNEAK172) [EP] (2010)/ |
|
|
|
17.4 MB |
|
|
16.8 MB |
|
|
574.5 KB |
|
/Sandro Silva - Hands High (ECB221D) [EP] (2010)/ |
|
|
|
14.4 MB |
|
|
13.8 MB |
|
|
13.2 MB |
|
|
12.0 MB |
|
|
226.7 KB |
|
/Sandro Silva - Yearbook (CON029) [EP] (2010)/ |
|
|
|
18.5 MB |
|
|
16.1 MB |
|
|
15.0 MB |
|
|
70.4 KB |
|
|
16.2 KB |
|
/Sawgood - Sawsage (PLASMADIGI080) [EP] (2010)/ |
|
|
|
14.8 MB |
|
|
13.1 MB |
|
|
12.9 MB |
|
|
192.4 KB |
|
/SBTRKT – Step In Shadows [EP] (2010)/ |
|
|
|
12.9 MB |
|
|
11.5 MB |
|
|
10.4 MB |
|
|
9.7 MB |
|
|
124.2 KB |
|
/Scanners - We Never Close Our Eyes (DM178) [Remixes EP] (2010)/ |
|
|
|
12.4 MB |
|
|
9.2 MB |
|
|
8.8 MB |
|
|
8.7 MB |
|
|
8.5 MB |
|
|
8.5 MB |
|
|
8.2 MB |
|
|
402.4 KB |
|
/Schlachthofbronx - Ayoba Remixes [Remixes EP] (2010)/ |
|
|
Schlachthofbronx_-_Vem_Que_Tem_(feat_Marina_-_Daniel_Haaksman_remix).mp3 |
13.4 MB |
|
Schlachthofbronx_-_Vem_Que_Tem_(Daniel_Haaksman_remix_instrumental).mp3 |
13.4 MB |
|
Schlachthofbronx_-_Ayoba_(feat_Spoek_&_Gnucci_Banana_-_Ku_Bo_remix).mp3 |
11.4 MB |
|
Schlachthofbronx_-_Vem_Que_Tem_(feat_Marina_-_Kush_version).mp3 |
10.7 MB |
|
Schlachthofbronx_-_Ayoba_(feat_Spoek_&_Gnucci_Banana_-_Top_Billin_remix).mp3 |
10.5 MB |
|
Schlachthofbronx_-_Ayoba_(feat_Spoek_&_Gnucci_Banana_-_Phon_O_remix).mp3 |
10.5 MB |
|
Schlachthofbronx_-_Ayoba_(Top_Billin_remix_instrumental).mp3 |
10.5 MB |
|
Schlachthofbronx_-_Vem_Que_Tem_(feat_Marina_-_Beware_+_Motorpitch_remix).mp3 |
9.7 MB |
|
|
9.1 MB |
|
|
200.7 KB |
|
/Schlachthofbronx - Ayoba [EP] (2010)/ |
|
|
|
13.0 MB |
|
|
9.3 MB |
|
|
8.9 MB |
|
|
8.8 MB |
|
|
8.2 MB |
|
|
73.5 KB |
|
/Scion A_V Presents - Sound Pellegrino - Straight From The Spring (2010)/ |
|
|
|
18.8 MB |
|
|
17.5 MB |
|
|
16.8 MB |
|
|
14.4 MB |
|
|
13.8 MB |
|
|
13.6 MB |
|
|
10.7 MB |
|
|
8.3 MB |
|
|
350.7 KB |
|
/Scissor Sisters - Invisible Light (BNR049) [EP] (2010)/ |
|
|
scissor-sisters-invisible-light-stuart-price-us-12inch-mix.mp3 |
17.8 MB |
|
|
17.8 MB |
|
|
10.9 MB |
|
|
61.9 KB |
|
/Screendeath - Packback (ECB256D) [EP] (2010)/ |
|
|
|
16.0 MB |
|
|
13.9 MB |
|
|
13.9 MB |
|
|
13.4 MB |
|
|
229.6 KB |
|
|
0.9 KB |
|
/Sei A - White Rainbow (TURBOCD029) [EP] (2010)/ |
|
|
|
15.5 MB |
|
|
14.2 MB |
|
|
13.7 MB |
|
|
13.0 MB |
|
|
10.3 MB |
|
|
9.6 MB |
|
|
9.6 MB |
|
|
8.7 MB |
|
|
8.7 MB |
|
|
2.9 MB |
|
|
2.8 MB |
|
/Sei A ÔÇô White Rainbow Remixes Pt. 1 (TURBO097A) [EP] (2010)/ |
|
|
|
19.6 MB |
|
sei-a-white-rainbow-remixes-pt1-02-who-dares-wins-adam-marshall-stripped-dub.mp3 |
18.2 MB |
|
sei-a-white-rainbow-remixes-pt1-03-body-of-eyes-gesaffelstein-violation-remix.mp3 |
16.2 MB |
|
sei-a-white-rainbow-remixes-pt1-04-little-one-song-wraetlic-remix.mp3 |
14.8 MB |
|
|
169.5 KB |
|
|
0.1 KB |
|
/Sekta Feat. Spoek Mathambo - Peterpan (TBMP3008) [Remixed EP] (2010)/ |
|
|
05-sekta_feat_spoek_mathambo_-_peterpan_(darling_farah_remix)-zzzz.mp3 |
21.0 MB |
|
01-sekta_feat_spoek_mathambo_-_peterpan_(julio_bashmore_remix)-zzzz.mp3 |
14.7 MB |
|
02-sekta_feat_spoek_mathambo_-_peterpan_(julio_bashmore_dub)-zzzz.mp3 |
14.6 MB |
|
07-sekta_feat_spoek_mathambo_-_peterpan_(sharkslayer_nassau_vip)-zzzz.mp3 |
11.9 MB |
|
03-sekta_feat_spoek_mathambo_-_peterpan_(doc_daneeka_remix)-zzzz.mp3 |
11.4 MB |
|
04-sekta_feat_spoek_mathambo_-_peterpan_(doc_daneeka_dub)-zzzz.mp3 |
11.4 MB |
|
06-sekta_feat_spoek_mathambo_-_peterpan_(dubbel_dutch_remix)-zzzz.mp3 |
10.0 MB |
|
|
409.7 KB |
|
00-sekta_feat_spoek_mathambo_-_peterpan_remixed-web-2010-zzzz.nfo |
8.5 KB |
|
/Shadow Dancer - Boss Rush, It's The Everything (BNRTRAX002) [EP] (2010)/ |
|
|
|
13.8 MB |
|
|
10.8 MB |
|
|
42.1 KB |
|
/Sharkslayer - Swamp Dubs Vol. 1 (TBMP3420) [EP] (2010)/ |
|
|
|
12.5 MB |
|
|
10.9 MB |
|
|
9.5 MB |
|
|
9.3 MB |
|
|
151.8 KB |
|
/Shaved Monkeys - Get Rough (CRUX031) [EP] (2010)/ |
|
|
|
13.8 MB |
|
|
12.3 MB |
|
|
10.6 MB |
|
|
10.2 MB |
|
|
10.2 MB |
|
|
51.1 KB |
|
|
47.3 KB |
|
|
39.0 KB |
|
/Shax - I Get Dirty (CRUX033) [EP] (2010)/ |
|
|
|
14.8 MB |
|
|
14.2 MB |
|
|
12.0 MB |
|
|
11.4 MB |
|
|
10.8 MB |
|
|
77.7 KB |
|
|
10.9 KB |
|
/Shinichi Osawa & Paul Chambers - Singapore Swing (ECB248DX) [EP] (2010)/ |
|
|
|
17.6 MB |
|
|
14.8 MB |
|
|
11.6 MB |
|
|
437.4 KB |
|
/Shinichi Osawa & Supabeatz - Cyclone (LDK002) [EP] (2010)/ |
|
|
|
13.0 MB |
|
|
12.4 MB |
|
|
223.1 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Shinichi Osawa - Zingaro (ECB264D) [EP] (2010)/ |
|
|
|
14.4 MB |
|
|
14.1 MB |
|
|
12.9 MB |
|
|
11.2 MB |
|
|
231.7 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Shit Robot - From The Cradle To The Rave (2010)/ |
|
|
|
20.6 MB |
|
|
19.4 MB |
|
06. Simple Things (Work It Out) (feat. Ian Svenonious) [Album Edit].mp3 |
18.8 MB |
|
|
17.9 MB |
|
|
16.8 MB |
|
|
16.8 MB |
|
|
12.8 MB |
|
|
11.6 MB |
|
|
10.5 MB |
|
|
94.5 KB |
|
/Shit Robot - Tuff Enuff [Single] (2010)/ |
|
|
|
22.7 MB |
|
|
15.3 MB |
|
|
199.9 KB |
|
/Shit Robot - Tuff Enuff [Single] (DFA335704) (2010)/ |
|
|
|
22.5 MB |
|
|
15.1 MB |
|
|
232.8 KB |
|
/Shout Out Out Out Out - In the End It's Your Friends [EP] (2010)/ |
|
|
02-shout_out_out_out_out-it_the_end_its_your_friends_(mugwumo_remix)-1real.mp3 |
17.9 MB |
|
01-shout_out_out_out_out-in_the_end_its_your_friends-1real.mp3 |
13.2 MB |
|
03-shout_out_out_out_out-guilt_trips_sink_ships_(headman_remix)-1real.mp3 |
11.4 MB |
|
04-shout_out_out_out_out-guilt_trips_sink_ships_((headman_instr_remix)-1real.mp3 |
11.4 MB |
|
|
58.9 KB |
|
/Sidney Samson - Punkass (SAMSO145) [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
13.2 MB |
|
|
12.1 MB |
|
|
235.8 KB |
|
/Simian Mobile Disco - Casu Marzu - 1000 Year Egg [EP] (2010)/ |
|
|
|
19.9 MB |
|
|
19.9 MB |
|
|
45.0 KB |
|
/Siriusmo - The Plasterer Of Love (MONKEYTOWN03) (2010)/ |
|
|
|
11.0 MB |
|
|
9.7 MB |
|
|
7.8 MB |
|
|
7.1 MB |
|
|
4.8 MB |
|
|
128.0 KB |
|
/Skint Pres. Remixers (BRASSIC071D) [Compilation] (2010)/ |
|
|
3-Fatboy_Slim-Song_For_Shelter-Chemical_Brothers_Remix-www-djtunes-com.mp3 |
17.0 MB |
|
|
16.5 MB |
|
|
15.0 MB |
|
6-Fatboy_Slim-Right_Here_Right_Now-Freemasons_Remix-www-djtunes-com.mp3 |
14.1 MB |
|
11-Space_Raiders-Disko_Doktor-Groove_Armada_Remix-www-djtunes-com.mp3 |
13.4 MB |
|
|
13.2 MB |
|
5-Midfield_General-Coatnoise-Dave_Clarke_Remix-www-djtunes-com.mp3 |
13.1 MB |
|
9-Kidda-Under_The_Sun-Herves_Aint_No_Sunshine_Mix-www-djtunes-com.mp3 |
12.8 MB |
|
2-Vicarious_Bliss-Theme_From_Vicarious_Bliss-Justice_Mix-www-djtunes-com.mp3 |
11.9 MB |
|
13-Midfield_General-Disco_Sirens-Boy_8_Bit_Vocal_Remix-www-djtunes-com.mp3 |
11.3 MB |
|
|
10.8 MB |
|
12-Goose-Black_Gloves-The_Bloody_Beetroots_Remix-www-djtunes-com.mp3 |
9.5 MB |
|
|
90.3 KB |
|
/Skipteque - All That Glitters (#4) [EP] (2010)/ |
|
|
|
12.2 MB |
|
|
12.2 MB |
|
|
11.7 MB |
|
|
11.2 MB |
|
|
9.5 MB |
|
|
9.1 MB |
|
|
59.3 KB |
|
/Skrillex - My Name Is Skrillex [EP] (2010)/ |
|
|
|
15.3 MB |
|
|
13.5 MB |
|
|
11.4 MB |
|
|
10.9 MB |
|
|
9.2 MB |
|
|
8.3 MB |
|
|
481.5 KB |
|
/Skrillex feat. Sirah - Weekends!!! [EP] (2010)/ |
|
|
|
13.1 MB |
|
|
11.5 MB |
|
|
151.3 KB |
|
/Slackk - Theme (NMBRS7D) [EP] (2010)/ |
|
|
|
13.5 MB |
|
|
13.0 MB |
|
|
13.0 MB |
|
|
88.6 KB |
|
|
12.4 KB |
|
/Slap In The Bass & Eats Everything - Wearhouse Music Pres. Fresh Attire Vol.5 (WFA 005 ) [EP] (2010)/ |
|
|
|
19.3 MB |
|
|
19.2 MB |
|
|
12.3 MB |
|
|
11.9 MB |
|
02 - Slap In The Bass - Surko (Boemklatsch & Dem Slackers remix).mp3 |
11.8 MB |
|
|
9.6 MB |
|
|
9.4 MB |
|
|
89.8 KB |
|
/Sneakerz Muzik Pres. - One Love (SNEAK169) [EP] (2010)/ |
|
|
andy-murphy-music-master-tommie-sunshines-new-york-music-master-remix.mp3 |
18.8 MB |
|
|
16.3 MB |
|
|
15.7 MB |
|
|
14.9 MB |
|
|
14.3 MB |
|
|
14.1 MB |
|
|
13.9 MB |
|
|
13.7 MB |
|
|
260.8 KB |
|
/Social Disco Club - Daft Funk (HOTGOLDII) [EP] (2010)/ |
|
|
|
17.3 MB |
|
|
17.1 MB |
|
|
78.0 KB |
|
/Soda 'n' Suds - Heavy [Single] (2010)/ |
|
|
|
13.5 MB |
|
|
305.8 KB |
|
/Solar Bears - Inner Sunshine [EP] (ZIQ269) (2010)/ |
|
|
|
12.4 MB |
|
|
11.1 MB |
|
|
10.8 MB |
|
|
9.4 MB |
|
|
7.8 MB |
|
|
4.5 MB |
|
|
617.0 KB |
|
/Solo - We Are The Midgets (DFEP03) [EP] (2010)/ |
|
|
|
15.3 MB |
|
|
14.5 MB |
|
|
13.8 MB |
|
|
72.4 KB |
|
/Sound Of Stereo - Helium (LL36D) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
14.4 MB |
|
|
13.6 MB |
|
|
13.2 MB |
|
|
8.0 MB |
|
|
31.2 KB |
|
/Sound Of Stereo - Zipper (Remix's) EP/ |
|
|
|
12.8 MB |
|
|
12.7 MB |
|
|
11.7 MB |
|
|
84.8 KB |
|
00_sound_of_stereo_-_zipper_ep_(remixes)-(ll22dr)-web-2010.nfo |
0.8 KB |
|
/Sound Pellegrino - One To Ten (Plus Two) [Compilation] (2010)/ |
|
|
|
18.3 MB |
|
|
16.5 MB |
|
|
15.8 MB |
|
|
15.6 MB |
|
12 Para One - Toadstool (Jesse Rosse Made to Play Dub Mix).mp3 |
15.2 MB |
|
|
14.8 MB |
|
|
14.4 MB |
|
|
14.3 MB |
|
|
14.2 MB |
|
|
13.4 MB |
|
|
12.2 MB |
|
|
11.9 MB |
|
|
10.2 MB |
|
|
8.0 MB |
|
|
123.9 KB |
|
/Sovnger - Breathless [EP] (2010)/ |
|
|
|
15.6 MB |
|
|
13.1 MB |
|
|
11.4 MB |
|
|
10.6 MB |
|
|
10.1 MB |
|
|
424.3 KB |
|
/Speaker Junk - We Can Be (CHEAP024) [EP] (2010)/ |
|
|
|
15.6 MB |
|
|
10.5 MB |
|
|
10.4 MB |
|
|
8.7 MB |
|
/Squarepusher - Shobaleader One [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
9.7 MB |
|
|
121.8 KB |
|
/Starfucker - B-Sides (BRCD924) [EP] (2010)/ |
|
|
|
13.0 MB |
|
|
11.9 MB |
|
|
9.6 MB |
|
|
9.4 MB |
|
|
8.9 MB |
|
|
156.8 KB |
|
|
7.6 KB |
|
/Starkey - Space Traitor Volume 1 (CIV015) [EP] (2010)/ |
|
|
|
12.6 MB |
|
|
11.8 MB |
|
|
11.2 MB |
|
|
10.3 MB |
|
|
10.0 MB |
|
|
9.7 MB |
|
|
9.4 MB |
|
|
9.4 MB |
|
|
9.2 MB |
|
|
9.1 MB |
|
|
8.8 MB |
|
12-starkey-starkbot_beats_space_traitor_volume_1_(narration_by_halfcast).mp3 |
7.3 MB |
|
|
438.9 KB |
|
|
1.2 KB |
|
IndieBubbles.com - All Indie & Electro For Free Download.url |
0.1 KB |
|
/Steve Starks - Get 'Em (TA016) [EP] (2010)/ |
|
|
|
15.5 MB |
|
|
13.5 MB |
|
|
11.2 MB |
|
|
10.7 MB |
|
|
10.4 MB |
|
|
8.1 MB |
|
|
94.7 KB |
|
/Style Of Eye & Slagsmålsklubben - Homeless [EP] (2010)/ |
|
|
|
16.7 MB |
|
|
13.0 MB |
|
|
13.0 MB |
|
|
9.5 MB |
|
|
62.7 KB |
|
/Sunday Girl - Four Floors Remixes (2010)/ |
|
|
|
13.7 MB |
|
|
10.6 MB |
|
|
10.4 MB |
|
|
8.6 MB |
|
|
34.4 KB |
|
/Sunnybeach Happyslap Mardigras - Conta & Mamacita (DM01) [EP] (2010)/ |
|
|
|
16.3 MB |
|
|
15.4 MB |
|
|
13.7 MB |
|
|
12.8 MB |
|
|
12.2 MB |
|
|
407.0 KB |
|
/Supabeatz & Landmark - Rhumbla Wohoo [Remixes EP] (2010)/ |
|
|
02-supabeatz_and_landmark-rhumbla_wohoo_(jay_robinson_remix)-fmc.mp3 |
11.6 MB |
|
01-supabeatz_and_landmark-rhumbla_wohoo_(keith_remix)-fmc.mp3 |
11.2 MB |
|
|
229.6 KB |
|
/Surkin - Silver Island EP/ |
|
|
|
10.4 MB |
|
|
9.6 MB |
|
|
8.8 MB |
|
|
533.0 KB |
|
/Swanky Tunes - Across The Light (MIXMA029) [EP] (2010)/ |
|
|
|
20.8 MB |
|
|
20.7 MB |
|
|
16.1 MB |
|
|
1.2 MB |
|
|
57.1 KB |
|
/Swen Weber - Time for Samba EP/ |
|
|
|
16.7 MB |
|
|
15.8 MB |
|
|
15.2 MB |
|
|
15.2 MB |
|
|
14.7 MB |
|
|
242.7 KB |
|
00_swen_weber_-_time_for_samba-ep-(ecb214dx)-web-2010-aph.nfo |
5.7 KB |
|
00_swen_weber_-_time_for_samba-ep-(ecb214dx)-web-2010-aph.sfv |
0.2 KB |
|
00_swen_weber_-_time_for_samba-ep-(ecb214dx)-web-2010-aph.m3u |
0.2 KB |
|
/T. Williams - Getting Mine (ENDG012) [EP] (2010)/ |
|
|
|
14.2 MB |
|
|
11.9 MB |
|
|
240.3 KB |
|
/T.Williams Feat. Terri Walker - Heartbeat (LOC003) [EP] (2010)/ |
|
|
|
19.9 MB |
|
|
13.2 MB |
|
|
12.5 MB |
|
|
12.4 MB |
|
|
440.0 KB |
|
/TAI - Power Chords (CCM051) [EP] (2010)/ |
|
|
|
15.4 MB |
|
|
14.8 MB |
|
|
13.3 MB |
|
|
12.1 MB |
|
|
11.5 MB |
|
|
53.2 KB |
|
/Talk - Holy Mountain (NS019) [EP] (2010)/ |
|
|
|
17.6 MB |
|
|
17.2 MB |
|
|
15.7 MB |
|
|
13.4 MB |
|
|
13.0 MB |
|
|
12.5 MB |
|
|
11.6 MB |
|
|
9.9 MB |
|
|
288.0 KB |
|
/Tambour Battant - On The Ground EP/ |
|
|
|
8.6 MB |
|
|
8.6 MB |
|
00-tambour_battant-on_the_ground_ep-(expr404)-web-2010-def.jpg |
1.5 MB |
|
/Tame Impala - Solitude Is Bliss EP (2010)/ |
|
|
Tame Impala – Solitude is Bliss (Midnight Juggernauts Remix) .mp3 |
10.1 MB |
|
|
9.4 MB |
|
Tame Impala - Solitude Is Bliss (Mickey Moonlight Remix).mp3 |
9.3 MB |
|
|
6.5 MB |
|
|
85.0 KB |
|
/Tapesh & Maximiljan - Wide Range (SNATCH006) [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
15.4 MB |
|
|
291.3 KB |
|
00-tapesh_and_maximiljan-wide_range_ep-(snatch006)-web-2010.nfo |
10.2 KB |
|
/Taras 3000 - Galaxis (SRV-03) [EP] (2010)/ |
|
|
|
16.8 MB |
|
|
15.6 MB |
|
|
15.2 MB |
|
|
162.4 KB |
|
/Tavrvs - Extendet Play (MOZZ024D) [EP] (2010)/ |
|
|
|
13.0 MB |
|
|
12.5 MB |
|
|
10.2 MB |
|
|
10.0 MB |
|
|
87.4 KB |
|
/Taz - Gold Tooth Grin (NMBRS3D) [EP] (2010)/ |
|
|
|
10.4 MB |
|
|
10.4 MB |
|
|
10.0 MB |
|
|
104.7 KB |
|
/Teenage Bad Girl - Tonton Funk (2010)/ |
|
|
|
13.0 MB |
|
|
12.6 MB |
|
|
9.6 MB |
|
|
9.0 MB |
|
|
491.1 KB |
|
/Tempa Allstars Vol.6 [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
15.1 MB |
|
|
12.4 MB |
|
|
12.2 MB |
|
|
10.5 MB |
|
|
6.6 MB |
|
|
124.4 KB |
|
/Tensnake - Coma Cat (DFTD271D2) [Remixes EP] (2010)/ |
|
|
|
16.7 MB |
|
|
16.0 MB |
|
|
15.8 MB |
|
|
7.1 MB |
|
|
72.0 KB |
|
|
0.4 KB |
|
/Terence Fixmer - Epsilon [EP] (TURBO092) (2010)/ |
|
|
|
17.7 MB |
|
|
17.0 MB |
|
|
15.1 MB |
|
|
14.2 MB |
|
|
156.6 KB |
|
/Terror Danjah & DOK - Bruzin & Hysteria (HDB037) [EP] (2010)/ |
|
|
|
9.9 MB |
|
|
7.3 MB |
|
|
367.5 KB |
|
/Terror Danjah - Bipolar (BUTTERZ001) [EP] (2010)/ |
|
|
|
14.8 MB |
|
|
9.4 MB |
|
|
7.7 MB |
|
|
97.9 KB |
|
|
1.4 KB |
|
/Terror Danjah - Reinforced (RWINA009) [EP] (2010)/ |
|
|
|
15.9 MB |
|
|
9.5 MB |
|
|
9.0 MB |
|
|
376.7 KB |
|
/Tesla Boy - Thinking Of You [EP] (2010)/ |
|
|
|
17.3 MB |
|
|
14.4 MB |
|
02- Tesla Boy - Thinking Of You (Casio Social Club Remix).mp3 |
13.3 MB |
|
|
10.8 MB |
|
|
20.3 KB |
|
/The 2 Bears - Follow The Bears (ECB211) [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
14.4 MB |
|
|
13.1 MB |
|
|
11.2 MB |
|
|
831.3 KB |
|
/The Aikiu - Just Can't Sleep [EP] (2010)/ |
|
|
|
18.6 MB |
|
|
16.7 MB |
|
|
16.4 MB |
|
|
14.0 MB |
|
|
13.0 MB |
|
|
10.4 MB |
|
|
46.7 KB |
|
/The Aston Shuffle - I Wanna See You EP (2010)/ |
|
|
|
12.1 MB |
|
|
9.9 MB |
|
|
4.5 MB |
|
|
4.1 MB |
|
|
37.3 KB |
|
/The Bloody Beetroots & Steve Aoki Feat. Refused - New Noise (DM176) [EP] (2010)/ |
|
|
|
8.4 MB |
|
|
5.8 MB |
|
|
90.9 KB |
|
/The Boomzers - WTF! (CRUX036) [EP] (2010)/ |
|
|
|
11.5 MB |
|
|
11.1 MB |
|
|
10.0 MB |
|
|
8.6 MB |
|
|
77.7 KB |
|
/The Bug - Infected (ZENDNLS273) [EP] (2010)/ |
|
|
|
12.6 MB |
|
|
12.6 MB |
|
|
12.4 MB |
|
|
9.0 MB |
|
|
164.8 KB |
|
/The C90's - Shine A Light (RR045) [EP] (2010)/ |
|
|
|
17.7 MB |
|
|
17.6 MB |
|
|
14.1 MB |
|
|
14.0 MB |
|
|
13.7 MB |
|
|
88.8 KB |
|
/The Cheerz - Whooz Da Baddest [EP] (2010)/ |
|
|
|
16.1 MB |
|
02 - The Cheerz - Whooz Da Baddest (Sedat The Turkish Avenger Remix).mp3 |
15.0 MB |
|
|
14.2 MB |
|
|
14.0 MB |
|
11 - The Cheerz - Whooz Da Baddest (Jay Robinson Remix) - Digital Only.mp3 |
13.8 MB |
|
10 - The Cheerz - Whooz Da Baddest (Yolanda Be Cool Remix) - Digital Only.mp3 |
13.0 MB |
|
|
12.5 MB |
|
13 - The Cheerz - Whooz Da Baddest (Mendel Remix) - Digital Only.mp3 |
12.1 MB |
|
12 - The Cheerz - Whooz Da Baddest (TV On Mars Remix) - Digital Only.mp3 |
11.7 MB |
|
|
11.6 MB |
|
|
10.7 MB |
|
|
7.9 MB |
|
|
6.3 MB |
|
|
1.1 MB |
|
|
931.5 KB |
|
|
59.1 KB |
|
/The Chemical Brothers - Another World [EP] (2010)/ |
|
|
03-the_chemical_brothers_-_swoon_(lindstroem_prins_thomas_remix)-l2m.mp3 |
22.7 MB |
|
04-the_chemical_brothers_-_horse_power_(popof_remix)-l2m.mp3 |
15.8 MB |
|
02-the_chemical_brothers_-_swoon_(boyz_noize_summer_remix)-l2m.mp3 |
12.9 MB |
|
01-the_chemical_brothers_-_another_world_(radio_edit)-l2m.mp3 |
7.1 MB |
|
|
60.0 KB |
|
/The Chemical Brothers - Dissolve (Bloody Beetroots Remix) [Single] (2010)/ |
|
|
01- The Chemical Brothers - Dissolve (Bloody Beetroots Remix).mp3 |
8.1 MB |
|
|
87.1 KB |
|
/The Count & Sinden Feat. Mystery Jets - After Dark [EP] (2010)/ |
|
|
|
14.6 MB |
|
|
12.4 MB |
|
|
12.1 MB |
|
|
11.2 MB |
|
|
8.8 MB |
|
|
428.6 KB |
|
/The Count & Sinden ft. Bashy - Addicted to You [EP] (2010)/ |
|
|
|
9.9 MB |
|
02- Addicted To You (The Count & Sinden 'Take It To The Club' Remix).mp3 |
8.7 MB |
|
|
8.3 MB |
|
03- Addicted To You (The Count & Sinden 'Take It To The Club' Dub).mp3 |
7.8 MB |
|
|
7.5 MB |
|
|
6.9 MB |
|
|
6.0 MB |
|
|
5.8 MB |
|
|
4.9 MB |
|
|
76.6 KB |
|
/The Crystal Ark - The Tangible Presence of the Miraculous [EP] (2010)/ |
|
|
|
33.1 MB |
|
02- The Tangible Presence of the Miraculous (Instrumental).mp3 |
33.1 MB |
|
|
45.7 KB |
|
/The Good Natured - Your Body Is A Machine (Remixes EP) (2010)/ |
|
|
03-the_good_natured-your_body_is_a_machine_(aspirins_for_my_children_remix).mp3 |
8.7 MB |
|
04-the_good_natured-your_body_is_a_machine_(radioproof_remix).mp3 |
7.8 MB |
|
02-the_good_natured-your_body_is_a_machine_(baby_monsters_remix).mp3 |
5.9 MB |
|
|
5.2 MB |
|
|
27.3 KB |
|
/The Japanese Popstars - Let Go [EP] (2010)/ |
|
|
|
15.2 MB |
|
|
15.2 MB |
|
|
13.2 MB |
|
|
13.0 MB |
|
|
12.0 MB |
|
|
24.4 KB |
|
/The Knife in collaboration with Mt Sims and Planningtorock - Seeds (BRILS45DJ) [EP] (2010)/ |
|
|
|
28.3 MB |
|
|
17.8 MB |
|
|
40.1 KB |
|
IndieBubbles.com - All Indie and Electro For Free Download.url |
0.1 KB |
|
/The Krays (feat. Ebony Bones) - We’re Ready When You Are [EP] (2010)/ |
|
|
03- We're Ready When You Are feat. Ebony Bones (Clashes Remix).mp3 |
13.6 MB |
|
02- We're Ready When You Are feat. Ebony Bones (DJ Mehdi Remix).mp3 |
12.2 MB |
|
01- We're Ready When You Are feat. Ebony Bones (Original Mix).mp3 |
10.0 MB |
|
|
270.1 KB |
|
/The Loops of Fury - Rack Em & Pump Up Remixes (UAA041) [Remixes EP] (2010)/ |
|
|
|
16.8 MB |
|
|
14.8 MB |
|
|
13.4 MB |
|
|
12.9 MB |
|
|
171.2 KB |
|
00-the_loops_of_fury-rack_em_-_pump_up_remixes-(uaa041)-2010.nfo |
8.4 KB |
|
/The Loops Of Fury - Rack Em (UAA039) [EP] (2010)/ |
|
|
|
17.3 MB |
|
|
16.9 MB |
|
|
8.8 KB |
|
|
7.2 KB |
|
/The Martin Brothers - Steal Drums (DB040) [EP] (2010)/ |
|
|
|
17.5 MB |
|
|
17.3 MB |
|
|
17.1 MB |
|
|
16.5 MB |
|
|
226.2 KB |
|
/The Mastertrons - Revenge Is Coming (MHTRSH04) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
12.1 MB |
|
|
12.0 MB |
|
|
11.7 MB |
|
|
11.5 MB |
|
|
11.5 MB |
|
|
11.5 MB |
|
|
10.9 MB |
|
|
9.8 MB |
|
|
119.2 KB |
|
/The Mould - Mad Soldier Take A Rifle (MAKO002D) [EP] (2010)/ |
|
|
|
18.2 MB |
|
|
14.8 MB |
|
|
12.8 MB |
|
|
12.1 MB |
|
|
62.0 KB |
|
/The Only - Top Of The Jam (2010)/ |
|
|
|
13.6 MB |
|
|
12.8 MB |
|
|
12.7 MB |
|
|
11.0 MB |
|
|
10.0 MB |
|
|
334.3 KB |
|
/The Outrunners - Running For Love And Money (FLEXX017) [EP] (2010)/ |
|
|
|
15.0 MB |
|
|
11.3 MB |
|
|
8.1 MB |
|
|
5.0 MB |
|
|
57.3 KB |
|
/The Outrunners - Running For Love And Money [EP] (2010)/ |
|
|
|
15.0 MB |
|
|
11.3 MB |
|
|
8.1 MB |
|
|
5.0 MB |
|
|
57.3 KB |
|
/The Paris Swing Box EP (November 19, 2010 Etage Noir)/ |
|
|
|
13.7 MB |
|
|
13.3 MB |
|
|
13.2 MB |
|
|
13.0 MB |
|
|
8.0 MB |
|
|
105.3 KB |
|
/The Phenomenal Handclap Band - Remixes [Remixes CD] (2010)/ |
|
|
|
20.1 MB |
|
|
16.1 MB |
|
|
15.6 MB |
|
|
14.7 MB |
|
|
12.3 MB |
|
|
12.0 MB |
|
|
11.7 MB |
|
|
11.1 MB |
|
|
11.0 MB |
|
|
10.6 MB |
|
12 The Journey To Serra Da Estrela (Fujiya & Miyagi Remix).mp3 |
10.2 MB |
|
|
7.7 MB |
|
|
81.6 KB |
|
/The Shoes - Stay The Same [EP] (2010)/ |
|
|
|
16.6 MB |
|
|
14.3 MB |
|
08- The Shoes - Stay The Same (Siriusmo & Jan Driver Dub).mp3 |
13.6 MB |
|
05- The Shoes - Stay The Same (Siriusmo & Jan Driver Remix).mp3 |
13.5 MB |
|
|
13.3 MB |
|
|
11.3 MB |
|
|
11.2 MB |
|
|
10.1 MB |
|
|
8.3 MB |
|
|
536.2 KB |
|
/The Sneekers - Aerobic (TELEROCK016) [EP] (2010)/ |
|
|
|
14.0 MB |
|
|
13.4 MB |
|
|
12.2 MB |
|
|
132.7 KB |
|
|
9.2 KB |
|
/The Subs & Les Petits Pilous - My Body & Rototom (LL40D) [EP] (2010)/ |
|
|
|
10.9 MB |
|
|
10.9 MB |
|
|
50.5 KB |
|
00-the_subs_and_les_petits_pilous-my_body__rototom-(ll40d)-web-2010.nfo |
0.5 KB |
|
/The Subs - Vomit In Style Remixes EP (2010)/ |
|
|
|
12.2 MB |
|
|
10.9 MB |
|
|
10.7 MB |
|
|
10.2 MB |
|
|
10.0 MB |
|
|
219.0 KB |
|
/The Temper Trap - Conditions Remixed [CD] (2010)/ |
|
|
|
17.0 MB |
|
|
16.9 MB |
|
|
13.6 MB |
|
|
13.5 MB |
|
|
12.8 MB |
|
|
12.3 MB |
|
|
10.5 MB |
|
|
9.3 MB |
|
|
9.0 MB |
|
|
8.7 MB |
|
|
16.3 KB |
|
/The Toxic Avenger - Toxic Is Dead [EP] (2009)/ |
|
|
|
12.7 MB |
|
|
12.6 MB |
|
|
12.5 MB |
|
|
12.4 MB |
|
|
10.8 MB |
|
|
10.7 MB |
|
|
205.4 KB |
|
/The Willowz - I Know (Remixes) (DM179) [EP] (2010)/ |
|
|
|
12.0 MB |
|
|
10.3 MB |
|
|
60.0 KB |
|
/Them Jeans - Balloons (TBMP3015) [EP] (2010)/ |
|
|
|
14.1 MB |
|
|
13.3 MB |
|
|
10.3 MB |
|
|
9.4 MB |
|
|
981.5 KB |
|
/Thomas Schumacher - Bandera (SNATCH005) [EP] (2010)/ |
|
|
|
25.4 MB |
|
|
19.3 MB |
|
|
14.8 MB |
|
|
267.0 KB |
|
/Tiga - Gentle Giant [Remixes EP] (2010)/ |
|
|
|
19.7 MB |
|
|
18.7 MB |
|
|
13.9 MB |
|
|
53.8 KB |
|
/Tim Deluxe - See Lye [EP] (2010)/ |
|
|
|
18.8 MB |
|
|
18.5 MB |
|
|
21.8 KB |
|
/Tinashe - Mayday [EP] (2010)/ |
|
|
|
7.3 MB |
|
02-tinashe-come_on_over_(this_could_be_love_with_kissy_sell_out).mp3 |
5.9 MB |
|
|
4.8 MB |
|
|
4.6 MB |
|
|
55.6 KB |
|
|
0.7 KB |
|
/Tinashe - Saved [Remixes EP] (2010)/ |
|
|
03-tinashe-saved_(totally_enormous_extinct_dinosaurs_remix_dub).mp3 |
8.6 MB |
|
02-tinashe-saved_(totally_enormous_extinct_dinosaurs_remix).mp3 |
8.5 MB |
|
|
8.4 MB |
|
|
7.2 MB |
|
|
6.8 MB |
|
|
5.8 MB |
|
|
25.2 KB |
|
/Tits & Clits - The Remixes/ |
|
|
|
13.9 MB |
|
|
13.8 MB |
|
|
13.4 MB |
|
|
13.2 MB |
|
|
13.2 MB |
|
|
12.8 MB |
|
|
12.1 MB |
|
|
11.8 MB |
|
|
11.6 MB |
|
11 Gold Dust (Flux Pavilion Remix) (Tits & Clits electro edit).mp3 |
11.2 MB |
|
|
9.0 MB |
|
|
8.5 MB |
|
|
8.5 MB |
|
/Toby Tobias - You Know [EP] (REKIDS048D) (2010)/ |
|
|
|
27.3 MB |
|
|
22.7 MB |
|
|
19.2 MB |
|
|
17.5 MB |
|
01- Toby Tobias feat. Marcus Marr - You Know Its Something.mp3 |
14.5 MB |
|
|
405.1 KB |
|
/Todd Edwards - Far Away (DS001) [EP] (2010)/ |
|
|
|
14.8 MB |
|
|
14.1 MB |
|
|
8.1 MB |
|
|
261.7 KB |
|
/Todd Edwards - I Might Be (2010)/ |
|
|
|
15.7 MB |
|
|
14.7 MB |
|
|
14.3 MB |
|
|
11.9 MB |
|
|
11.6 MB |
|
|
598.6 KB |
|
/Toddla T Feat. Wayne Marshall - Sky Surfing (ZENDNLS269X) [Remixes EP] (2010)/ |
|
|
|
11.7 MB |
|
|
11.6 MB |
|
|
10.0 MB |
|
|
8.4 MB |
|
|
754.4 KB |
|
/Tom Deluxx - Wasted (FMO1012) [EP] (2010)/ |
|
|
|
14.1 MB |
|
|
13.9 MB |
|
|
13.0 MB |
|
|
12.8 MB |
|
|
11.8 MB |
|
|
10.2 MB |
|
|
8.9 MB |
|
|
129.2 KB |
|
/Tom Flynn - Little Havana [EP] (2010)/ |
|
|
|
18.5 MB |
|
|
17.8 MB |
|
|
16.7 MB |
|
|
16.2 MB |
|
|
97.4 KB |
|
/Tom Flynn - Tom Flynn (DB042) [EP] (2010)/ |
|
|
|
15.9 MB |
|
|
14.8 MB |
|
|
326.2 KB |
|
|
0.7 KB |
|
/Tom Staar - Heavy Artillery (MODA006) [EP] (2010)/ |
|
|
|
14.4 MB |
|
|
13.1 MB |
|
|
13.1 MB |
|
|
240.2 KB |
|
/Tony Anthem & Axl Ender - Extinct (ROTD028) [EP] (2010)/ |
|
|
|
10.4 MB |
|
|
10.4 MB |
|
|
10.2 MB |
|
|
9.1 MB |
|
|
22.8 KB |
|
00-tony_anthem_&_axl_ender-extinct_ep-(rotd028)-web-2010.nfo |
0.7 KB |
|
/Tony Senghore - If You Came Here (HOHA012) [Remixes EP] (2010)/ |
|
|
|
16.7 MB |
|
|
15.6 MB |
|
|
15.4 MB |
|
|
15.0 MB |
|
|
12.1 MB |
|
|
11.7 MB |
|
|
380.8 KB |
|
/Totally Enormous Extinct Dinosaurs - All In Two Sixty Dancehalls [EP] (2010)/ |
|
|
|
12.6 MB |
|
|
11.5 MB |
|
|
11.0 MB |
|
02-totally_enormous_extinct_dinosaurs-blood_pressure_(feat_riko_-_dub)-vrt.mp3 |
10.0 MB |
|
|
377.8 KB |
|
/Totally Enormous Extinct Dinosaurs - Garden (Jesse Rose Remixes) (PID003) [EP] (2010)/ |
|
|
02-totally_enormous_extinct_dinosaurs-garden__jesse_rose_play_it_down_dub.mp3 |
21.2 MB |
|
01-totally_enormous_extinct_dinosaurs-garden__jesse_rose_remix.mp3 |
18.0 MB |
|
|
29.0 KB |
|
00-totally_enormous_extinct_dinosaurs-garden__jesse_rose_remixes-(pid003)-web-2010.nfo |
0.8 KB |
|
/Totally Enormous Extinct Dinosaurs - Household Goods (GREC015D) [EP] (2010)/ |
|
|
|
16.4 MB |
|
|
14.5 MB |
|
|
8.7 MB |
|
|
145.8 KB |
|
00-totally_enormous_extinct_dinosaurs-household_goods_ep-(grec015d)-web-2010.nfo |
0.5 KB |
|
/Treasure Fingers - Lift Me (DFTD279D) [EP] (2010)/ |
|
|
|
15.9 MB |
|
|
15.9 MB |
|
|
13.4 MB |
|
|
563.8 KB |
|
|
2.3 KB |
|
/Treasure Fingers feat. Haley Small - Keep Up (FGR036) [EP] (2010)/ |
|
|
|
19.7 MB |
|
|
14.1 MB |
|
|
11.3 MB |
|
|
9.8 MB |
|
|
9.7 MB |
|
|
8.7 MB |
|
|
8.6 MB |
|
|
110.9 KB |
|
/Trentemoeller - Silver Surfer And Ghost Rider Go!!! [EP] (2010)/ |
|
|
01- Trentemoeller - Silver Surfer, Ghost Rider Go (Trentemoeller Remix).mp3 |
17.0 MB |
|
03- Trentemoeller - Silver Surfer, Ghost Rider Go (Andrew Weatherall Prinz Mix).mp3 |
16.0 MB |
|
04- Trentemoeller - Silver Surfer, Ghost Rider Go (Lulu Rouge Feat. Abdullah S Remix).mp3 |
11.7 MB |
|
|
10.5 MB |
|
|
205.4 KB |
|
/Trentemoller - Even Though You're With Another Girl (IMR03BP) [EP] (2010)/ |
|
|
02_even_though_youre_with_another_girl_(pantha_du_prince_dub_version)-dd.mp3 |
21.5 MB |
|
01_even_though_youre_with_another_girl_(kollektiv_turmstrasse_remix)-dd.mp3 |
19.4 MB |
|
04_even_though_youre_with_another_girl_(alternative_instrumental_version)-dd.mp3 |
12.2 MB |
|
03_even_though_youre_with_another_girl_(original_mix)-dd.mp3 |
11.6 MB |
|
|
69.2 KB |
|
00_trentemoller_-_even_though_youre_with_another_girl-(imr03bp-web)-2010-dd.nfo |
7.5 KB |
|
/Tricky - Murder Weapon (RUG376D) [EP] (2010)/ |
|
|
|
7.1 MB |
|
|
5.4 MB |
|
|
475.7 KB |
|
/Tuccillo Feat. Patty Pravo - Bambola (The Remixes) (SNEAK187) [Remixes EP] (2010)/ |
|
|
01-tuccillo_ft._patty_pravo-bambola_(sickindividuals_remix).mp3 |
14.3 MB |
|
02-tuccillo_ft._patty_pravo-bambola_(sandro_silva_remix).mp3 |
13.5 MB |
|
|
59.1 KB |
|
00-tuccillo_ft._patty_pravo-bambola_(the_remixes)-(sneak187)-web-2010-hft.nfo |
2.2 KB |
|
/Turned On Vol.1 - Compiled by Neoteric (DBR004) [CD] (2010)/ |
|
|
|
16.9 MB |
|
|
15.2 MB |
|
|
15.1 MB |
|
|
14.6 MB |
|
|
13.6 MB |
|
|
13.5 MB |
|
|
13.4 MB |
|
|
12.2 MB |
|
|
12.2 MB |
|
|
11.8 MB |
|
|
11.3 MB |
|
|
11.1 MB |
|
|
11.1 MB |
|
|
11.0 MB |
|
|
10.9 MB |
|
/TWR72 - Tunnel & Schizophrenia (INST004) [EP] (2010)/ |
|
|
|
13.9 MB |
|
|
9.8 MB |
|
|
161.2 KB |
|
|
2.6 KB |
|
/Udachi - Swagger (POS020) [EP] (2010)/ |
|
|
|
13.5 MB |
|
|
12.3 MB |
|
|
12.1 MB |
|
|
11.2 MB |
|
|
11.0 MB |
|
|
10.4 MB |
|
|
10.4 MB |
|
|
962.8 KB |
|
/Uffie - Difficult (BEC5772746) [EP] (2010)/ |
|
|
|
15.2 MB |
|
|
9.8 MB |
|
|
7.6 MB |
|
|
28.3 KB |
|
|
0.5 KB |
|
/Underworld - Always Loved A Film (OM458) [EP] (2010)/ |
|
|
|
19.0 MB |
|
|
18.7 MB |
|
|
18.6 MB |
|
|
18.6 MB |
|
|
17.3 MB |
|
|
16.7 MB |
|
|
16.2 MB |
|
|
9.8 MB |
|
|
8.8 MB |
|
|
54.1 KB |
|
/Unicorn Kid - Dream Catcher EP (2010)/ |
|
|
|
8.4 MB |
|
|
8.3 MB |
|
|
8.1 MB |
|
|
8.0 MB |
|
|
5.5 MB |
|
|
109.6 KB |
|
/UNKLE - The Answer [EP] (2010)/ |
|
|
|
20.6 MB |
|
|
16.2 MB |
|
|
12.8 MB |
|
|
12.7 MB |
|
|
12.2 MB |
|
|
11.2 MB |
|
|
29.3 KB |
|
/Untold & Dubbel Dutch - Anaconda & Pulso (SSSSS001) [EP] (2010)/ |
|
|
|
12.6 MB |
|
|
10.7 MB |
|
|
191.6 KB |
|
00-va-anaconda__tribal_guarachero_mix__pulso-(sssss001)-web-2010.nfo |
0.5 KB |
|
/VA - 50 Weapons Of Choice 2-9 (Monkeytown) [CD] (2010)/ |
|
|
|
23.0 MB |
|
|
14.6 MB |
|
|
13.9 MB |
|
|
12.8 MB |
|
|
12.3 MB |
|
|
10.9 MB |
|
|
10.0 MB |
|
|
8.4 MB |
|
|
19.0 KB |
|
/VA - Hard Ass Sessions Volume III (ENDG010) [EP] (2010)/ |
|
|
|
14.2 MB |
|
|
14.0 MB |
|
|
13.8 MB |
|
|
12.2 MB |
|
|
362.8 KB |
|
/VA - Night Slugs EP (DTS012D) (2010)/ |
|
|
|
13.6 MB |
|
|
13.4 MB |
|
|
13.0 MB |
|
|
11.1 MB |
|
|
1.6 KB |
|
|
0.2 KB |
|
|
0.2 KB |
|
/VA - Planet Turbo [EP] (2010)/ |
|
|
|
18.6 MB |
|
|
15.8 MB |
|
|
14.6 MB |
|
05- Chromeo - Don't Turn The Lights On (Carte Blanche Late Nite Mix).mp3 |
10.9 MB |
|
|
9.4 MB |
|
|
166.9 KB |
|
/VA - The Four Feet High EP (2010)/ |
|
|
|
15.9 MB |
|
|
11.8 MB |
|
|
10.8 MB |
|
|
10.3 KB |
|
|
0.1 KB |
|
|
0.1 KB |
|
|
0.1 KB |
|
/Valerna - Look Ma, No Pants! (PLASMADIGI095) [EP] (2010)/ |
|
|
|
14.9 MB |
|
|
14.6 MB |
|
|
315.9 KB |
|
/Van Toth - Van Toth (SNEAK175) [EP] (2010)/ |
|
|
|
17.3 MB |
|
|
15.8 MB |
|
|
14.4 MB |
|
|
216.6 KB |
|
/Vandalism - Throw Your Hands Up EP (2010)/ |
|
|
|
10.6 MB |
|
|
10.3 MB |
|
|
10.1 MB |
|
|
4.7 MB |
|
|
303.6 KB |
|
|
49.5 KB |
|
/Vaski - Hurricane (ROTD027) [EP] (2010)/ |
|
|
|
15.6 MB |
|
|
12.1 MB |
|
|
12.1 MB |
|
|
11.1 MB |
|
|
11.0 MB |
|
|
79.6 KB |
|
|
0.8 KB |
|
/Velour - The Velvet Collection (NS007) [EP] (2010)/ |
|
|
|
16.7 MB |
|
|
12.5 MB |
|
|
11.8 MB |
|
|
11.3 MB |
|
|
340.3 KB |
|
/Vhyce - Voivodine (Ha Ha Ho Hey) (SWEATDS030) [EP] (2010)/ |
|
|
|
15.9 MB |
|
|
14.9 MB |
|
|
13.6 MB |
|
|
11.9 MB |
|
|
10.9 MB |
|
|
328.2 KB |
|
|
45.9 KB |
|
/Villains - Victims [EP] (2010)/ |
|
|
|
12.7 MB |
|
|
12.5 MB |
|
|
11.8 MB |
|
|
11.0 MB |
|
|
152.2 KB |
|
/Visti & Meyland - Stars [EP] (2010)/ |
|
|
|
20.0 MB |
|
|
17.7 MB |
|
02- Visti & Meyland - Stars (The Time Space Machine Remix).mp3 |
15.3 MB |
|
|
62.5 KB |
|
/Visti & Meyland - Yes Maam (All Nite Long) [EP] (2009)/ |
|
|
01- Visti & Meyland - Yes Maam (All Nite Long) (Trentemøller Remix).mp3 |
17.9 MB |
|
04- Visti & Meyland - Yes Maam (All Nite Long) (Kasper Bjørke Remix).mp3 |
17.4 MB |
|
03- Visti & Meyland - Yes Maam (All Nite Long) (Henrik Schwarz Remix).mp3 |
14.8 MB |
|
02- Visti & Meyland - Yes Maam (All Nite Long) (Original Mix).mp3 |
11.3 MB |
|
|
95.8 KB |
|
/Voltage - All Night EP (2010)/ |
|
|
|
17.6 MB |
|
|
16.0 MB |
|
|
15.3 MB |
|
|
14.0 MB |
|
|
13.7 MB |
|
|
12.7 MB |
|
|
11.2 MB |
|
|
134.8 KB |
|
/Voodoo Chilli - Love Songs (CHEAP024) [EP] (2010)/ |
|
|
|
13.3 MB |
|
|
10.8 MB |
|
|
10.4 MB |
|
Voodoo Chilli - Love Songs - His Majesty Andre 'Everybody Spinnin' Remix.mp3 |
9.8 MB |
|
|
310.0 KB |
|
/Wafa - Ewid Disco [EP] (2010)/ |
|
|
05 Ewid Disco (Totally Enormous Extinct Dinosaurs Remix).mp3 |
12.8 MB |
|
|
12.6 MB |
|
|
12.3 MB |
|
|
12.1 MB |
|
|
10.8 MB |
|
|
54.1 KB |
|
/Wazabi - Interplay (GND006) [EP] (2010)/ |
|
|
|
15.1 MB |
|
|
11.0 MB |
|
|
10.5 MB |
|
|
10.4 MB |
|
|
392.1 KB |
|
|
12.9 KB |
|
/Wazabi - Optimus Prime (MPR002) [EP] (2010)/ |
|
|
|
9.8 MB |
|
|
9.2 MB |
|
|
7.6 MB |
|
|
68.6 KB |
|
/We Are Fans - Inferno [EP] (2010)/ |
|
|
|
14.7 MB |
|
|
14.5 MB |
|
|
13.7 MB |
|
|
13.2 MB |
|
|
12.6 MB |
|
|
12.5 MB |
|
|
8.7 MB |
|
|
21.3 KB |
|
/We Love - Underwater_Hide Me Remixes [EP] (2010)/ |
|
|
|
21.8 MB |
|
|
19.8 MB |
|
|
19.0 MB |
|
|
10.8 MB |
|
|
8.9 MB |
|
|
24.9 KB |
|
|
7.3 KB |
|
/Wiley - Electric Boogaloo (Find A Way) [EP] (2010)/ |
|
|
|
15.4 MB |
|
|
10.9 MB |
|
|
10.5 MB |
|
|
9.3 MB |
|
|
9.2 MB |
|
|
6.2 MB |
|
|
33.5 KB |
|
/Will Bailey - Grind (SIM026) [Single] (2010)/ |
|
|
|
12.2 MB |
|
|
238.6 KB |
|
|
2.0 KB |
|
/Wolfgang Gartner - Fire Power (UL2686) [EP] (2010)/ |
|
|
|
16.9 MB |
|
|
16.7 MB |
|
|
35.9 KB |
|
00-wolfgang_gartner_-_fire_power__latin_fever-(ul2686)-web-2010-srg.nfo |
12.7 KB |
|
/Wolfgang Gartner - Illmerica (UL2656) [Single] (2010)/ |
|
|
|
17.8 MB |
|
|
48.1 KB |
|
/Woolfy - Looking Glass (DFA2266) [EP] (2010)/ |
|
|
|
16.5 MB |
|
|
14.0 MB |
|
|
13.3 MB |
|
|
210.3 KB |
|
/World Gone Club Vol. 1 (TBMP3025) [Compilation] (2010)/ |
|
|
|
18.3 MB |
|
|
17.5 MB |
|
|
14.1 MB |
|
|
14.0 MB |
|
|
12.5 MB |
|
|
12.0 MB |
|
|
12.0 MB |
|
|
9.8 MB |
|
|
449.4 KB |
|
/Xinobi - Japanese (DT004) [EP] (2010)/ |
|
|
|
19.9 MB |
|
|
16.0 MB |
|
|
14.5 MB |
|
|
826.4 KB |
|
/Yasmin Le Bon & Marc Benjamin - The Wedding (SNEAK177) [EP] (2010)/ |
|
|
01-yasmin_le_bon_and_marc_benjamin_-_the_wedding_(original_mix)-ume.mp3 |
16.9 MB |
|
02-yasmin_le_bon_and_marc_benjamin_-_the_wedding_(dub_mix)-ume.mp3 |
15.6 MB |
|
|
411.9 KB |
|
00-yasmin_le_bon_and_marc_benjamin_-_the_wedding-(sneak177)-web-2010-ume.nfo |
16.1 KB |
|
/Yelle - La Musique [EP] (KITSUNE120) (2010)/ |
|
|
|
14.7 MB |
|
|
14.0 MB |
|
|
14.0 MB |
|
|
9.2 MB |
|
|
8.9 MB |
|
|
830.9 KB |
|
|
104.8 KB |
|
/Young Hunz (TBMP3020) [EP] (2010)/ |
|
|
|
17.0 MB |
|
|
13.6 MB |
|
|
11.2 MB |
|
|
10.5 MB |
|
|
10.4 MB |
|
|
10.3 MB |
|
|
71.1 KB |
|
/Youngunz One [Compilation] (2010)/ |
|
|
|
14.3 MB |
|
|
12.6 MB |
|
|
12.2 MB |
|
|
10.7 MB |
|
|
10.6 MB |
|
|
8.8 MB |
|
|
326.0 KB |
|
/Zombie Disco Squad - King Kong (PID002) [EP] (2010)/ |
|
|
|
17.1 MB |
|
|
15.8 MB |
|
|
34.9 KB |
|
/Zombie Disco Squad Feat. Spoek - We Should Bang Tonight (DFEP17) [EP] (2010)/ |
|
|
|
18.9 MB |
|
|
16.9 MB |
|
|
16.1 MB |
|
|
207.2 KB |
|
/Zombie Nation - Squeek Overshoot (UKW7853) [EP] (2010)/ |
|
|
|
14.5 MB |
|
|
13.3 MB |
|
|
11.6 MB |
|
|
9.9 MB |
|
|
808.7 KB |
|
/Zombie Zombie - Plays John Carpenter [EP] (2010)/ |
|
|
|
18.4 MB |
|
|
13.7 MB |
|
|
13.2 MB |
|
|
11.4 MB |
|
|
9.3 MB |
|
|
551.2 KB |
|
/Zombies For Money - Sururumba (TBD043) [EP] (2010)/ |
|
|
|
12.1 MB |
|
|
12.1 MB |
|
|
467.2 KB |
|
/ZZT - ZZafrika (TURBO090)/ |
|
|
|
13.4 MB |
|
|
135.6 KB |
|
/ |
|
|
|
0.5 KB |
|
|
0.1 KB |
|
Total files 3930 |
|
Copyright © 2024 FileMood.com
-jamie-my-intentions-are-bass-ep-(2010)-cover.jpg-6-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-11-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-18-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-21-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-26-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-36-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-46-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-51-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-62-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-66-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-72-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-75-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-79-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-86-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-91-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-96-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-101-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-108-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-118-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-123-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-139-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-that-bassline-track-(gdm014)-ep-(2010)-cover.jpg-143-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-148-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-153-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-161-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpeg-164-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-167-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-172-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-back.jpg-178-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-inside.jpg-179-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-front.jpg-180-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-186-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-193-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-201-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-207-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-212-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-219-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-224-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-229-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-233-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-241-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-249-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-254-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-257-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-267-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-276-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-281-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-back.jpeg-292-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpeg-293-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cd.jpeg-294-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-302-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-305-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-309-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-bnrtrax003-(2010)-cover.jpg-314-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-323-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpeg-335-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-341-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-blende-urh-320.mp3.jpeg-346-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.png-354-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-359-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-364-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-368-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-376-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-vinyl-(2010)-cover.jpg-381-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-388-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-394-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-402-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-piazza-venezia-ep-(2010)-cover.jpg-406-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-409-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-413-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-417-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-420-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-436-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-444-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-452-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-457-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-465-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-471-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-478-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-482-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-487-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.png-494-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-497-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-501-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-508-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-512-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cd2-(2010)-cover.jpg-528-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-539-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-545-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-550-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-558-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-565-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-572-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-579-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-586-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-593-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-597-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-600-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-602-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-607-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-611-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-616-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-620-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(methlp013s)-single-(2010)-cover.jpg-623-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-629-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-633-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-640-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-647-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-650-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.png-656-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-661-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-666-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-671-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-678-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-685-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-691-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-696-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-704-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-712-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-728-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-733-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-736-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-742-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-744-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-748-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-755-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-759-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-769-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-774-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-compilation-(2010)-cover.jpg-785-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-793-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-801-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-808-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-810-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-814-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-819-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-825-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-831-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-836-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-839-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-843-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-849-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-859-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-864-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-foktop-logo.jpg-869-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-872-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-878-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-885-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-890-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-894-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-908-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-912-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-915-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-920-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-925-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-931-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-936-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-947-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-953-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-960-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-964-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-969-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-973-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(3beat014x)-ep-(2010)-cover.jpg-977-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2007)-cover.jpg-982-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2008)-cover.jpg-988-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-epic.jpg-991-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-995-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-998-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1006-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(mako004)-the-hole-ep.png-1010-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1016-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1022-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1027-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1034-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1040-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1044-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1049-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1053-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1058-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1060-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1065-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1069-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1077-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1085-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1092-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-www.comolasgrecas.com.jpg-1100-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-eumig-chinon.jpg-1101-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1107-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1111-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.png-1114-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1118-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-2010-cover.jpg-1125-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1134-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1144-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1154-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-back.jpg-1158-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1159-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-1164-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1168-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1172-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1180-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1185-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1190-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-1193-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1196-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-1201-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-front-hq.png-1208-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-back-hq.png-1209-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-1212-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1217-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1222-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-1225-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1233-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1236-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1240-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1248-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1251-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1259-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1262-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-1269-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1277-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1280-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1283-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1286-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(nsdx005)-(2010)-cover.jpg-1292-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1298-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1303-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1316-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1320-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1326-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1335-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover-big.jpg-1341-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1342-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1345-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1348-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1363-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1369-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1375-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1382-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1386-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1392-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-1398-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1402-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1407-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-1416-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1426-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1430-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1437-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1445-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1450-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1457-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-1466-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1471-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1475-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1479-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1483-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1488-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1495-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1499-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1505-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1508-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1513-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(320)-cover.jpg-1517-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1520-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-1524-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1530-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1536-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1540-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1546-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1549-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1554-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-1556-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1562-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1569-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1572-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1579-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1591-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1594-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1603-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1608-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1611-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1616-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1620-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover-big.jpg-1624-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1625-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1629-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1632-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1636-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1640-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1647-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-frontcover.png-1653-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1662-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1667-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-folder.jpg-1670-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1676-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1680-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1688-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1697-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1704-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1710-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1719-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1725-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-(2010)-cover.jpg-1736-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1739-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1742-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1753-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1760-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1766-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1769-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1773-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-1776-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1782-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1787-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1792-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1803-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1808-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1815-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1826-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1832-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1846-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1855-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1861-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-kissed-with-a-noise-ft.-young-buck-watuppp.jpg-1869-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1876-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(sch001d)-remixes-(2010)-cover.jpg-1882-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-1885-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1891-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1900-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1904-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1917-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.png-1924-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1932-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1937-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1941-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1944-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-1951-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-1954-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-1960-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-1963-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1973-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1979-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-1985-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-1998-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2003-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2011-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2019-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2025-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2032-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2040-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2049-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2052-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2057-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2064-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-flush-remixes-(dtil025d)-ep-(2010)-cover.jpg-2072-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2009)-cover.jpg-2077-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2082-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2088-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-folder.jpg-2102-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2103-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2111-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2118-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2126-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2139-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2145-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2150-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.png-2153-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2160-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2167-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2172-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2181-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2188-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2196-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2202-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2212-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2217-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2222-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2234-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-2243-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-front.jpg-2247-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-back.jpg-2248-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2256-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2259-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-2262-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2268-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2273-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2278-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2285-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2289-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2293-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-2299-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2312-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2326-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2331-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2338-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.png-2345-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2356-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2361-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.png-2366-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2369-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover-big.jpg-2375-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2376-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-coverjpg.jpg-2382-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2386-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2390-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2394-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2399-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2009)-cover.jpg-2404-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2411-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2418-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2424-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2427-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2433-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixed-ep-(2010)-cover.jpg-2443-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2452-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-album-(2010)-cover.jpg-2471-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2476-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2483-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2487-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2493-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2503-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2509-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2512-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-2518-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.png-2523-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2527-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2530-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2535-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2543-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2546-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-oliver-s-i-hope-ep-cover.jpg-2551-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2556-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpeg-2563-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2567-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpeg-2573-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2581-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2589-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2594-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2602-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2607-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2612-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2617-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2623-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2631-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2638-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2650-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2654-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2660-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2666-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-2671-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2676-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2683-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2686-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2693-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2699-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2706-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2711-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2718-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-2007-back.jpeg-2721-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-2007-front.jpeg-2722-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2730-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2738-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2744-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2747-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-2750-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2783-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2790-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2797-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2801-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(bew002)-ep-(2010)-cover.jpg-2804-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2810-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2816-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2822-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-riva-starr-feat.-rettore-splendido-front.jpg-2825-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2831-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2838-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-2842-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2846-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-2849-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2855-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover-back.jpg-2856-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2863-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2869-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2874-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2881-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2889-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2893-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2898-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2902-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2907-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2912-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-2920-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2930-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2936-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-2945-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2949-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2954-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2971-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixed-ep-(2010)-cover.jpg-2980-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2984-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2989-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-2995-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3003-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3008-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3011-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3017-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3028-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3031-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover-big.jpg-3034-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3039-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3043-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3046-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-3052-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-compilation-(2010)-cover.jpg-3065-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-folder.jpg-3072-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3079-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3082-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3086-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3095-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3104-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3107-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3109-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-3116-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3120-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-helium-cover.jpg-3126-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-cover.jpg-3130-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-compilation-(2010)-cover.jpg-3146-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3152-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3159-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3165-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3179-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3188-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3193-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3198-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3204-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3207-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3215-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3228-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3233-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3239-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-talk-cover.jpg-3248-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-web-2010-def.jpg-3251-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3256-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3259-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3264-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3269-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3273-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3278-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.png-3285-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-3290-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-3296-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3299-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3303-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3308-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3313-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3318-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3325-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3330-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-new-noise.jpg-3333-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3338-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3343-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3349-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover-back.jpg-3363-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover-front.jpg-3364-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3365-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3370-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-3372-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3378-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3388-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3391-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-3396-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3402-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3405-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-we-re-ready-when-you-are-ep-(2010)-cover.jpg-3410-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-3415-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3420-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.png-3425-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3435-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3440-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3446-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3451-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3456-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3462-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3475-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3485-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3489-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3493-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3500-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3511-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3518-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(dm179)-ep-(2010)-cover.jpg-3521-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3526-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3530-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3534-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3537-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3542-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3550-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover-big.jpg-3569-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-todd-edwards-far-away.jpg-3573-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3579-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-3584-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3592-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3597-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3600-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3605-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3610-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-remixes-ep-(2010)-cover.jpg-3618-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3623-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(pid003)-ep-(2010)-cover.jpg-3626-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3631-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3636-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3645-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3650-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3655-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3659-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(sneak187)-remixes-ep-(2010)-cover.jpg-3662-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3681-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3690-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3694-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3705-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.png-3711-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3718-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3721-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cd-(2010)-cover.jpg-3731-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3736-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3749-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3759-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3763-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3768-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3775-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3781-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(sweatds030)-ep-(2010)-cover.jpg-3787-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3793-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3797-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2009)-cover.jpg-3802-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3810-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3815-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3821-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3826-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3831-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3839-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-coverbig.jpg-3845-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3846-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3853-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-3855-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3859-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-single-(2010)-cover.jpg-3862-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3866-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-compilation-(2010)-cover.jpg-3875-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3879-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3882-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover-big.jpg-3889-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-(2010)-cover.jpg-3890-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3897-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3904-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3907-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3911-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3916-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3922-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-ep-(2010)-cover.jpg-3925-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}
-cover.jpg-3927-34c7b283a37c19522d770570f5f95472bba5aaaa.html){kind=link}